* Your assessment is very important for improving the workof artificial intelligence, which forms the content of this project
Download AP Chemistry Second Semester Notes
Acid–base reaction wikipedia , lookup
Atomic nucleus wikipedia , lookup
Chemical thermodynamics wikipedia , lookup
Coordination complex wikipedia , lookup
Low-energy electron diffraction wikipedia , lookup
Jahn–Teller effect wikipedia , lookup
Gas chromatography–mass spectrometry wikipedia , lookup
Electrolysis of water wikipedia , lookup
X-ray fluorescence wikipedia , lookup
Molecular orbital wikipedia , lookup
Chemical reaction wikipedia , lookup
Molecular Hamiltonian wikipedia , lookup
Bent's rule wikipedia , lookup
Biochemistry wikipedia , lookup
Chemical equilibrium wikipedia , lookup
Computational chemistry wikipedia , lookup
Photoelectric effect wikipedia , lookup
Bioorthogonal chemistry wikipedia , lookup
Photoredox catalysis wikipedia , lookup
Electronegativity wikipedia , lookup
Electrical resistivity and conductivity wikipedia , lookup
Stoichiometry wikipedia , lookup
Equilibrium chemistry wikipedia , lookup
Bond valence method wikipedia , lookup
Metastable inner-shell molecular state wikipedia , lookup
Molecular dynamics wikipedia , lookup
Atomic orbital wikipedia , lookup
Electrochemistry wikipedia , lookup
Marcus theory wikipedia , lookup
Transition state theory wikipedia , lookup
Light-dependent reactions wikipedia , lookup
X-ray photoelectron spectroscopy wikipedia , lookup
Physical organic chemistry wikipedia , lookup
Gaseous detection device wikipedia , lookup
Rutherford backscattering spectrometry wikipedia , lookup
Metalloprotein wikipedia , lookup
Resonance (chemistry) wikipedia , lookup
Molecular orbital diagram wikipedia , lookup
Metallic bonding wikipedia , lookup
History of molecular theory wikipedia , lookup
Electron configuration wikipedia , lookup
Photosynthetic reaction centre wikipedia , lookup
Atomic theory wikipedia , lookup
Hypervalent molecule wikipedia , lookup
AP Chemistry Notes Name __________________________ Instructions: Highlight each line in the notes as you review and understand it. Repeat until all the lines are highlighted. 1B. Atomic Nature of Matter (2.1 to 2.7) 1A. Measurement (1.4 to 1.6) 1. historical perspective 1. uncertainty in measurements a. Dalton's atomic theory (1805) a. data analysis 1. unique, indestructible atoms for each element 1. accuracy = correct (even if inconsistent) is 2. atoms are rearranging, not created during measured by percent difference: chemical change % = 100|mean – true|/true 3. compounds are groups of atoms in fixed ratio b. subatomic structure 2. precision = consistent (even if incorrect) is 1. J. J. Thomson (1897): measure charge-tomeasured by percent deviation (N trials): mass ratio of electrons with cathode rays % = 100 |trial – mean|/N(mean) 2. Millikan (1909): measure electron charge with b. significant figures (sf): all certain (numbered) plus oil drops in a vacuum chamber one estimated value 7.5 cm (2 sf) 3. Rutherford (1910): characterized dense, + c. rules for counting significant figures nucleus with alpha () radiation and gold foil 1. all nonzero digits are significant 2. components of the atom a. subatomic particles 2. zero is sometimes significant, sometimes not Particle Location Charge Mass Symbol a. example: 0.00053000021000 1 p or 1 H Proton nucleus +1 1.0 1 1 never always ? 1 n Neutron nucleus 0 1.0 0 b. (?) decimal vs. no decimal o e Electron outside -1 .00055 -1 1. significant with decimal: 120. (3 sf) b. atomic number (Z) 2. not significant w/o decimal: 120 (2 sf) 1. number of protons 3. exact numbers (metric conversions, counting 2. defines type of atom c. mass number (A) or written numbers) have infinite number of sf 1. protons + neutrons 4. scientific notation: C x 10n 2. isotopes (same Z, different A) a. C contains only significant figures 3. nuclear symbol: AZX 3 b. 1200 with 3 sf: 1.20 x 10 d. ions are atoms where # electrons # protons d. rules for rounding off calculations 1. e > p: (–) charged (anion): Xn1. limited by least accurate measurement 2. e < p: (+) charged (cations): Xn+ e. unified atomic mass unit (u) 2. x, : answer has the same number of sf as 1. 1 u = 1/12 the mass of a C-12 atom the measurement with the fewest 2. average atomic mass (periodic table mass) 3. +, –: answer has same end decimal position a. isotopes have fixed % in natural sample as measurement with left most end position b. 100mav = %1m1 + %2m2 + ... 2. SI measuring system 3. forms of matter a. summary chart a. pure substance has a unique composition of Measurement SI standards Chemistry atoms unique formula and set of properties 1. elements—one type of atom mass kilogram (kg) gram (g) (diatomic: H2, N2, O2, F2, Cl2, Br2, I2) 3 volume cubic meter (m ) liter (L) 2. compounds—two or more types of atoms o temperature kelvin (K) Celcius ( C) a. molecular—formula defines size time second (s) varies b. crystalline—formula shows ratio of atoms b. prefixes system (x 10X) b. mixture of pure substances in an object or container 1. variable composition (no set formula) 1. k3, c-2, m-3, µ-6, n-9 2. uniform: homogenous mixture = solution 2. squared/cubed prefix: 1 cm2 = 1 x (10-2)2 m2 3. non-uniform: heterogeneous 3 3. 1 mL = 1 cm 1C. Radioactivity (21.1 to 21.4) 3 -2 3 3 4. 455 kg x 10 g x (10 ) m = 0.455 g 1. forms of natural radiation m3 1 kg 1 cm3 cm3 Mass # Charge # Stopping 3. mass and volume measure amount of matter Type Symbol (A) (Z) Shield a. density: d = m/V 4 He alpha 4 +2 paper 2 1. units depend on units for m and V 0 e 3 3 beta 0 -1 Al -1 2. dH2O = 1.00 g/mL = 1.00 g/cm = 1000 kg/m 0 e positron 0 +1 destroyed 1 b. number of particles: mole = 6.022 x 1023 particles 0 1. periodic table mass equals formula mass in g gamma 0 0 Pb 0 2. molar mass (MM)—sum of mass of atoms in 2. balancing nuclear reactions using nuclear symbols: AZX chemical formula (use 3 significant figures) balance A and Z values c. conversions (dimensional analysis) determine symbol by Z number 1. mass moles (given formula or MM) 238 U 4 He + 234 Th 92 2 90 __ g x 1 mole/(MM) g = __ mole 3. transmutations 2. volume mass (given density–d) a. induced nuclear reactions by bombardment __ mL x (d) g/1 mL = __ g b. 147N + 42He 178O + 11H 3. volume mass moles (given d and MM) c. produce trans-uranium elements __ mL x (d) g/1 mL x 1 mole/(MM) g = __ mole 4. radioactive decay 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 1s a. rate of decay number of radioactive atoms (Nt) 1 1s 1. rate = kNt (k: rate constant) 2p 2 2s 2. time for half of remaining atoms to decay (t½) 3p 3 3s is constant: t½ = (ln2)/k 3d 4p 4 4s b. ln(No/Nt) = kt or Nt = Noe-kt 4d 5p 5 5s 1. No = original amount 5d 6p 6 6s 2. t and k must have same time units 6d 7p 7 7s 1D. Electron Structure—Bohr Model (6.3 to 6.4) 1. atomic spectrum 4f lanthanide a. emitted by energized atoms (unique for element) 5f actinide -25 J•m/ b. calculations: Ephoton 4. types of diagrams a. electron configuration 1. = wavelength (m) 1. n (#), l (letter), # of electrons (superscript) 2. f = frequency (s-1) = c/ on AP test) Al: 1s22s22p63s33p1 3. Ephoton = hf = hc/ (hc = 2.00 x 10-25 J•m) 2. abbreviated: