Survey
* Your assessment is very important for improving the workof artificial intelligence, which forms the content of this project
* Your assessment is very important for improving the workof artificial intelligence, which forms the content of this project
Dr. Steward’s Quiz #1 1. Use the following condensed structure to draw a Lewis structure and skeletal structure. CH3COOC(CH3)2CCOCH2NBrCHO 2. Determine how each of the structures below is related to the following structure: same molecule, constitutional isomer, or neither. isomer neither isomer same neither neither neither 3. For each of the following determine the number of carbons, hydrogens, heteroatoms, and lone pairs of electrons. C’s: __7__ HA’s: __1__ C’s: __11_ HA’s: __2__ C’s: __12_ HA’s: __1__ H’s: __14__ Lone Pairs: __0__ H’s: __12_ Lone Pairs: __4__ H’s: __17_ Lone Pairs: _2___ 4. Draw two resonance structures for the structure provided. Show curvy arrows to show how you determined the structures. Note: The lone pair(s) suggested by the formal charge are not shown. Place any lone pairs in the original and subsequent structures. Rank the structures above in terms of: major contributor, minor contributor, and very minor contributor. Explain your reasoning. Major: 3rd structure. Full octets, only one formal charge, negative charge on most electronegative atom. Minor: 2nd structure. Full octets, only one formal charge, negative charge not on most electronegative atom. Very Minor: 1st structure. One incomplete octet. Most formal charges. 5. Give the approximate bond angles around the following atoms: 1: _180°_ 2: _120°_ 4: _180°_ 5: _120°_ 3: _109.5° 6. Determine the hybridization of each of the labeled atoms in the structure below. sp sp3 sp3 sp3 sp sp2 7. Answer the questions concerning bonding using the following structure: Using bonds 1, 2, and 3: Which bond is the longest? __3___ Which bond is the strongest? __2___ a b c Using bonds a, b, and c: 2 3 1 Which bond is the shortest? __a____ Explain why the three single bonds a, b, and c are not the same length. Using all bonds How many bonds are formed from sp-sp2 overlap? __1___ How many bonds are formed from sp2-sp3 overlap? __1___ How many total pi bonds are in the structure? __3___ 8. Using skeletal structures, draw as many alcohols as possible with the formula C4H10O. 9. Using skeletal structures, draw as many ethers as possible with the formula C4H10O.