* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
Download Today*s topic is*11 letters long
Survey
Document related concepts
Transcript
+ 1. Catalyst Take out your HW! Complete the chart: Macromole cule Monomer Polymer Objectives I can name and describe the four macromolecules and their monomers or building blocks. I can explain why carbon can form so many different molecules. Protein Carbohydrat e Nucleic acid Agenda Catalyst Macromolecule Bingo Organic Chemistry Video and Reading Exit Slip: Macromolecules + What do all these molecules have in common? Glucose – a monosaccharide Lysine – an amino acid Triglyceride – a lipid Guanine – a nucleotide + Macromolecules Bingo Macromolecule isomer Polymer functional group Monomer saturated hydrocarbon Carbohydrate unsaturated hydrocarbon Protein amino acid Nucleic acid nucleotide Lipid triglyceride Hydrocarbon monosaccharide Alkane disaccharide Alkene polysaccharide Alkyne condensation reaction Peptide bond polypeptide + a very large molecule; the four types are proteins, carbohydrates, lipids, and nucleic acids. the nucleic acid monomer; small molecules that are linked together to form RNA or DNA macromolecule characterized by inability to dissolve in water; fats and steroids are examples; store energy and are cell membranes organic compound made of one or more long chains of amino acids; key component of all cells a simple sugar that is the basic subunit of a carbohydrate; carbohydrate monomer + one of the carbohydrates made up of long chains of simple sugars; ex: starch, glycogen, cellulose; sugar polymer a long chain of several amino acids; protein polymer hydrocarbon containing only single bonds organic compound composed of only hydrogen and carbon the portion of a molecule that is active in a chemical reaction and that determines the properties of many organic compounds + Chemical species with the same chemical formula of another molecule but a different shape chemical bond that forms between the carboxyl group of one amino acid and the amino group of another amino acid : lipid molecule formed by bonding three fatty acids to a glycerol molecule small similar or identical molecules that are often linked together to form large long chains called polymers a large molecule that is formed by more than five monomers or small units an organic compound, either RNA or DNA, whose molecules are made of one or two chains of nucleotides and carry genetic information + any organic compound that is made of carbon, hydrogen, and oxygen and that provides energy/nutrients to cells chemical reaction in which two or more molecules combine to produce water or another simple molecule organic compound of hydrogen and carbon with at least one double or triple bond sugar formed from two monosaccharides; ex: sucrose, maltose, lactose macromolecule characterized by inability to dissolve in water; fats and steroids are examples; store energy and are cell membranes + O-Chem! Hydrocarbons http://www.planete-energies.com/en/energy-sources-/oiland-gas/oil-and-gas-deposits/formation-of-deposits-8.html Focus Question: What is the relationship between oil and gas and living things? + Organic Chemistry Reading Activity Expectations: Read individually or with a partner Answer all questions on a separate sheet of paper. Use complete sentences. Tools: Article, Notes Day 1, Textbook Tonight’s HW: p.704 #8, 15; p. 706 #43, p. 742 #33, 34; p. 743 #43 – 48 (reading graphs) + Exit Slip 1. What are the names of the four macromolecules? 2. What is the difference between a monomer and a polymer? 3. Give an example of the monomer and polymer for one of the macromolecules. 4. When propane (C3H8) is burned for fuel, what type of chemical reaction is this? Write the chemical reaction equation. 5. Identify the repeated sequence in the following molecule: … CH(NH3)CH2CH(NH3)CH2CH(NH3)CH2CH…