replace inner (core) electrons with 2. Bohr model—atoms with one electron only noble gas symbol—Al: [Ne]3s23p1 a. energy levels (n) b. orbital diagrams 1. Eelectron = -B/n2 1. electrons (arrows) fill specific orbital 2. for H: En = -2.18 x 10-18 J/n2 2. Hund's rule: maximum # of electrons with 3. ground state (n = 1), E = -B the same electron spin (maximum number of 4. excited state (n > 1), -B < E < 0 half-filled degenerate orbitals) 5. ionization (n = ), E = 0 J Electron 6. Eelectron = En-final – En-initial Orbital Diagram Element # eConfiguration a. Eelectron > 0 when increasing n 1s 2s 2p 3s b. Eelectron < 0 when decreasing n Li 3 1s2 2s1 b. |Eelectron| = Ephoton Be 4 1s2 2s2 2A. Quantum Mechanical Model (6.5 to 6.6) B 5 1s2 2s2 2p1 1. electron’s exact position or velocity is unknowable C 6 1s2 2s2 2p2 a. Heisenberg uncertainty principle b. orbital = 90 % probable location of an electron N 7 1s2 2s2 2p3 2. each electron has four quantum numbers: n, l, ml, ms O 8 1s2 2s2 2p4 a. principal energy levels (n)—defines orbital radius F 9 1s2 2s2 2p5 b. sublevels (l)—defines orbital shape Ne 10 1s2 2s2 2p6 1. l = 0, 1, 2, •••, (n - 1) Na 11 1s2 2s2 2p6 3s1 2. 0 = s, 1 = p, 2 = d, 3 = f c. quantum numbers (arranged by periodic table c. orbital (ml)—defines spatial orientation position) 1. ml = –l, ••• -1, 0, +1, •••, +l n l = 0 l=1 2. number of orbitals: s (1), p (3), d (5), f (7) (s) ms (½, -½) (p) d. spin (ms)—defines magnetic field +½ (), -½ () 1 ½ -½ Pauli Exclusion Principle—no two electrons can 2 ½ -½ ½ ½ ½ -½ -½ -½ l = 2 (n = row # – 1) have the same spin in the same orbital (d) 3 ½ -½ ½ ½ ½ -½ -½ -½ 3. relationship among values of n, l, ml through n = 4 4 ½ -½ ½ ½ ½ ½ ½ -½ -½ -½ -½ -½ ½ ½ ½ -½ -½ -½ n Possible l Sublevel Designation Possible ml 0 0 -2 -1 0 1 2 -2 -1 0 1 2 -1 0 1 -1 0 1 1s 1 0 0 ml 2s 0 0 2 5. column 6 and 11: an s electron moves to the d sublevel 2p 1 -1, 0, 1 to maximize half and/or full orbitals (lower energy state) 3s 0 0 6. electron arrangements in monatomic ions 3p 3 1 -1, 0, 1 a. ions with noble gas structure 3d 2 -2, -1, 0, 1, 2 1. elements that are ± 3 of the noble gas lose or 4s 0 0 gain electrons to reach noble gas electron 4p 1 -1, 0, 1 configuration 4 4d 2 -2, -1, 0, 1, 2 3210 1+ 2+ 3+ 4f 3 -3, -2, -1, 0, 1, 2, 3 N3O2FNe Na+ Mg2+ Al3+ 2B. Electron Arrangements in Atoms and Ions (6.7 to 6.9) 2. ions with the same # of e: isoelectronic 1. electrons fill from low to high energy (same for all atoms) b. transition metal ions a. n: 1 < 2 < 3 < 4 < 5 < 6 < 7 1. transition metal lose s electrons first b. l: s < p < next energy level < d < f 2. may lose d electrons if it eliminates sublevel c. ml and ms: equal energy = degenerate or reduces doubling up 2. outer (valence) electrons—interact with other atoms 7. magnetic properties a. highest occupied principle energy level a. element is magnetic (paramagnetic) if it contains b. s and p sublevels only (maximum 8 electrons) unpaired electrons, whose magnetic fields are 3. inner (core) electrons + nucleus = core charge (+1 to +8) reinforcing respond to external magnetic field 4. organization of the periodic table 4s 3d a. row (period)—same valence energy level (n) [Ar] 26Fe b. column (group)—same # of valence electrons b. elements with all paired electrons (diamagnetic) are 1. main groups (1: alkali metals, 2: alkaline unaffected by magnetic fields (columns 2, 12, 18) earth metals, 17: halogens, 18: noble gases) 2. similar chemical properties 2C. Periodic Properties—Main Groups (7.1 to 7.6) 6. metals, nonmetals and metalloids 1. effective nuclear charge (Zeff) or shielding effect 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 a. atom holds valence electrons because of 1 Metals attraction between atom core and valence shell 2 Metalloids b. atomic core = nucleus + core electrons 3 Nonmetals 1. core charge = Zeff (# p – # core e) 4 2. other valence electrons reduce Zeff because of 5 electron-electron repulsion 6 ? ? 2. atomic size (radius) 7 a. minimum distance between two gas atoms or distance between nuclei in diatomic molecule lanthanide b. group: increase as energy level increases actinide c. period: decrease as Zeff increases from +1 to + 8 a. metals—left side of stair step d. transition metals 1. shiny, conduct heat and electricity, malleable 1. group: increase with energy level and ductile, mostly solids (except Hg) 2. period: no change (Zeff constant) 2. form ionic compounds with nonmetals 3. ionic size (radius) compared to parent atom 3. small positive ionization energy a. smaller cations (lose energy level) 4. positive or small negative electron affinity b. larger anions (more electron-electron repulsion) 5. lose electrons during reactions (alkali metals c. isoelectronic series (± 3 from noble gas) largest are most reactive) (fewest protons) to smallest (most protons) b. nonmetals—right side of stair step and H N3- > O2- > F- > Ne > Na+ > Mg2+ > Al3+ 1. opposite properties to metals 4. ionization energy 2. form molecules in addition to ionic compounds a. E to remove electron from a gaseous atom 3. large positive ionization energy 1. X(g) X+(g) + 1e4. large negative electron affinity except 2. all +E (greater value = harder to ionize) columns 15 and 18 b. inversely proportional to atomic radius (E 1/r) 5. gain or share electrons during reactions except 1. weaker hold on distant electron less noble gases (halogens are most reactive) energy to remove electron c. metalloids—touch stair step except Al 2. anomalies: ionized electron comes from a 1. intermediate properties depending on physical relatively less negative energy level less and chemical conditions energy to reach zero energy (ionization) 2. Po and At classification unresolved a. 13: ionized electron comes from a higher 3A. Bonding (8.1 to 8.4) energy sublevel p vs. s 1. why bond? b. 16: ionized electron comes from a full a. atoms and ions become attached (bonded) orbital (higher energy than ½-filled) because they enter a lower energy state c. successive ionization energies b. complete valence shell = lowest energy state Successive Ionization Energies in kJ/mol 1. metals lose all valence electrons, which uncovers complete valence shell (+ ion) Element I1 I2 I3 I4 2. nonmetals with 5-7 valence electrons gain Na 496 4562*** (core electrons) electrons to complete valence shell (– ion) Mg 738 1451* 7733*** 3 nonmetals share valence electrons with other Al 578 1817** 2745* 11,577*** nonmetals 1. *small increases within a sublevel a. 1-3 valence electrons share 1 for 1 2. **greater increase between sublevels doubling valence number 3. ***greatest increase between energy levels b. 4-7 valence electrons share to fill s and p 5. electron affinity orbitals (8 electrons = octet rule) a. E to add electron to gaseous atom c. Lewis symbols 1. X(g) + 1 e X (g) 1. chemical symbol + dots for valence electrons 2. E = EX X- + Ee2. Na•, •Mg•, etc. a. EX X- > 0 (added electron increases d. three major types of bonds atom's overall energy level) 1. ionic bond: electrostatic attraction between b. Ee- < 0 (added electron's energy cations and anions decreases from zero) 2. covalent bond: shared electrons between c. –E when added electron enters non-metal