Survey
* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
Download Supplementary 1: Model details
Document related concepts
no text concepts found
Transcript
Supplementary 1: Model details Reactions Flux Name Reactions E.C. no Gene Name KEGG BioCyc Seo et al. Yang et al. Alanine and aspartate metabolism Alanine and aspartate metabolism Alanine degradation I Alanine degradation I, alanine biosynthesis I * * ** ** *** *** **** **** * ** *** **** Gene Loci Pathway ZMO0144 ZMO1683 Ala1 Ala2 Ala3 Ala4 asp-L + h2o + o2 -> oaa + nh3 + h2o2 asn-L + h2o -> asp-L + nh3 ala-D + h2o <-> nh3 + pyr ala-L <-> ala-D 1.4.3.16 3.5.1.1 5.1.1.1 nabB ybiK dadA dadX Alcohol4 etoh + nad <-> acald + nadh 1.1.1.1 adhB/adhA ZMO1236, ZMO1596, ZMO1722 Alcohol Degradation * ** *** **** Alcohol3 Alcohol1 Alddeg2 Alddeg1 etoh + h2o2 <-> acald + 2 h2o h2o + nad + gcald <-> nadh + glyclt lgt-S + h2o <-> gthrd + lac-D lgt-S <-> mthgxl + gthrd 1.11.1.6 1.2.1.21 3.1.2.6 4.4.1.5 cat aldA gloB gloA ZMO0918 Alcohol Degradation Alcohol Degradation Aldehyde Degradation Aldehyde Degradation * ** *** **** * ** ** *** *** **** **** altcarb3 altcarb1 altcarb2 Cofact15 atp + glyc -> adp + glyc3p + h ru5p-D <-> ara5p glyclt + q8 -> glx + q8h2 amet + precorrin-1 <-> ahcys + precorrin-2 2.7.1.30 5.3.1.13 2.1.1.107 cysG ZMO0006, ZMO1271 Cofact16 uppg3 + amet <-> precorrin-1 + ahcys 2.1.1.107 cysG ZMO0006, ZMO1271 Arg22 Cofact17 Arg24 Cofact18 Arg23 rna2 ametam + ptrc <-> 5mta + spmd glyc-R + atp <-> 3pg + adp orn-L <-> co2 + ptrc 2 glx <-> co2 + 2h3oppan amet <-> ametam + co2 tyr-L + trnatyr + atp <-> tyrtrnatyr + ppi + AMP trnamet + met-L + atp <-> mettrnamet + ppi + AMP 2.5.1.16 2.7.1.31 4.1.1.17 4.1.1.47 4.1.1.50 6.1.1.1 speE glxK lysA ilvl speD tyrS 6.1.1.10 metG rna3 ZMO1592 ZMO0759 ZMO0030, ZMO0760, ZMO0761, ZMO1721 Alternate Carbon Metabolism Alternate Carbon Metabolism Alternate Carbon Metabolism Amines and Polyamines Metabolism ** ** ** *** **** Amines and Polyamines Metabolism ** *** **** *** *** **** **** *** **** *** **** ZMO1643 Amines and Polyamines Metabolism Amines and Polyamines Metabolism Amines and Polyamines Metabolism Amines and Polyamines Metabolism Amines and Polyamines Metabolism Aminoacyl-tRNA Charging ZMO1092 Aminoacyl-tRNA Charging ZMO0059 ZMO1020 **** * ** ** ** ** ** ** ** rna1 atp + ser-L + trna(Ser) <-> AMP + ppi + sertrnaser 6.1.1.11 serS ZMO0986 Aminoacyl-tRNA Charging * ** *** **** rna4 trna(Asp) + asp-L + atp <-> asptrnasp + ppi + AMP 6.1.1.12 aspS ZMO0715 Aminoacyl-tRNA Charging * ** *** **** rna5 trnagly + gly + atp <-> glycyl-trnagly + ppi + AMP 6.1.1.14 glyS,glyQ ZMO1444, ZMO1446 Aminoacyl-tRNA Charging * ** *** **** rna6 atp + pro-L + trna(Pro) <-> AMP + ppi + protrnapro 6.1.1.15 proS ZMO0460 Aminoacyl-tRNA Charging * ** *** **** rna7 trnacys + cys-L + atp <-> cystrnacys + ppi + AMP 6.1.1.16 cysS ZMO0186 Aminoacyl-tRNA Charging ** *** **** rna8 trnaGlu + glu-L + atp <-> glutrnaglu + ppi + AMP 6.1.1.17 gltX ZMO0900, ZMO1964 Aminoacyl-tRNA Charging ** *** **** rna9 trnaarg + arg-L + atp <-> argtrnaarg + ppi + AMP 6.1.1.19 argS ZMO0843 Aminoacyl-tRNA Charging ** *** **** rna10 atp + trnatrp + trp-L <-> AMP + ppi + trp-Lyltrnatrp 6.1.1.2 trpS,trpS2 ZMO1640 Aminoacyl-tRNA Charging ** *** **** rna11 atp + phe-L + trna(Phe) <-> AMP + ppi + phetrnaphe 6.1.1.20 pheS ZMO1513, ZMO1514 Aminoacyl-tRNA Charging * ** *** **** rna12 atp + his-L + trna(his) <-> AMP + ppi + histrnahis 6.1.1.21 hisS Aminoacyl-tRNA Charging * ** rna13 trnathr + thr-L + atp <-> thrtrnathr + ppi + AMP leu-L + trnaleu + atp <-> leutrnaleu + ppi + AMP trnaile + ile-L + atp <-> L-isoleucyl-trnaile + ppi + AMP 6.1.1.3 thrS ZMO0765 Aminoacyl-tRNA Charging ** *** **** 6.1.1.4 leuS ZMO1435 Aminoacyl-tRNA Charging ** *** **** 6.1.1.5 ileS ZMO0323 Aminoacyl-tRNA Charging ** *** **** rna16 trnalys + lys-L + atp <-> L-lysyl-trnalys + ppi + AMP 6.1.1.6 yjeA ZMO0890 Aminoacyl-tRNA Charging ** *** **** rna17 atp + ala-L + trna(Ala) <-> AMP + ppi + LAlanyl-trna 6.1.1.7 alaS ZMO0845 Aminoacyl-tRNA Charging * ** *** **** rna18 trnaval + val-L + atp <-> L-valyl-trnaval + ppi + AMP 6.1.1.9 valS ZMO1878 Aminoacyl-tRNA Charging * ** *** **** tca15 arg20 arg18 arg19 arg15 accoa + glx + h2o -> coa + h + mal-L 5mtr + atp -> 5mdr1p + adp + h 5mta + h2o -> 5mtr + ade 5mdr1p <-> 5mdru1p 2 atp + gln-L + h2o + hco3 -> 2 adp + cbp + glu-L + 2 h + pi 2.3.3.9 2.7.1.100 3.2.2.16 5.3.1.23 6.3.5.5 *** **** arg16 arg17 arg21 dkmpp + 3 h2o -> 2kmb + formate + 6 h + pi 5mdru1p -> dkmpp + h2o 2kmb + glu-L -> akg + met-L rna14 rna15 carB/carA ZMO1617, ZMO1618 * Anaplerotic reactions Arginine and Proline Metabolism Arginine and Proline Metabolism Arginine and Proline Metabolism Arginine and Proline Metabolism ** ** ** ** Arginine and Proline Metabolism Arginine and Proline Metabolism Arginine and Proline Metabolism ** ** ** **** arg1 arg2 glu-L + acorn <-> acglu + orn-L acgald + nadp + pi <-> acglu-p + nadph 2.3.1.35 1.2.1.38 argC ZMO0923 ZMO0804 Arginine biosynthesis II (acetyl cycle) Arginine biosynthesis II (acetyl cycle), arginine biosynthesis III, ornithine biosynthesis arg3 acorn + akg <-> glu-L + acgald 2.6.1.11 argD ZMO0408 arg4 acglu + atp <-> acglu-p + adp 2.7.2.8 argB arg5 accoa + glu-L <-> coa + acglu 2.3.1.1 arg6 arg7 acorn + h2o <-> ac + orn-L argsuc <-> arg-L + fum ** ** *** *** **** Arginine biosynthesis II (acetyl cycle), arginine biosynthesis III, ornithine biosynthesis ** *** **** ZMO1494 Arginine biosynthesis II (acetyl cycle), arginine biosynthesis III, ornithine biosynthesis ** *** **** argA ZMO0923 Arginine biosynthesis II (acetyl cylcle), argininine biosynthesis III, orthinine biosynthesis * ** *** **** 3.5.1.16 4.3.2.1 argE argH ZMO1770 * ** ** *** **** **** arg8 asp-L + citr-L + atp <-> argsuc + ppi + AMP 6.3.4.5 argG ZMO1036 * ** *** **** arg9 orn-L + akg <-> glu-L + glu5sa 2.6.1.13 oat arg10 succgluald + nad + h2o <-> sucglu + nadh + 2 h arg-L + succoa <-> coa + succarg-L sucorn + akg <-> succgluald + glu-L 2 nh3 + sucorn + co2 -> succarg-L + 2 h2o o2 + 34dyphelac <-> cmcald h2o + nad + bald <-> nadh + benzoate + 2 h h2o + cmcald + nad <-> 5c2hm + nadh 4-hydroxybald + nadp + h2o <-> phbz + nadph h2o + nadp + bald <-> nadph + benzoate ethylp + h2o <-> pi + etoh h2o + alltn <-> alltt ophenlac <-> co2 + bald hbenzf <-> hbald + co2 4h2ktp <-> succald + pyr 2hhdiene + h2o <-> 4h2ktp 1.2.1.71 astD ZMO1272 Arginine degradation II * ** *** **** 2.3.1.109 2.6.1.81 3.5.3.23 1.13.11.15 1.2.1.28 1.2.1.60 1.2.1.7 astA argD astB hpaD gabD hpaE gabD ZMO0657 Arginine degradation II Arginine degradation II Arginine degradation II Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation * ** ** *** **** *** **** 1.2.1.7 3.1.3.1 3.5.2.5 4.1.1.7 4.1.1.7 4.1.2.4.2.1.- gabD phoD allB ilvB ilvB arg11 arg12 arg13 aro4 aro11 aro5 aro1 aro12 aro10 aro15 aro13 aro2 aro7 aro8 Arginine biosynthesis III Arginine biosynthesis IV , L-citrulline-nitric oxide cycle , arginine biosynthesis II (acetyl cycle) , arginine biosynthesis III Arginine biosynthesis IV , L-citrulline-nitric oxide cycle , arginine biosynthesis II (acetyl cycle) , arginine biosynthesis III * Arginine degradation I (Arginase pathway), proline biosynthesis V (From arginine), Lcitrulline biosynthesis, arginine biosynthesis IV ZMO1172 ZMO0938 ZMO1146 Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation Aromatic Compounds Degradation ** * ** ** ** ** * ** ** ** ** ** ** ** *** **** *** aro14 Rmandelate <-> Smandelate 5.1.2.2 yfkB/rspA ZMO1228, ZMO1264 Aromatic Compounds Degradation * ** *** aro3 S4hmnd <-> R4hmnd 5.1.2.2 ykfB ZMO1228, ZMO1264 Aromatic Compounds Degradation * ** *** aro9 ala5 5c2hm <-> 5c2o3ene gln-L + asp-L + atp + h2o <-> glu-L + asn-L + ppi + AMP 5.3.3.10 6.3.5.4 hpaF asnB ala6 oaa + glu-L <-> akg + asp-L 2.6.1.1 aspC but6 but7 but5 but4 but1 but3 but2 glyc23 carb4 carb6 carb9 carb8 carb1 carb12 carb7 carb11 carb3 carb14 carb2 carb5 carb10 carbx5 butal + h + nadh <-> butol + nad butal + h + nadph <-> butol + nadp btcoa + h + nadh <-> butal + coa + nad cncoa + h + nadh <-> btcoa + nad alac -> acin + co2 Rhbtcoa <-> cncoa + h2o 3hbtcoa <-> Rhbtcoa 2pg <-> pep + h2o udpg + 2 nad + h2o <-> 2 nadh + udpglcur hproly + nad <-> hprol + nadh + h 14aDg(n+1) <-> glycogen adpglc + 14aDg(n) <-> adp + 14aDg(n+1) kdo8p + pi <-> pep + ara5p + h2o atp + fru <-> adp + f6p g1p + atp + h -> adpglc + ppi CTP + kdo <-> ppi + ckdo udpg + ppi <-> utp + g1p h2o + ppi <-> 2 pi ru5p-D <-> xu5p-D udpgal <-> udpg g1p <-> g6p lac-D + nad <-> pyr + nadh 1.1.1.1.1.1.1.2.1.10 1.3.99.2 4.1.1.5 4.2.1.55 5.1.2.3 4.2.1.11 1.1.1.22 1.8.1.4 2.4.1.18 2.4.1.21 2.5.1.55 2.7.1.4 2.7.7.27 2.7.7.38 2.7.7.9 3.6.1.1 5.1.3.1 5.1.3.2 5.4.2.2 1.1.1.28 carbx3 carbx4 carbx7 carbx2 carbx1 env1 env4 env3 accoa + enz6dly <-> coa + aclipoly formate + accoa -> pyr + coa 2hacgth + h2o <-> gthrd + lac-D h2o + acgam6p <-> gam6p + ac acnam <-> nacmsam + pyr h2o + udcpdp -> h + pi + udcpp alaala + atp + ugmh -> adp + h + pi + uamp 2 ala-D + atp <-> adp + alaala + h + pi 2.3.1.12 2.3.1.54 3.1.2.6 3.5.1.25 4.1.3.3 3.6.1.27 6.3.2.15 6.3.2.4 Aromatic Compounds Degradation Asparagine biosynthesis III ZMO0342 Aspartate degradation II, glutamate degradation II, aspartate biosynthesis ZMO1771 ZMO1771 Butanoate Metabolism Butanoate Metabolism Butanoate Metabolism Butanoate Metabolism Butanoate metabolism Butanoate Metabolism Butanoate Metabolism C1 Compound Utilisation and Assimilation Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carbohydrates Metabolism Carboxylates Degradation eno ugd lpdA glgB glgA kdsA yajF yebC kdsB celA ppa rpe ZMO0941 pgm ldhA/lhdA ZMO1608 ZMO0819 ZMO0512 aceF pfl gloB nagA dapA ZMO0510 ZMO1570 ZMO0759 ZMO0962 ZMO1488 ZMO1719 ZMO0153 ZMO1489 ZMO1767 ZMO1507 ZMO0018 ZMO0256, ZMO1237 ZMO1115 ddl ZMO0834 Carboxylates Degradation Carboxylates Degradation Carboxylates Degradation Carboxylates Degradation Carboxylates Degradation Cell Envelope Biosynthesis Cell Envelope Biosynthesis Cell Envelope Biosynthesis ** ** * *** **** *** *** * * * * * * * * * * * ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** *** *** *** **** **** **** *** *** *** *** *** *** *** **** **** *** **** *** *** *** *** **** **** **** **** *** **** **** **** **** **** env15 env19 env16 env9 env20 env8 env10 env11 env7 env21 env6 env12 env17 1.1.1.158 2.3.1.157 2.4.1.227 2.5.1.7 2.6.1.16 2.7.1.66 2.7.8.13 5.1.1.3 5.3.1.8 5.4.2.10 5.4.2.8 6.3.2.10 6.3.2.13 murB glmU murG murA glmS bacA mraY murI manA gpm exoC murF murE ZMO0833 ZMO0498 ZMO0831 ZMO1724 ZMO0056 env18 env13 env14 env22 uamr + nadp <-> uaccg + nadph + h gam1p + accoa <-> acgam1p + coa + h napdc + uacgam <-> udpnappu + UDP + h uacgam + pep <-> uaccg + pi f6p + gln-L <-> glu-L + gam6p undecaprenol + atp <-> udcpp + adp uamp + udcpp <-> napdc + UMP glu-L <-> glu-D man6p <-> f6p gam1p <-> gam6p man1p <-> man6p ugmh + alaala + atp <-> uamp + pi + adp atp + uamag + 26DAP-m <-> adp + pi + ugmh atp + 2 ala-D <-> adp + pi + alaala ala-L + uamr + atp <-> uama + pi + adp + h uama + glu-D + atp <-> uamag + pi + adp + h utp + acgam1p + h -> ppi + uacgam Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis * * * * * 6.3.2.4 6.3.2.8 6.3.2.9 2.7.7.23 ddl murC murD glmU ZMO0834 ZMO0832 ZMO0829 ZMO0498 Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis Cell Structure Biosynthesis / Carbohydrates Metabolism * chor1 chor2 chor3 chor4 chor5 chor6 chor7 tca1 tca6 tca9 tca2 skm + nadp <-> 3dhsk + nadph + h skm3p + pep <-> 5eskm3p + pi pep + e4p + h2o <-> 2DDA7P + pi atp + skm <-> adp + skm3p 3dhq <-> h2o + 3dhsk 2DDA7P <-> 3dhq + pi 5eskm3p <-> pi + chor accoa + h2o + oaa -> cit + coa + h oxalosucc + nadp <-> akg + co2 + nadph succald + h2o + nadp <-> succ + nadph pyr + enzn6ly <-> aclipoly + co2 1.1.1.282 2.5.1.19 2.5.1.54 2.7.1.71 4.2.1.10 4.2.3.4 4.2.3.5 4.1.3.7 1.1.1.42 1.2.1.16 1.2.4.1 aroE aroA aroF/G/H aroL/K aroD aroB aroC ZMO1796 ZMO0187 ZMO0594 ZMO0737 ZMO0593 ZMO1693 Chorismate Biosynthesis Chorismate Biosynthesis Chorismate Biosynthesis Chorismate Biosynthesis Chorismate Biosynthesis Chorismate Biosynthesis Chorismate Biosynthesis Citrate Cycle (TCA) Citric Acid Cycle Citric Acid Cycle Citric Acid Cycle * * ** ** ** ** ** ** ** citC gabD/ssdA aceE ZMO0544 ZMO1754 ZMO1605, ZMO1606 tca3 2thippi + enzn6ly <-> aclipoly + thmpp 1.2.4.1 aceE ZMO1605, ZMO1606 Citric Acid Cycle * ** tca4 tca7 tca5 succ + fad <-> fadh2 + fum cit <-> ac + oaa succ + coa + atp <-> succoa + adp + pi 1.3.99.1 