atoms relatively low-energy orbital (stable anion) 3. metallic bond: metal atoms collectively share d. +E when added electron enters relatively valence electrons high-energy orbital (unstable anion) 4. molecular bonds are NOT true bonds b. electron affinity becomes more negative from left to 2. ionic bonding right because receiving orbital energy decreases a. metal and nonmetal: Na(s) + ½ Cl2(g) NaCl(s) c. anomalies: receiving orbital energy is relatively high (oxidation-reduction reaction) 2: p orbital energy > s orbital energy b. cations and anions: Na+(aq) + Cl-(aq) NaCl(s) 15: full orbital energy > ½-filled orbital energy (precipitation reaction) (electron-electron repulsion raises level) c. bond strength 18: next higher energy level > valence level 1. lattice energy measures E for bonding d. group: little change for next energy level because 2. electrostatic force measures ionic attraction greater orbital volume reduces electron-electron 3. proportional to ionic charges repulsion, which counterbalances reduced core 4. inversely proportional to ionic radii attraction 3. covalent bonding a. bonding atoms' orbitals overlap, which maximizes attraction between nuclei and bonding electrons b. atoms share 2, 4 or 6 electrons 1. 2 (single), 4 (double), 6 (triple) bond 2. multiple bonds reduce bond distance a. bond distance < sum of atomic radii b. shorter bond distance = stronger bond c. polar bond when electrons are not shared equally 1. electronegativity a. measures atom's attraction for bonding electron pair (higher # = stronger) b. relative scale where period 2 elements are 1.0 (Li) to 4.0 (F), with 0.5 intervals 1. noble gases are excluded 2. trend: a. increase across period b. decrease down groups 2. bond polarity a. electronegativity difference between bonding atoms result in uneven sharing of electrons, which generates a partially positive charged side, +, and a partial negative charged side, b. measured as dipole moment 3. bond strength increases with polarity 3B. Lewis Structures (8.5 to 8.7) 1. shows the atoms in a molecule with their bonding and non-bonding electron pairs a. bonding electrons (– single, = double, triple) b. lone (non-bonding or unshared) electron pair (••) 2. drawing Lewis structures with one central atom count the total number of valence electrons (subtract charge for ions) CO2: 4 + 2(6) = 16 IF2–: 7 + 2(7) + 1 = 22 draw a skeleton structure o first element in formula is central, except H o single bonds to other atoms (max. 4) O–C–O [F–I–F]– (ions are bracketed) place electrons around each atom o 8 total electrons o except H, Be and B or when total number of electrons is an odd number .. .. .. .. .. .. :O – C – O: [:F – I – F:]– .. .. .. .. .. .. count Lewis structure electrons (including bonding electrons) o if equal to valence electrons, stop o if valence e- < Lewis e-, add additional bonds to reduces # of electrons by 2's o if valence e- > Lewis e-, add 2 or 4 electrons to central atom (3rd period or higher); called expanded octet .. .. .. .... .. O=C=O [:F – I – F:]– .. .. .. .. .. added bonds expanded octet 3. when more than one Lewis structure is possible use formal charge to decide which is more likely a. each atom is assigned its lone electrons plus half the bonding electrons b. formal charge = valence e- – assigned ec. preferred structure 1. atoms have formal charges closest to zero 2. negative formal charge reside on the more electronegative atom (upper right most on the periodic table) example: NCS[::N=C=S::][:::N–CS:][:NC–S:::]5 4 6 5 4 6 5 4 6 valence e7 4 5 6 4 6 5 4 7 assigned e-2 0 +1 -1 0 0 0 0 -1 formal [::N=C=S::]- is preferred because formal charges are closest to zero and negative charge is on the nitrogen (higher electronegativity) 3C. VSEPR Model (9.1 to 9.3) 1. rules a. maximum separation between electron pairs b. atom positions define molecular geometry c. lone pairs make actual angle < ideal angle 2. polar molecules a. lone electron pairs distort symmetry except for sp3d-linear and sp3d2-square planar b. different perimeter atoms c. polar interactions increase water solubility, increase melting and boiling temperatures, decrease evaporation (volatility) 3. summary chart Domain Bond Molecular (–) (••) Polar? Geometry Angle Geometry o 2 0 Linear 180 Linear no d. 3 0 3 1 4 0 3 1 4 2 5 0 4 1 3 2 2 6 5 Trigonal planar Tetrahedral 120o 109o planar no Bent yes Tetrahedral no pyramidal yes Bent yes bipyramidal no 90o, Seesaw yes 120o T-shaped yes 3 Linear no 0 Octahedral no pyramidal yes 1 Trigonal bipyramidal Octahedral 90o 4 2 planar no 3D. Valence-Bond Theory (9.4 to 9.5) 1. bonding atoms' half filled valence energy level atomic orbitals overlap so that electrons from each atom can simultaneously attract both nuclei (H:H, Cl:Cl) 2. more complex molecules require a fusion of s and p orbitals into equivalent (hybrid) orbitals 1 s + 1 p form 2 sp hybrids (2 e- domains) 1 s + 2 p form 3 sp2 hybrids (3 e- domains) 1 s + 3 p form 4 sp3 hybrids (4 e- domains) 1 s + 3 p + 1 d = 5 sp3d hybrids (5 e- domains) 1 s + 3 p + 2 d = 6 sp3d2 hybrids (6 e- domains) 3. not all valence electrons enter hybrid orbitals a. one electron pair per bond enters a hybrid orbital 1. sigma bond () 2. electrons located between bonding atoms b. lone pairs of electrons enter hybrid orbital c. remaining bonding pairs of electrons from multiple bonds remain in pure p orbitals 1. pi bond () 2. electrons located above/below bonding atoms e. bond electrons can spread out across entire molecule (delocalized) 1. multiple Lewis structures show all possible locations for bonds = resonance forms 2. bond order = sigma bond + share of bonds 3E. Naming Binary Molecules (2.8) 1. two types of nonmetal atoms covalently bonded 2. lower electronegative atom is written first and named as the element 3. second element is given –ide ending 4. prefix used to indicate number of atoms a. 1—mono, 2—di, 3—tri, 4—tetra, 5—penta, etc. b. mono never used for first element 5. exceptions a. common names: NH3 (ammonia), H2O2 (hydrogen peroxide) and H2O (water) b. molecules that begin with H (except H2O) 1. no prefix for H H2S(g) is hydrogen sulfide 2. aqueous acids H2S(aq) is hydrosulfuric acid c. organic molecules 3F. Simple Organic Molecules—Hydrocarbons (25.1 to 25.6) 1. general properties a. contain C and H b. nonpolar, flammable (fuels) 2. formulas and names a. number of carbons in parent chain 1 2 3 4 5 meth eth prop but pent 6 7 8 9 10 hex hept oct non dec b. bond between carbons 1. alkanes (all single bonds) end in “ane” 2. alkenes (1 or more double bonds) 1 double end in “ene”, 2 double end in "diene" 3. alkynes (1 or more triple bonds) end in “yne” 4. cyclical a. 3 to 6 carbon ring with single bonds between carbons: prefix "cyclo" b. 6 carbon ring with 3 shared bonds: benzene (called aromatic hydrocarbon) c. branches 1. C-branches—“yl” 2. benzene branch—"phenyl" 3. location of branches a. number of the parent carbon b. lowest number possible c. dash: # – word, comma: #, # d. number of branches (2—di, 3—tri, etc.) 3. condensed structural formula a. hydrogens are written after the carbon b. branches are in parentheses after hydrogens c. example: 4-ethyl-2-methyl-1-hexene