4.1.3.6 6.2.1.5 sdhC ZMO0487 sucC/D ZMO0569 ZMO0487 ZMO0567, ZMO1481 Citric Acid Cycle Citric Acid Cycle Citric Acid Cycle * * * tca8 tca10 succoa + nadh + co2 <-> nad + coa + akg mal <-> fum + h2o 4.2.1.2 sucB fumA/B/C Citric Acid Cycle Citric Acid Cycle / Generation of Precursor Metabolites and Energy * ZMO0828 ZMO1197 ZMO1233 ZMO1002 ZMO0339 ZMO0827 ZMO0826 ZMO1307 * * * ** ** ** ** ** ** ** ** ** ** ** ** ** * ** ** * * * ** ** *** *** *** *** *** **** **** **** **** **** *** *** *** *** *** *** *** **** **** *** *** *** *** **** **** **** *** *** *** *** *** *** **** **** **** **** **** **** *** *** *** **** **** **** *** **** *** *** *** **** **** *** **** **** **** **** **** tca11 tca12 tca13 tca14 cofact7 icit-D + nadp -> akg + co2 + nadph oaa + accoa + h2o <-> cit + coa cit <-> cis-aconitate + h2o cis-aconitate + h2o <-> icit-D 4r5au + db4p -> dmlz + 2 h2o + pi 1.1.1.42 2.3.3.1 4.2.1.3 4.2.1.3 2.5.1.9 citC gltA acnA acnA ZMO0544 ZMO1963 ZMO0543 ZMO0543 ZMO0475 Citric Acid Cycle / Respiration Citric Acid Cycle / Respiration Citric Acid Cycle / Respiration Citric Acid Cycle / Respiration Cofactor and Prosthetic Group Biosynthesis * * * * ** ** ** ** ** *** *** *** *** *** **** **** **** **** **** cofact3 6hmhpt + atp -> 6hmhptpp + amp + h 2.7.6.3 folK ZMO1647 Cofactor and Prosthetic Group Biosynthesis *** **** cofact6 gtp + h2o -> ahdt + formate 3.5.4.16 ZMO0326/folE ZMO1229 Cofactor and Prosthetic Group Biosynthesis *** **** cofact4 dhpmp + h2o -> dhnpt + pi 3.6.1.- ZMO0013 ZMO0574, ZMO0865, ZMO1417, ZMO1562, ZMO1644, ZMO1646, ZMO1921 Cofactor and Prosthetic Group Biosynthesis *** cofact5 ahdt + h2o -> dhpmp + h + ppi 3.6.1.- ZMO0013 ZMO0574, ZMO0865, ZMO1417, ZMO1562, ZMO1644, ZMO1646, ZMO1921 Cofactor and Prosthetic Group Biosynthesis *** cofact1 asp-L + fum -> iasp + succ Cofactor and Prosthetic Group Biosynthesis ** cofact2 4abz + 6hmhptpp -> dhpt + h + ppi Cofactor and Prosthetic Group Biosynthesis ** cofact8 5aprbu + h2o -> 4r5au + pi Cofactor and Prosthetic Group Biosynthesis ** cofact9 ru5p-D -> db4p + formate + h Cofactor and Prosthetic Group Biosynthesis ** cofact68 pant-R + nadp <-> 2dhp + nadph + h 1.1.1.169 apbA Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact29 5aprbu + nadp <-> nadph + 5apru + h 1.1.1.193 ribD ZMO0476 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact49 2cmery4pi + nadp <-> dxyl5p + nadph 1.1.1.267 dxr ZMO1150 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact47 h2mb4p + nadh <-> dmethppi + nad + h2o 1.17.1.2 lytB ZMO0875 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** *** cofact48 h2mb4p + nadph <-> dmethppi + nadp + h2o 1.17.1.2 lytB ZMO0875 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact50 h2mb4p + nadh <-> ipdp + nad + h2o 1.17.1.2 lytB ZMO0875 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact51 h2mb4p + nadph <-> ipdp + nadp + h2o 1.17.1.2 lytB ZMO0875 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact46 h2mb4p + pds <-> 2cmer24cp + pdt 1.17.7.1 gcpE ZMO0180 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** cofact73 precorrin-2 + nad <-> nadh + shcl 1.3.1.76 cysG ZMO0006, ZMO1271 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** cofact42 cpppg3 + o2 + 2 h <-> pppg9 + 2 co2 + 2 h2o 1.3.3.3 hemN ZMO0951 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact55 o2 + asp-L -> h2o2 + iasp 1.4.3.16 nadB ZMO0144 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** folate8 mlthf + nad <-> methf + nadh 1.5.1.15 folD Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** folate9 5mthf + nadp <- mlthf + nadph + h 1.5.1.20 metF ZMO1747 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact80 dhf + nadph + h -> thf + nadp 1.5.1.3 dhfrIII ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact81 dhf + nadh + h -> thf + nad 1.5.1.3 dhfrIII ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** folate1 thf + 2 nadp <-> Folate + 2 nadph + 2 h 1.5.1.3 folA ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** folate2 thf + nad -> Folate + nadh 1.5.1.3 folA ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** folate3 dhf + nadp <-> Folate + nadph + h 1.5.1.3 folA ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** folate4 dhf + nad -> Folate + nadh + h 1.5.1.3 folA ZMO0321 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** folate10 mlthf + nadp <-> methf + nadph + h 1.5.1.5 folD ZMO0914 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * cofact14 nad + nadph <-> nadh +nadp 1.6.1.1 lpd cofact40 gthrdox + nadph + h -> nadp + 2 gthrd 1.8.1.7 gor cofact41 gthrdox + nadph -> 2 gthrdrd + nadp 1.8.1.7 cofact11 trdrd + nadp <-> trdox + nadph 1.8.1.9 ** Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** ZMO1211 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** gor ZMO1211 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis trxB ZMO1142 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis *** *** **** * *** **** * *** **** cofact45 dmmq8 + amet <-> ahcys + mq8 2.1.1.- dlpA ZMO0017 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** folate7 ser-L + thf -> mlthf + gly + h2o 2.1.2.1 glyA ZMO1201 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact64 mlthf + 3mob + h2o <-> thf + 2dhp 2.1.2.11 panB ZMO1952, ZMO1970 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact19 pmcoa + ala-L <-> co2 + coa + 7k8apg 2.3.1.47 bioF ZMO1917 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact13 gthrd + h2o <-> cysgly + glu-L 2.3.2.2 ggt ZMO1388 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact58 nicrnt + ppi + co2 <-> pyr23dcboyl + prpp 2.4.2.19 nadC ZMO1870 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact70 grdp + ipdp <-> ppi + ttfrdp 2.5.1.10 ispA ZMO0855 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact84 2a78dh4hoxy6pte + 4abz <-> ppi + dhpt 2.5.1.15 folP ZMO1006 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact90 4mpetz + 2mahmp <-> thmmp + ppi 2.5.1.3 thiE ZMO0332 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact10 atp + met-L + h2o <-> pi + ppi + amet 2.5.1.6 metK ZMO0273 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact86 h2o + 4 ppbng <-> 4 nh3 + hmbil 2.5.1.61 hemC ZMO1903 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact57 iasp + dhap <-> pi + 2 h2o + pyr23dcboyl 2.5.1.72 nadA Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact30 2 dmlz<-> ribflv + 4r5au 2.5.1.9 ribE ZMO0475 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact20 amet + 7k8apg <-> sade4m2obut + 78dapg 2.6.1.62 bioA ZMO1918 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact53 4c2me + atp <-> 2p4c2me + adp 2.7.1.148 ipk ZMO1182 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact61 nad + atp <-> nadp + adp 2.7.1.23 ZMO1329 ZMO1329 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact25 atp + dpcoa <-> adp + coa 2.7.1.24 coaE ZMO0040 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact31 atp + ribflv <-> adp + FMN 2.7.1.26 ribF/C ZMO0322 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact26 pnto-R + atp <-> 4ppan + adp 2.7.1.33 coaA ZMO1867 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact91 atp + 4ahmmp <-> adp + 4ampm 2.7.1.49 thiD Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** * * cofact92 atp + 4mhetz <-> adp + 4mpetz 2.7.1.50 thiE Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis resp15 atp + ppi <-> adp + PPPi 2.7.4.1 ppk ZMO0712 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis resp16 atp + pi <-> adp + ppi 2.7.4.1 ppk ZMO0712 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis cofact93 atp + thmmp <-> adp + thmpp 2.7.4.16 thiL ZMO1553 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis cofact94 atp + 4ampm <-> adp + 2mahmp 2.7.4.7 thiD ZMO1003 cofact85 atp + 6h78dhpn <-> AMP + 2a78dh4hoxy6pte 2.7.6.3 folK cofact59 atp + nicrnt <-> ppi + deamido-nad 2.7.7.18 cofact32 atp + FMN <-> ppi + fad cofact66 ** * ** *** **** ** *** **** * ** *** **** Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** ZMO1647 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** nadD ZMO1662 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** 2.7.7.2 ribF/C ZMO0322 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** atp + pan4p <-> ppi + dpcoa 2.7.7.3 coaD ZMO0854 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact52 