CH2C(CH3)CH2CH(C2H5)CH2CH3 d. semi-condensed (shows branches and bonds) CH3 C2H5 | | CH2=C–CH2–CH–CH2–CH3 4. functional groups a. dramatically modify properties of hydrocarbon b. haloalkanes: halogen replaces one or more H 1. reduces reactivity (flammability) 2. named as a branch with an “o” ending c. oxygen containing groups 1. hydroxyl group (C–O–H): alcohols 2. carbonyl group (C=O) a. aldehydes: C=O on end carbon b. ketones: C=O on interior carbon 3. ethers have C–O–C 4. acids: C(=O)–O–H on end carbon 5. esters: C(=O)–O–C 4. increases polarity: C–O–H > C=O > C–O–C d. amines—NH3 with H replaced with CH3 (weak bases) 5. isomerism a. structural isomers: same molecular formula, different structure and name 1. move double/triple bond position 2. move branch 3. form cycloalkane from alkene b. geometric isomers: same molecular formula, same relative position of carbons and bonds, but different spatial arrangement 1. >C=C< carbons can't rotate a. x>C=C<x : cis b. x>C=C<x : trans three expanded octet geometries show geometric isomerism a. sp3d: trigonal bipyramidal b. sp3d2: square planar and octahedral 4A. Gas State (10.2 to 10.9) 1. tend to be small, non-polar molecules 2. form homogenous mixtures 3. distributed evenly throughout the entire container (molecules typically occupy 0.1 % of the volume) 4. kinetic theory for gases (ideal gas) a. molecules in continuous, chaotic motion, which is proportional to temperature 1. kinetic energy, Kmole = 1/2(MM)v2 = 3/2RT a. R = 8.31 J/mol•K b. MM (molar mass) in kg c. T in kelvin (TK = ToC + 273) 2. root-mean-square speed, u = (3RT/MM)½ 3. Graham’s law a. rate r of effusion (leaking) or diffusion (spreading out) is proportional to speed b. rA/rB = (MMB/MMA)½ b. molecular volume is insignificant compared to container volume (approximation—see real gas) c. collisions produce pressure w/o loss of total kinetic energy d. Bonding between molecules is insignificant (approximation—see real gas) 5. gas laws a. Ideal gas Law equation: PV = nRT 1. molecules generate pressure via collisions a. pressure = force/area b. 1 atm = 101 kPa = 760 mm Hg (torr) c. measuring tools 1. barometer: atmospheric pressure 2. manometer: enclosed gas pressure Pgas = Patm ± h (in mm Hg) 2. gas pressure is affected by: a. n: each molecule exerts pressure more molecules exert more pressure: P n b. T: hotter molecules move faster and collide with greater force generate more pressure: P T c. V: molecules spread out which reduces collision per surface area generate less pressure: P 1/V 3. ideal gas law constant R (V in L, T in K) a. 8.31 J/mol•K (P in kPa) b. 0.0821 atm•L/mol•K (P in atm) 4. molar volume at STP = 22.4 L/mol (standard T = 0oC, standard P = 1 atm) 5. derived equations a. P1V1/T1 = P2V2/T2 b. MM = mRT/PV = dRT/P b. Dalton’s law (P n) 1. Ptot = PA + PB 2. PA = XAPtot , where XA = molA/(molA + molB) 2. real gases a. Van der Waals:(Preal + n2a/V2)(Vreal – nb) = nRT b. "a" corrects for molecular bonding 1. "low" temperature (close to boiling point) molecules clump and collide less often, which generates less pressure Preal < Pideal 2. a is proportional to molecular polarity c. "b" corrects for molecular volume 1. high pressure is generated by crowded molecules where the volume of empty space (Videal) is significantly less than 100 % of the total volume (Vreal) Vreal > Videal 2. b is proportional to molar mass 4B. Phase Change (11.1 to 11.2, 11.4 to 11.6) 1. cohesive forces (van der Waals forces) a. attraction between molecules (covalent bonds hold atoms together in molecule) b. dipole-dipole forces 1. polar molecules 2. of one molecule attracts of a neighbor 3. strength to polarity, if all else is even c. London dispersion forces 1. attraction between nuclei of one molecule's atoms for the electrons in a neighboring molecule causes temporary polarization throughout the liquid or solid (polarizability) 2. generalization a. operates between all molecules (stronger than dipole-dipole for large molecules, i.e. large nonpolar > small polar) b. only force for nonpolar (strength to mass: Xe > He, I2 > F2, C3H8 > CH4) d. hydrogen bonding 1. super strong dipole-dipole force (stronger than dispersion forces) 2. H bonded to N, O or F a. H +1 charge and N, O or F –1 charge because of extreme electronegative difference and small radius b. bonding is ionic like (E Q1Q2/d) 3. explains unusual properties of water a. each water molecule bonds to 4, which makes a 3-d structure with open cavities b. high melting and boiling temperatures c. low vapor pressure (low volatility) 2. cooling profile for water from 110oC to -10oC A 100oC 0 oC Step B-C C-D D-E E B C D E F Heat Removed (J) a. slope C-D < slope E-F more heat is removed when one mole H2O(l) is cooled 1oC compared to one mole H2O(s) b. length B-C > length D-E more heat is removed when one mole H2O(g) H2O(l) compared to one mole H2O(l) H2O(s) c. calculations Process Formula Constants Condensation Q = nHvap Hvap = 40.7 kJ/mol Cl = 75.3 J/mol•K Cooling liquid Q = nClT Freezing Q = nHfus Hfus = 6.01 kJ/mol Cooling solid Q = nCsT Cs = 37.8 J/mol•K 3. phase diagram Pressure 6. Temperature point A: triple point (three phases at equilibrium) 1. below triple point: sublimation 2. above triple point: melting and vaporization b. line A-B: equilibrium vapor-pressure curve for liquid (normal boiling point occurs at 1 atm pressure) c. B: critical point, where there is no distinction between liquid and vapor (no liquid-vapor surface) d. line A-C: equilibrium vapor-pressure curve for solid e. line A-D: melting point of solid at various pressures (normal freezing point occurs at 1 atm) 1. positive slope when solid is the densest phase (melting point increases with pressure) 2. negative slope when liquid is the densest phase (melting point decrease with pressure) vapor a. some surface molecules in the condensed phase have enough kinetic energy (speed) to escape surface (evaporate) below boiling point b. as temperature increases more molecules have sufficient kinetic energy more vapor molecules a. 4. c. cooling process (hottest evaporate first, leaving cooler molecules behind) d. equilibrium between liquid and vapor 1. evaporation rate = condensation rate in a closed container 2. concentration of vapor measured as Pvap 3. independent of container size until no liquid 4. Pvap increases at higher temperature because a. more molecules are in vapor phase b. vapor molecules exert greater pressure e. boiling occurs when Pvap = Patm boiling point decreases with elevation (lower air pressure Patm) f. high Pvap indicates volatility—tendency to evaporate 4C. Crystalline Solids (11.8) Covalent Metallic Molecular Ionic Network ion atom molecule ion Structural Unit metallic covalent molecular ionic Bond name strong weak strong Bond strength variable high low high Melting point variable low low variable high Solubility high low low low Conductivity high low variable low Malleability Cu C, SiO2 H2O NaCl Example 1. metallic—metals only 2. expressing concentration a. attraction between cations and delocalized a. concentration units [ ] 1. mass percent: % = 102(msolute/mtotal) valence electrons (electron sea model) 2. mole fraction: Xsolute = molsolute/moltotal b. melting point: variable ( bond strength) 3. molarity: M = molsolute/Vsolution(L) c. conductivity: free electrons yes 4. molality: m = molsolute/msolvent(kg) d. malleable: non-directional bond yes b. conversion of concentration units e. water solubility: no molecular interactions no determine mass or moles of solute and solvent 2. covalent network—nonmetals w/o H or halogen Unit Assume Conclusion a. atoms covalently bond throughout w/o size limit gsolute = % (different than large molecule) 2 % 10 g solution gsolvent = 100 – % b. melting point: strong bonds high 1 mol solute + nsolute = X c. conductivity: no free electrons no X nsolvent = 1 – X solvent d. malleability: bond highly directional brittle nsolute = M e. water solubility: no molecular interactions no M 1 L solution gsolvent = 1000d – (nsolute)MM 3. molecular—nonmetals often with H and/or halogen nsolute = m a. attraction between + of one with – of another m 1 kg solvent msolvent = 1000 g b. melting point: weak bonds low convert numerator and/or denominator c. conductivity: no free electrons no o mass volume: m = (d)(V) d. malleability: non-directional yes o mass moles: m = (n)(MM) e. water solubility ("like dissolves like") yes/no 3. Separation solute and solvent 4. Ionic—metal plus nonmetals a. filtration: separate solvent from insoluble solute a. attraction between cations and anions b. distillation b. melting point: strong bonds 1. simple: separate solvent from soluble solid c. conductivity: no free electrons no 2. fractional: separate solvent from soluble liquid (fused or dissolved state is conducting) 5B. Colligative Properties (13.5) d. malleability: bond highly directional brittle 1. lower vapor pressure e. water solubility: ion-dipole interaction yes a. solute particles reduce vapor pressure 5A. Solubility (13.1 to 13.4) b. nonvolatile-nonelectrolyte: Pvap = XsolventPosolvent 1. dissolving process c. two volatile liquids: Pvap = XAPoA + XBPoB a. one substance disperses uniformly throughout other 2. higher boiling point and lower freezing point 1. solvent: dissolving medium (usually majority) a. lowered vapor pressure changes Tb and Tf 2. solute: dissolved in a solvent (usually minority) b. Tb = Kbmi, Tf = Kfmi a. ionic or acid = electrolyte (forms ions) 1. m = molality b. number of free ions = i (van't Hoff factor) 2. i c. polar molecules = nonelectrolyte 3. Kb/Kf = molal boiling/freezing point constant 3. solvation (hydration): solute-solvent bonding c. determination of molar mass of non-electrolyte a. cation with side of H2O (O side) solute by freezing pt. depression b. anion with side of H2O (H side) calculate molality: molality = Tf/Kf b. saturated solution calculate molsolute: molsolute = (molality)(msolvent/1000) 1. undissolved solid dissolved solid calculate molar mass: MM = msolute/molsolute 2. solution rate = crystallization rate 3. osmotic pressure 3. maximum amount that dissolves = solubility a. semi-permeable membrane blocks solute c. effect of temperature on solubility b. solvent flows from high [ ] to low [ ] osmosis 1. solvent kinetic energy is used to break solutec. osmotic pressure () = pressure to stop flow solute bonds solute gains energy; solvent d. = MRTi (R = 8.31— in kPa or 0.0821— in atm) lose kinetic energy (cools) 6A. Chemical Reactions (3.1-3.4, 3.7) 2. energy is released when solute-solvent bonds 1. chemical equation form and turns into kinetic energy of solution a. coefficients and subscripts particles (warms up) H2O—subscript refers to # of atom that precedes it 3. H = Esolute-solute + (-Esolute-solvent) 2 H2O—coefficient refers to # of molecules a. when |Esolute-solute| > |Esolute-solvent| b. reactants and products 1. +H (solution cools = endothermic) 1. one directional reaction: reactants products 2. raising T increases solubility 2. equilibrium reaction: "reactants" "products" b. when |Esolute-solute| < |Esolute-solvent| c. conservation of atoms (mass)—Dalton's Theory 1. –H (solution warms = exothermic) CH4(g) + 2 O2(g) CO2(g) + 2 H2O(g) 2. raising T decreases solubility 1C 4O 1C 4H 4. solubility graphs (g solute/100 g H2O) 4H 2O 2O 5. gas solubility generally decreases with (16 g) + (64 g) = (44 g) + (36 g) increased temperature because solution 2. types of chemical reactions depends on solute-solvent bonds, which a. combustion: CH4 + 2 O2(g) CO2(g) + 2 H2O(g) weaken as temperature increases b. aqueous reactions d. effect of pressure upon solubility (gas only) 1. ionic compounds in solution exist as separate 1. solubility increases proportionally to partial ions MX(aq) is M+(aq) + X-(aq) pressure above solution Mg = kPg (Mg = mol/L) 2. usually one ion in a compound is unreacted 2. gas in solution gas in air space more a. unreacted ion = "spectator ion" gas in air space force more into solution b. usually column 1 cations or NO33. only Pg, not Ptot, will increase solubility 3. "net ionic" equation excludes spectator ions 3. calculations based on balanced chemical equations a. coefficients represent moles of formula units b. flow chart Given: A Find: B Grams of Grams of Substance A Substance B MM MM Moles of Moles of Coefficients Substance A Substance B M M Volume of Volume of Solution A Solution B c. model calculations _ g A x 1 mol A x (#) mol B x (MM) g B = _ g B (MM) g A (#) mol A 1 mol B _ L A x (M) mol A x (#) mol B x __1 L B__ = _ L B 1LA (#) mol A (M) mol B 4. limiting reactant (reactant consumed first) and theoretical yield (maximum product made) calculate moles of each reactant available calculate moles of one product based on moles of each reactant smallest = theoretical yield use theoretical yield for remaining calculations excess reactant = mole present – moles used percent yield = 100(actual yield/theoretical yield) 6B. Gravimetric Analysis (3.5) 1. mass percent from formula moles mass for each element (MM x subscript) add masses to get total mass mass % = 100(mass part/total mass) 2. empirical formula convert g (or %) moles divide each mole value by smallest multiple by factor to make all whole numbers whole numbers become subscripts "burning" carbon compounds yield CO2 and H2O o mole C = mole CO2 o mole H = 2 mole H2O o mole O = (mCxHyOz – mC – mH)/16 3. molecular formula (given MM) MM/empirical formula mass = constant multiple each subscript in empirical formula by constant = molecular formula 6C. Volumetric Analysis (4.6) 1. make standard solution from stock moles needed: molestandard = MstandardVstandard o mass of stock powder, m = (molestandard)MM o volume of stock solution, V = (molestandard)/(Mstock) (Mstock)(Vstock) = (Mstandard)(Vstandard) add to volumetric flask filled ¾ full with distilled water dissolve add sufficient distilled water to bring volume to total 2. determine moles of unknown (titration) add standard solution (titrant) to buret o rinse buret with standard solution o clear air pockets o record initial volume (bottom of meniscus) add unknown and indicator to flask add standard solution until color change (equivalence) o touch tip to flask to release hanging drop o record final volume (bottom of meniscus) calculation moles of unknown X o balance equation to determine molX/molT ratio o moles of titrant: molT = (MT)(VT) o moles of unknown: molX = (molT)(molX/molT) o molar mass of unknown: MMX = mX/molX o molarity of unknown: MX = molX/VX 7A. Enthalpy (H): Bond Energy (5.3 to 5.5, 8.8) 1. breaking bonds takes energy chemical system gains bond energy; surroundings lose energy (heat, etc.) 2. forming bonds releases energy chemical system loses energy, surroundings gain energy 3. change in energy called “change in enthalpy”—H a. when energy required to break bonds > energy released to form new bonds, +H (endothermic) 1. products at a higher energy state than reactants (weaker bonds) 2. surroundings lose energy (cool down) b. when energy required to break bonds < energy released to form new bonds, –H (exothermic) 1. products at a lower energy state than reactants (stronger bonds) 2. surroundings gain energy (heat up) 4. thermochemical equation a. chemical equation with H 1. listed to the right of equation 2. included as reactant (endothermic) or product (exothermic) b. H can be used in dimensional analysis process 5. H from calorimetry a. reactants are put in an insulated container filled with water, where heat is exchanged between reactants and water, but no heat is lost b. by conservation of energy: Hreaction = –Qwater 1. Q = mcT for simple coffee cup calorimeter— aqueous reactions a. m = mass of water b. c = specific heat of water (4.18 J/g•K) c. T = change in temperature (Tf – Ti) temperature can stay in oC, since 1 oC = 1 K (don't add 273 to ToC!) 2. Q = (C + mc)T for “bomb" calorimeter C = “bomb constant” accounts for all nonwater components that change temperature 6. H using bond energy (B.E.) data a. energy to break a bond (i.e. C–H) in a diatomic, gaseous molecule, which contains the bond type 1. is approximately the same for any molecule 2. only works for gaseous species 3. positive value (+ B.E.) for breaking bonds b. forming bonds (– B.E.) c. H = B.E.reactants – B.E.products 7B. Entropy (S): Disorder (19.2) 1. atoms/molecules have inherent disorder depending on a. number of atoms—more internal motion = disorder b. spacing of molecules—farther apart = disorder c. speed of molecules—faster = disorder 2. predict increase in disorder for physical changes (+ S) a. spread out: evaporation, diffusion and effusion (solution: spread out solute and solvent (+S), but bond solute-solvent (-S) ?, but usually +S) b. motion: melting and boiling 3. predict increase in disorder for chemical changes (+ S): moles gaseous products > moles gaseous reactants 7C. Thermodynamic Data (5.6 to 5.7, 19.4) 1. standard heat of formation (Hfo) data a. Ho for the formation of one mole of compound from its elements at standard temperature (25oC) b. Hfo for elements in natural state = 0.0 c. more negative = more stable (harder to decompose) 2. standard entropy (So) data a. amount of disorder compared to H+ (simplest form of matter), which is zero by definition b. listed in J/mol•K on AP exam, so you will have to convert to kJ/mol•K for most calculations 3. calculations using the thermodynamic data chart a. altering Hfo 1. opposite sign for the reverse reaction 2. multiply by number of moles (coefficient) b. calculate H for a reaction using Hfo H Ho = Hfoproducts – Hforeactants c. calculate S for a reaction using So S So = Soproducts – Soreactants 7D. Gibbs Free Energy (G): Overall Energy State (19.5 to 19.6) 1. G Ho – TSo 2. determining if a process is spontaneous (G < 0) a. lower potential energy (-H)—chemical reactions b. greater disorder (+S)—physical changes c. depends on temperature 1. threshold temperature (Tthreshold) 2. occurs when G = 0 Tthreshold = Ho/So d. summary chart H S Spontaneous Process (G <0) for temperatures above Tthreshold + + + – at no temperatures – + at all temperatures for temperatures below Tthreshold – – 8A. Reaction Rate (14.1 to 14.4) 1. rate = [A]/t a. A is a general term for reactant or product b. instantaneous rate = slope of [A] vs. t graph c. units depend on units for [ ] and t, but usually M/s d. same reaction rates depend on measured species 2 NO2(g) 2 NO(g) + O2(g) rate = [NO2]/t = -[NO]/t = -2[O2]/t 2. rate law: rate = k[A]n a. k = rate constant 1. depends on reaction (larger k = faster) 2. depends on temperature (k increases with T) b. n = order of reaction (first, second, etc.) c. multiple reactants: rate = k[A]m[B]n (overall order = m + n) d. determined experimentally: process write rate laws for each experiment divide rate laws to cancel out all but one reaction order solve for unknown reaction order repeat for other reactants solve for k e. units for k are Mxt-1, where x = (1 – overall order) 3. summary chart Order 0 1 2 k k[A] k[A]2 rate = kt = [A]o – [A]t ln([A]o/[A]t) 1/[A]t – 1/[A]o t½ = [A]o/2k ln2/k 1/k[A]o [A] vs. t ln[A] vs. t 1/[A] vs. t linear Plot 8B. Collision Model (14.5) 1. effective collision a. sufficient speed to weaken existing bonds b. correct orientation to allow new bonds to form 2. potential energy diagram a. reactant, activated complex and product energies b. activation energy (Ea) 1. Ea = Eactivated complex – Ereactants 2. positive quantity, which depends on nature of reactants, but not temperature or [ ] 3. H = Ea - Ea' (Ea’ for reverse reaction) 3. reaction rate and temperature a. high temperature = faster rate 1. more particles' kinetic energy > Ea 2. more frequent collisions b. relation between k and T 1. graph lnk vs. 1/T is straight line: slope = -Ea/R 2. 2 data points: ln(k1/k2) = (Ea/R)(1/T2 – 1/T1) a. R = 8.31, Ea in J, and T in K b. k1/k2 = rate1/rate2 8C. Reaction Mechanism (14.6 to 14.7) 1. complex reactions occur in steps (elementary reactions), where each step has 1 or 2 reactants with low Ea 2. intermediate forms in early step and is consumed in a subsequent step 3. corresponds to rate law: coefficients of slow step (ratedetermining step) become exponent in rate law 4. catalyst a. catalyst provides a reaction mechanism that has a lower Ea than the noncatalyzed reaction b. homogeneous catalyst 1. consumed in slow step, reappear in fast step 2. example: decomposition of H2O2 step 1: 2 Br- + 2 H+ + H2O2(aq) Br2(aq) + 2 H2O step 2: Br2(aq) + H2O2(aq) 2 Br- + 2 H+ + O2(g) overall: 2 H2O2(aq) 2 H2O + O2(g) a. catalyst: H+ and Br-—included in rate law b. intermediate: Br2—not included c. rate = k[Br-]2[H+]2[H2O2] c. heterogeneous catalyst written over arrow 9A. Oxidation-Reduction Reactions (4.4, 20.1 to 20.2) 1. reactions involve the transfer of electrons (or control of electrons) from substance that is oxidized (reducing agent) to substance that is reduced (oxidizing agent) Electrons Process Agent Lose Oxidation Reducing Agent Gain Reduction Oxidizing Agent 2. oxidation number a. each atom is assigned an oxidation number which represents the number of electrons (compared to a neutral atom) that the atom has control over 1. zero for isolated neutral atom 2. equals ionic charge for monatomic ions b. overall oxidation number for polyatomic species 1. zero for neutral compound or molecule 2. equals ionic charge for polyatomic ion c. assign oxidation numbers to atoms within a molecule or polyatomic ion 1. assign the standard value for the following a. Li+ ...(+1), Mg2+...(+2), Al (+3), F- (-1) b. O (-2) except for peroxides, O22- (-1) c. H (+1) except for hydrides, MHx (-1) 2. determine the missing atom's value by using the total for the compound (see 2b) 3. balancing redox equations assign oxidation to each atom (see 2c) determine oxidized atom (oxidation # increases) and reduced atom (oxidation # decreases) split the reaction into an oxidation half-reaction and a reduction half-reaction eliminate "spectator" ions (ion that doesn't contain atom that changes oxidation number—often cation) balance each half reaction o balance atoms except O and H o balance O, by adding H2O o balance H, by adding H+ o balance charge, by adding e multiply half-reactions to equalize electrons add half-reactions together simplify by reducing H2O and H+ and/or coefficients this process assumes reaction takes place in acid (H+), if in base, add an OH- for each H+ in the final equation (combine H+ and OH- to make water) 4. reduction half reactions of common oxidizing agents a. MnO4- + 8 H+ + 5 e- Mn2+ + 4 H2O b. Cr2O72- + 14 H+ + 6 e- 2 Cr3+ + 7 H2O 5. oxidation of reactive metals a. metal ion with greater Eored takes e- from metal metal + salt salt of metal + new metal Zn(s) + Cu(NO3)2(aq) Zn(NO3)2(aq) + Cu(s) net ionic: Zn(s) + Cu2+ Zn2+ + Cu(s) b. H+ ion takes e- from metal with negative Eored metal + acid salt of metal + hydrogen gas Zn(s) + 2 HCl(aq) ZnCl2(aq) + H2(g) net ionic: Zn(s) + 2 H+ Zn2+ + H2(g) c. hydrogen in water takes electron from column 1 and heavier column 2 metals 2 Na(s) + 2 H2O 2 Na+ + 2 OH- + H2(g) Ca(s) + 2 H2O Ca2+ + 2 OH- + H2(g) 6. redox with metal hydride and water (Hhydride (ox # = –1) reacts with the Hwater (ox # = +1) to form H2 (ox # = 0) NaH(s) + H2O Na+ + OH- + H2(g) CaH2(s) + 2 H2O Ca2+ + 2 OH- + 2 H2(g) 9B. Standard Reduction Potentials Chart (20.4 to 20.6) 1. reduction half reactions a. listed from |greatest| electron affinity to |least| b. 2 H+ + 2 e- H2: Eored = Eoox = 0 V c. Eo measured in volts, 1 V = 1 J/C 1. "o": standard conditions (25oC, 1 atm, 1 M) 2. not proportional to amount of chemical d. oxidation is reverse (Eoox = -Eored) 2. Eo = Eored + Eoox a. Eo > 0 is a spontaneous reaction (reduction listed above oxidation on chart) b. Go = –nFEo (in joules) 1. n: # e- in balanced redox equation 2. F: faraday = 96,500 C/mol ec. voltage under nonstandard conditions 1. Nernst equation: E = Eo – (RTo/nF)lnQ R (8.31), To (298) and F (96,500) are constant E = Eo – (0.0257/n)lnQ 2. Q (quotient) = Product/Reactants a. gas (atm), ions (M) b. solids and liquids excluded 9C. Voltaic (Galvanic) Cell (20.3) spontaneous redox reaction generates voltage electrons flow through wires from oxidation cell to reduction cell anode (–) Voltage > 0 salt bridge cathode (+) porous membrane site of oxidation site of reduction 1. oxidation half cell (– anode) a. reducing agent (|lower| electron affinity) gives up electrons to external circuit (wires) b. anions flow toward anode through salt bridge/ porous membrane to maintain electrical neutrality 2. reduction half cell (+ cathode) a. oxidizing agent (|higher| electron affinity) attract electrons from external circuit (wires) b. cations flow toward cathode through salt bridge/ porous membrane to maintain electrical neutrality 3. predict how change affects standard voltage a. [P] > [R]: E < Eo 1. Nernst equation: -RT/nFlnQ is negative 2. Le Chatelier's Principle: stressed system shifts towards reactants (E decreases) b. size of electrode and chamber: no change c. remove salt bridge: E = 0 9D. Electrolytic Cell (20.9) battery forces non-spontaneous redox reaction by pulling electrons from reducing agent and sending to oxidizing agent anode (+) + Battery – cathode (–) site of oxidation site of reduction 1. Eo < 0 (battery makes up for deficit) 2. oxidation at + anode, reduction at – cathode 3. electrolysis in water solutions (inert electrodes) a. cathode reduction: H2O or cation (which ever one is higher on the standard potential chart) 1. columns 1, 2 or Al3+: 2 H2O + 2 e- H2 + 2 OH2. acid (H+): 2 H+ + 2 e- H2 3. otherwise: Mx+ + X e- M b. anode oxidation: anion or H2O 1. Cl-, Br-, I-: 2 X- X2 + 2 e2. base (OH-): 4 OH- O2 + 2 H2O + 4 e3. otherwise: 2 H2O O2 + 4 H+ + 4 e4. electroplating (transition metal cations coat cathode) a. current, I, measured in amperes (amps—A) 1 A = 1 C/s (coulomb/second) b. mass plated given current, I, and time, t (t) s x (I) C x mol e- x mol Mx+ x (MM) g = __ g 1 s 96,500 C X mol e- 1 mol Mx+ c. time for plating—calculate right to left 10A. The Equilibrium State (15.1 to 15.6) 1. N2O4(g) 2 NO2(g) a. reversible because reactants and products are confined in same state and Ea is relatively small b. reaction rates change as [R] and [P] change until kf[N2O4] = kr[NO2]2 EQUAL REACTION RATES NOT CONCENTRATIONS 2. equilibrium expression a. law of mass action: N2O4(g) 2 NO2(g) kf[N2O4] = kr[NO2]2 K = kf/kr = [NO2]2/[N2O4] b. liquid and solid are not included c. equilibrium constant, K 1. unit-less quantity 2. independent of original concentrations 3. depends on temperature 4. Kc vs. Kp for gaseous systems a. concentration in mol/L, then Kc b. concentration in atm, then Kp c. Kp = Kc x (RT)n(gas)—R = 0.0821 5. size of K and the reactant/product balance a. large K, means [products] > [reactants] b. small K, means [products] < [reactants] 6. if reaction is written backwards, then: K' = K-1 7. if coefficient x factor "n", then K’' = Kn d. adding equilibria: multiply K e. K, Go and Eo 1. equilibrium: GE = EE = 0, but Go and Eo 0 2. "o" [ ] = 1 M and P = 1 atm (not always 298 K) 3. Go = -RTlnK and Eo = (RT/nF)lnK (R = 8.31, T in K, n = moles e-, F = 96,500) 4. when K > 1, then Go < 0, and Eo > 0 10B. Le Chatelier's Principle (15.7) 1. disturbed an equilibrium, system shifts to reduce disturbance 2. analysis of shift using Le Chatelier’s principle a. change amount of reactants 1. [R] causes system to shift away () a. [ ]E of products and added reactant will b. [ ]E of other reactants will 2. decrease reactant: opposite response () 3. value of K remains unchanged b. change amount of products 1. [P] causes system to shift away () a. [ ]E of reactants and added product b. [ ]E of other products will 2. decrease product: opposite response () 3. value of K remains unchanged c. change temperature of the container 1. changing temperature changes forward and reverse reaction rates, which changes the equilibrium position a. T increases endothermic reaction rate more than exothermic reaction rate system shifts in endothermic direction b. T increases endothermic reaction rate more than endothermic reaction rate system shifts in exothermic direction 2. change in equilibrium position = change in K a. shift to the right increases K b. shift to the left decreases K 3. generalization a. endothermic: T K, T K b. exothermic: T K, T K d. change volume of the container 1. generalization: decrease volume: system shifts to the side with the fewer moles of gas (increase volume, shifts toward more moles) 2. V = P shift away from moles of gas V = P shift toward moles of gas 3. adding inert gas does not shift the equilibrium 4. moles gas reactants = products: no response e. catalyst affects rates but not equilibrium position 11A. Ionic Compounds (2.7 to 2.8, 4.2) 1. name and formula a. cations (charge based on periodic table position) 1. named the same as metal (Na+ = sodium) 2. NH4+ (ammonium), H3O+ (hydronium) 3. assume all transition metals are 2+ a. use Roman numeral for multiple cations b. important exceptions: Cr3+, Ag+ b. anions 1. –ide ending a. monatomic: Cl- (chloride) b. binary: OH- (hydroxide), CN- (cyanide) 2. oxyanion (–ate and –ite ending) C2H3O2acetate MnO4permanganate 2CO3 carbonate NO3nitrate CrO42chromate PO43phosphate Cr2O72dichromate SO42sulfate a. use "bi" prefix when H is added to anion: HCO3- (bicarbonate). HSO4- (bisulfate) b. use "ite" suffix when one O is removed: SO32- (sulfite), NO2- (nitrite) c. when non-oxygen atom is a halogen: ClO4ClO3ClO2ClOperchlorate chlorate chlorite hypochlorite c. empirical formula (criss-cross method) 2. predicting solubility Anions (X) Cations (M) NO3- Cl-, Br-, I- SO42- OH-, S2- Others Alkali Metal S S S S S NH4+ S S S S S Sr2+,Ba2+ S S I S I Ag+ S I S I I Hg22+, Pb2+ S I I I I Others S S S I I 11B. Solubility Equilibrium (17.4-17.5) 1. ionic compound (salt) equilibrium with its ions a. MmXn(s) m Mn+(aq) + n Xm-(aq) b. Ksp = [Mn+]m[Xm-]n (Ksp or mass action expression) 11C. Factors that Affect Solubility (17.5) 1. common ion effect: less soluble with common ion 2. addition of acid: more soluble in H+ (except Cl-, SO42-) 3. formation of complex ions: Cu2+ + 4 CN- Cu(CN)42Kf = [Cu(CN)42-]/[Cu2+][CN-]4 4. determine equilibrium position: Koverall = K1 x K2 > 1 5. amphoterism: some metal oxides and hydroxides are soluble in both strong acid and strong base 12A. Acids and Bases (16.1 to16.11) 1. three theories a. Arrhenius: acid (H+), base (OH-): H+ + OH- H2O b. Brønsted-Lowry: acid (HA), base (:B-): H+ transfer c. Lewis: acid (M+) base (:B-): electron pair transfer 2. acids a. neutral molecule made from H+ + anion = HA b. name based on anion name 1. –ide anion: acid name is Hydro___ic acid 2. –ate anion: acid name is ___ic acid 3. –ite anion: acid name is ___ous acid c. when A- is Cl-, Br-, I-, NO3-, ClO3-, ClO4, SO421. % ionization = [H+]/[HA]o x 100 = 100 % 2. strong acid = strong electrolyte d. when A- is any other ion—weak acid (electrolyte) 1. % ionization < 5 % 2. organic acids, HC2H3O2 or CH3COOH 3. A- is oxyanion, HXOy (HClO, HBrO2, H2SO3) a. H is bonded to O b. weaker O-H bond = stronger acid 1. electronegativity (HClO > HBrO) 2. oxygen (HClO2 > HClO) c. nonmetal oxides: CO2 + H2O H2CO3 e. polyprotic acids (HxA)—first H+ is easiest to remove from neutral molecule than from anions f. acid dissociation/ionization 1. HA(aq) H+ + A2. Ka = [H+][A-]/[HA] = [H+]2/[HA] 3. acid strength: (larger Ka = stronger acid) 4. polyprotic acids (HxA) a. H2A H+ + HA-: Ka1 = [H+]2/[H2A] b. HA- H+ + A2-: Ka2 = [H+][A2-]/[HA-] [HA-] = [H+] ka2 = [A2-] 3. bases a. hydroxides (:OH-) 1. soluble: column 1, Ca2+, Sr2+, Ba2+ = strong 2. oxides: M2O(s) + 2 H2O 2 M+ + 2 OHb. ammonia or amines (:NH3, :NH2CH3, etc.) NH3(aq) + H2O NH4+ + OHKb = [NH4+][OH-]/[NH3] = [OH-]2/[NH3] c. anions from weak acids (:A-) A- + H2O HA(aq) + OHKb = [HA][OH-]/[A-] = [OH-]2/[A-] 4. autoionization of water: H2O H+ + OHa. Kw = [H+][OH-] = 1 x 10-14, [H+] = [OH-] = 1 x 10-7 M b. pH scale 1. pH = -log [H+], pOH = -log[OH-] 2. pH + pOH = pKW = 14 5. pH of ionic compounds (salts) in water—hydrolysis Strong Acid polyprotic anion Others Strong Base neutral acidic basic Others acidic acidic ? 6. acid/base reactions a. Arrhenius neutralization reaction (produces H2O) 1. HA + MOH: H+ + OH- H2O 2. HA + M2O: 2 H+ + Na2O(s) 2 Na+ + 2 H2O b. Brønsted-Lowry proton transfer reaction 1. stronger acid + base weaker acid + base 2. examples (conjugate pairs) acid + base acid + base K HA + H2O H3O+ + A1/Ka H3O+ + A HA + H2O Ka H2O HA + OH+ A1/Kb H2O + A HA + OHKb -14 Ka x Kb = Kw = 1 x 10 3. amphiprotic: can act as a proton donor and proton acceptor, depending on other reactant 12B. Buffer Systems (17.2) 1. mixture of weak acid or base with its conjugate 2. addition of strong acid or base to buffer a. addition of acid: A- + H+ HA(aq) b. addition of base: HA(aq) + OH- A- + H2O c. process is reversible, but not equilibrium 3. determine [H+] or [OH-] after addition of acid or base determine original moles of HAo, A-o o no-HA = Vsolution x [HA]o o n-o-A = Vsolution x [A-]o determine moles of H+ or OH- added o nH+ = (VH+)(MH+) o nOH- = (VOH-)(MOH-) calculate equilibrium moles of HAE and A-E o nE-HA = no-HA – nOH- or no-HA + nH+ o nE-A = no-A + nOH- or no-A – nH+ calculate [H+] or [OH-] o moles buffer > moles H+/OH-: [H+] = Ka(nHA/nA-) o moles buffer < moles H+/OH [H+] = (nH+ – no-A)/Vtot [OH-] = (nOH- – no-HA)/Vtot 12C. Acid-Base Titration (17.3) 1. acid or base is added to a fixed amount of base or acid a. pH is monitored using a pH meter 1. equivalence: nH+MaVa = nOH-MbVb 2. end point when indicator changes color b. buffered solution during incomplete neutralization 2. graphs a. equivalence: middle of vertical section (pH = 9) b. buffer region: mini-plateau (10 mL to 40 mL) 3. [H+] or [OH-] calculation chart 1. SA + SB 2. WA + SB 3. WB + SA [H+] = [H+] = [OH-] = initial [HA] (Ka[HA])½ (Kb[B])½ buffer [H+] = [H+] = [OH-] = (2 and 3) (nHA - nOH-)/Vtot Ka(nHA/nA-) Kb(nB/nHB+) [H+] = [OH-] = [H+] = equivalence 1 x 10-7 M (Kb[A-])½ (Ka[HB+])½ [OH-] = [OH-] = [H+] = excess (nOH- - nHA)/Vtot (nOH- - nHA)/Vtot (nH+ - nB)/Vtot 1. 2. 3. 4. 5. 6. Equilibrium Problems Determine direction ( or from [ ]o substitute [ ]o into equilibrium expression = Q if Q > K, then , if Q < K, then example: Determine if a precipitate will form, given [ ]o (precipitate when Q > Ksp. no precipitate when Q < Ksp) Determine K, given [ ]E: write expression, substitute [ ]E and solve for K Determine K, given [ ]o and one [ ]E [] A + 2B C + 3D [A]o [B]o [C]o [D]o I C -x -2x x = [C]E – [C]o 3x E [A]o - x [B]o – 2x [C]E [D]o + 3x write expression, substitute [ ]E and solve for K example: Determine Ksp, given solubility (s) [] MmXn m Mn+ + n Xm0 0 I +m•s +n•s C m•s n•s E example: Determine Ka, given pH or [H+]E and [HA]o [] HA H+ + A[HA]o 0 0 I C –[H+]E +[H+]E +[H+]E E [HA]o – [H+]E [H+]E [H+]E example: Determine Kb, given pOH or [OH-]E and [B]o [] B + H 2O HB+ + OH[B]o 0 0 I +[OH-]E +[OH-]E C –[OH-]E [OH-]E [OH-]E E [B]o Determine one [ ]E, given other [ ]E and K write expression, substitute [ ]E and solve for missing [ ]E Determine [ ]E, given [ ]o and K [] A + 2B C + 3D [A]o [B]o [C]o [D]o I -x -2x +x +3x C [A]o – x [B]o – 2x [C]o + x [D]o + 3x E write expression, substitute [ ]E and K, solve for x, substitute x and solve for [ ]E example: Determine solubility (mol/L) “s”, given Ksp [] MmXn m Mn+ + n Xmn+] 0 or [M 0 or [Xm-]o o I +m•s +n•s C m•s n•s or [Xm-]o E 2 3 (MX: Ksp = s , MX2: Ksp = 4s , MX3: Ksp = 27s4) example: Determine [H+]E, given [HA]o, [A-]o and Ka [] HA H+ + A[HA]o 0 0 or [A-]o I C –x +x +x x x or [A-]o E o (x < 5%) example: Determine [OH-]E, given [HA]o, [A-]o and Kb [] A+ H2O HA + OH[A ]o 0 or [HA]o 0 I +x +x C –x x or x [A-]o E [HA]o Determine [A-]o/[HA]o given [HA]o/[A-]o pHE/pOHE and Ka/Kb given Ka [] HA H+ + A[HA]o 0 x I C –[H+]E +[H+]E +[H+]E [H+]E E [HA]o x given Kb [] A+ H2O HA + OH[A ]o x 0 I +[OH-]E +[OH-]E C –[OH-]E E [A-]o x [OH-]E