2cmery4pi + CTP <-> 4c2me + ppi 2.7.7.60 ispD ZMO1128 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * *** **** cofact67 apo-[acp] + coa <-> pap + ACP 2.7.8.7 acpS ZMO1709 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis *** **** cofact22 dtbt + sulfur + 2 amet <-> btn + 2 met-L + 2 5'-dad-2 2.8.1.6 bioB ZMO0094 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis *** **** cofact23 dtbt + sulfur <-> mcdtbt 2.8.1.6 bioB ZMO0094 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact24 mcdtbt<-> btn 2.8.1.6 bioB ZMO0094 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact62 h2o + nadp <-> nad + pi 3.1.3.2 phoC ZMO0061, ZMO0130 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact63 ncammnu + h2o <-> pi + ncamr 3.1.3.5 ZMO0985 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact37 Cys-Gly + h2o <-> cys-L + gly 3.4.11.2 pepN ZMO1345, ZMO1776 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact75 GTP + h2o <-> formate + 78dhnpte3tpi 3.5.4.16 folE ZMO1229 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact33 3 h2o + GTP <-> ppi + dpyrpi + formate 3.5.4.25 ribA ZMO0474, ZMO1698 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact34 dpyrpi + h2o <-> 5apru + nh3 3.5.4.26 ribD ZMO0476 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** ** * * cofact74 h2o + methf <-> N10fthf 3.5.4.9 cofact76 78dhnpte3tpi + h2o <-> dhpmp + ppi cofact77 folD ZMO0914 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** 3.6.1.- ZMO0574, ZMO0865, ZMO1417, ZMO1562, ZMO1644, ZMO1646, ZMO1921 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** dhpmp + h2o <-> 78neop + pi 3.6.1.- ZMO0574, ZMO0865, ZMO1417, ZMO1562, ZMO1644, ZMO1646, ZMO1921 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** cofact27 r4phopncys-L <-> pan4p + co2 4.1.1.36 dfp ZMO1190 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** cofact43 uppg3 <-> cpppg3 + 4 co2 4.1.1.37 hemE ZMO1998 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** cofact78 78neop <-> gcald + 6h78dhpn 4.1.2.25 folB Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact79 4adcho <-> 4abz + pyr 4.1.3.38 pabC Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact87 2 5-amino-levulinate <-> 2 h2o + ppbng 4.2.1.24 hemB ZMO1879 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** cofact88 hmbil <-> uppg3 + h2o 4.2.1.75 hemD ZMO1902 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** cofact54 2p4c2me <-> 2cmer24cp + CMP 4.6.1.12 ygbB ZMO1128 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * cofact44 ppp9 + fe2 <-> heme 4.99.1.1 hemH ZMO0303 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * cofact72 shcl + fe2 <-> sheme + 2 h 4.99.1.4 cycG ZMO0006, ZMO1271 cofact89 llnate <-> S4a5opnt 5.4.3.8 cofact12 chor <-> ichor cofact56 nh3 + atp + deamido-nad <-> AMP + ppi + nad * **** **** **** **** *** **** ** *** **** Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** argD Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** 5.4.4.2 trpE Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** 6.3.1.5 nadE ZMO0899 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** cofact65 pant-R + atp + ala-B <-> pnto-R + ppi + AMP 6.3.2.1 panC ZMO1971 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact69 plac + ala-B <-> pnto-R 6.3.2.1 panC ZMO1971 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact82 atp + dhpt + glu-L <-> adp + pi + dhf 6.3.2.12 folC ZMO0582 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** folate5 atp + 10fthf + glu-L <-> adp + pi + 10fthfglu 6.3.2.12 folC ZMO0582 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** cofact38 atp + glu-L + cys-L <-> adp + pi + glucys 6.3.2.2 gsh ZMO1556 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis * ** *** **** cofact39 gly + atp + glucys <-> gthrd + pi + adp 6.3.2.3 gshB ZMO1913 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact28 4ppan + cys-L + CTP <-> r4phopncys-L + ppi + CMP 6.3.2.5 dfp ZMO1190 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** folate11 N5-formyl-ThF + atp <-> methf + adp + pi 6.3.3.2 ZMO0215 ZMO0215 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** cofact21 atp + 78dapg + co2 <-> adp + pi + dtbt 6.3.3.3 bioD ZMO1915 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** folate6 atp + formate + thf <-> adp + pi + N10fthf 6.3.4.3 fhs ZMO0454 Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** *** **** cofact60 atp + deamido-nad + gln-L + h2o <-> AMP + ppi + nad + glu-L 6.3.5.1 nadE Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact83 gln-L + chor <-> glu-L + 4adcho 6.3.5.8 pabA/B Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact35 ru5p-D <-> formate + 34d2but4p ribB Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact36 db4p + 5a6rpmd <-> 2 h2o + pi + 67dl ribH Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact95 air <-> 4ampm thiC Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cofact97 23ddhb + nad <-> nadh + 23dhb + h Cofactors, Prosthetic Groups, Electron Carriers Biosynthesis ** cyst1 cyst2 ser-L + accoa <-> acser + coa acser + h2s <-> cys-L + ac 2.3.1.30 2.5.1.47 cysE cysK / M ZMO1730 ZMO0748, ZMO0821 cysteine biosynthesis I cysteine biosynthesis I ** ** *** *** **** **** cyst3 3sala + akg <-> glu-L + 3spyr 2.6.1.1 ybdL ZMO0342 cysteine degradation I ** *** **** cyst8 cyst9 cyst4 3 h2o + h2s + 3 nadp <-> 5 h + 3 nadph + so3 paps + trdrd -> 2 h + pap + so3 + trdox suchms + h2o <-> 2obut + succ + nh3 1.8.2.2 1.8.4.8 2.5.1.48 Cysteine Metabolism Cysteine Metabolism Cysteine metabolism ** ZMO0007 *** **** metB * * ** **** cyst7 atp + gtp + h2o + so4 -> aps + gdp + pi + ppi 2.7.7.4 ZMO0004, ZMO0005 cyst6 cyst5 altcarb6 h2o + pap -> amp + pi ser-L <-> acryl + h2o octanoate + atp + coa <-> octcoa + AMP + ppi 3.1.3.7 4.3.1.17 6.2.1.3 sdaB ZMO0704 pur1 pur2 cofact98 2dr5p <-> acald + g3p 2dr1p <-> 2dr5p ichor + h2o <-> 23ddhb + pyr 4.1.2.4 5.4.2.7 3.3.2.1 deoC deoB entB/dhbB/AMO1840 ed1 pgl <-> dgp + h2o 4.2.1.12 edd fa32 fa33 fa34 gpl2 gpl3 fa10 fa22 fa4 fa5 fa6 fa7 fa8 fa9 fa25 fa26 fa27 fa28 fa29 fa30 fa31 fa19 fa18 fa11 fa12 fa13 fa14 fa15 fa16 hddcoa + nad <-> 3oddcoa + nadh httdcoa + nad <-> 3ottylcoa + nadh hhdeccoa + nad <-> 3ohexdeccoa + nadh sn-glyc3p + nad <-> nadh + dhap sn-glyc3p + nadp <-> nadph + dhap tdecenacp + nadh <-> palmACP + nad acACP + nad <-> dec2enoylacp + nadh + h but2enoylacp + nadh <-> butACP + nad hex2enoylacp + nadh <-> hexACP + nad oct2enoylacp + nadh <-> octACP + nad dec2enoylacp + nadh <-> dcACP + nad ddecenacp + nadh <-> ddcaACP + nad tdeACP + nadh <-> myrsACP + nad btcoa + fad <-> fadh2 + t2enoylcoa hexadeccoa + fad <-> thdecencoa + fadh2 octcoa + fad <-> oct2enoylcoa + fadh2 dodeccoa + fad <-> ddecencoa + fadh2 ttdeccoa + fad <-> ttdec2enoylcoa + fadh2 hexcoa + fad <-> hex2enoylcoa + fadh2 deccoa + fad <-> dec2enoylcoa + fadh2 accoa + ACP <-> coa + aacp malcoa + ACP <-> malACP + coa ddcaACP + malACP -> 3ottylACP + co2 + ACP butACP + malACP -> 3ohexACP + co2 + ACP hexACP + malACP -> 3ooctACP + co2 + ACP octACP + malACP -> 3odylACP + co2 + ACP dcACP + malACP -> 3oddcaACP + co2 + ACP myrsACP + malACP -> 3ohdACP + co2 + ACP 1.1.1.35 1.1.1.35 1.1.1.35 1.1.1.94 1.1.1.94 1.3.1.9 1.3.1.9 1.3.1.9 1.3.1.9 1.3.1.9 1.3.1.9 1.3.1.9 1.3.1.9 1.3.99.3 1.3.99.3 1.3.99.3 1.3.99.3 1.3.99.3 1.3.99.3 1.3.99.3 2.3.1.38 2.3.1.39 2.3.1.41 2.3.1.41 2.3.1.41 2.3.1.41 2.3.1.41 2.3.1.41 fadB fadB fadB gpsA gpsA fabI fabI fabI fabI fabI fabI fabI fabI ZMO0485 ZMO0485 ZMO0485 ZMO0485 ZMO0485 ZMO0485 ZMO0485 ZMO0189 ZMO0758, ZMO1887 ZMO0368 ZMO1905 ZMO1905 ZMO1692 ZMO1692 ZMO1692 ZMO1692 ZMO1692 ZMO1692 ZMO1692 ZMO1692 0 fabD fabH/fabF fabH/fabF fabH/fabF fabH/fabF fabH/fabF fabH/fabF ZMO1223 Cysteine Metabolism Cysteine Metabolism Cysteine metabolism Degradation/Utilization/Assimilation Other * Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism **** *** **** **** ** Deoxyribose Phosphate Degradation Deoxyribose Phosphate Degradation Enterobacterial Common Antigen Biosynthesis Enterobacterial Common Antigen Biosynthesis *** ** ** ** * * * * * * * * * * * * * * * * * * ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** *** *** **** *** *** *** *** *** *** *** *** *** *** **** **** **** **** **** **** **** **** **** **** *** **** **** **** **** **** **** **** fa20 fa21 fa23 gpl4 co2 + aacp -> malACP aacp + malACP -> aaacp + co2 + ACP acACP + malACP <-> co2 + ACP + actacp lppdat + acACP <-> pdate + ACP 2.3.1.41 2.3.1.41 2.3.1.41 2.3.1.51 fabB fabB fabB plsC gpl5 gpl7 gpl1 CTP + pdate <-> ppi + CDP-diacylglyc 2 L1pgly <-> cardiolipin + glyc etoh + glyc3p <-> h2o + g3pe 2.7.7.41 2.7.8.3.1.4.46 cdsA cls glpQ/ugpQ ZMO1151 ZMO0314 ZMO0168, ZMO0170 Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism * gpl6 fa39 fa35 ppser <-> peam + co2 3hdecoylacp <-> dec2enoylacp + h2o hexadecanoate + atp + coa <-> hexadeccoa + AMP + ppi 4.1.1.65 4.2.1.60 6.2.1.3 psd mad ZMO0704 ZMO1160 Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism * fa3 fa1 atp + bccpd + co2 <-> adp + pi + cbbtn-BCCP BCCP(monomer) + btn + atp <-> ppi + AMP + bccpm 6.3.4.14 6.3.4.15 accC birA ZMO0735 ZMO1868 Fatty Acid Metabolism Fatty Acid Metabolism * * fa17 atp + accoa + hCO3- <-> adp + pi + malcoa 6.4.1.2 accA ZMO0583, ZMO0599, ZMO0735 Fatty Acid Metabolism * fa2 accoa + cbbtn-BCCP <-> malcoa + bccpd 6.4.1.2 accD ZMO0583, ZMO0599, ZMO0735 Fatty Acid Metabolism * altcarb9 resp14 sbt-D + nad <-> fru + nadh + h 2pglyclt + h2o <-> glyclt + pi 1.1.1.14 3.1.3.18 gph ZMO0497, ZMO1805 Fructose and mannose metabolism Generation of Precursor Metabolites and Energy * altcarb7 pi + oaa <-> pep + h2o + co2 4.1.1.31 ppc ZMO1496 Generation of Precursor Metabolites and Energy * glu1 2 glu-L + nadp <- gln-L + akg + nadph + h 1.4.1.13 gltB ZMO1116, ZMO1117 Glutamate biosynthesis I, glutamine degradation II * glu3 co2 + nadh + accoa <-> coa + nad + mald 1.2.1.18 gabT glutamate degradation IV, 4aminobutyrate degradation II,I ** glu2 akg + ala-B <-> glu-L + mald 2.6.1.19 gabT glutamate degradation IV, 4aminobutyrate degradation II,I ** glu4 pphn + nad <-> 34hpp + co2 + nadh + h 1.2.7.1 nifJ glutamate degradationVII(to butyrate), pyr fermentation to ac III, pyr fermentation to ac I, reductive monocarboxylic acid cycle ** glu5 gln-L + h2o <-> glu-L + nh3 6.3.5.5 carA ZMO1617, ZMO1618 glutamate metabolism glu6 nh3 + glu-L + atp <-> gln-L + adp + pi 6.3.1.2 glnA ZMO0493 glutamine biosynthesis I ZMO0099, ZMO0419 Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism Fatty Acid Metabolism * * ** ** ** ** **** **** **** **** *** ** ** ** *** *** *** **** ** ** ** *** **** *** *** **** **** ** *** **** ** *** **** *** **** *** **** *** **** ** *** **** ** *** **** **** ** * ** gpl9 gpl18 gpl8 gpl10 gpl12 gpl11 gly1 amet + peam -> ahcys + pme amet + pme -> ahcys + ppdel amet + ppdel -> ahcys + pc CDP-diacylglyc + inost -> cmp + pinost mi1p-D + h2o -> inost + pi g6p -> mi1p-D chol + nad <-> betald + nadh + h 2.1.1.17 2.1.1.71 2.1.1.71 2.7.8.11 3.1.3.25 5.5.10.4 1.1.1.1 ZMO0776 adhA/adhB ZMO1236, ZMO1596, ZMO1722 gly2 gly3 glyc8 ed2 glyc1 glyc10 thr-L <-> gly + acald phom + h2o <-> thr-L + pi nad + mal <-> pyr + co2 + nadh g6p + nadp <-> gl6p + nadph + h nad + g3p + pi -> nadh + 13dpg pyr + thmpp -> 2thippi + co2 4.1.2.5 4.2.3.1 1.1.1.38 1.1.1.49 1.2.1.12 1.2.4.1 ltaA thrC sfcA zwf gapA aceE ZMO1347 ZMO1891 ZMO1955 ZMO0367 ZMO0177 ZMO1605, ZMO1606 glycine biosynthesis IV glycine, serine and threonine metabolism Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis ed5 glyc21 glyc14 glyc15 glyc16 glyc17 glyc18 glyc19 glyc20 glyc4 ed3 glyc5 glyc13 glyc22 glyc11 glyc2 glyc6 glyc3 glyc12 glyc7 hist1 hist11 hist2 coa + nad + pyr -> accoa + co2 + nadh atp + glc-D -> adp + g6p atp + pyr <-> adp + pep GTP + pyr <-> GDP + pep CTP + pyr <-> CDP + pep utp + pyr <-> UDP + pep ITP + pyr <-> IDP + pep dATP + pyr <-> dADP + pep dGTP + pyr <-> dGDP + pep 3pg + atp <-> adp + 13dpg h2o + gl6p -> pgl fdp + h2o -> f6p + pi acald + thmpp <-> 2thippi pyr -> acald + co2 atp + oaa <-> adp + pep + co2 dhap + e4p <-> sedbispi fdp <-> dhap + g3p g3p <-> dhap f6p -> g6p 2pg <-> 3pg histidinal + nad + h2o <-> his-L + nadh histd + 2 nad + h2o -> his-L + 2 nadh + 2 h histd + nad <-> histidinal + nadh 1.8.1.4 2.7.1.2 2.7.1.40 2.7.1.40 2.7.1.40 2.7.1.40 2.7.1.40 2.7.1.40 2.7.1.40 2.7.2.3 3.1.1.31 3.1.3.11 4.1.1.1 4.1.1.1 4.1.1.49 4.1.2.13 4.1.2.13 5.3.1.1 5.3.1.9 5.4.2.1 1.1.1.23 1.1.1.23 1.1.1.23 ZMO0512 ZMO0369 ZMO0152 ZMO0152 ZMO0152 ZMO0152 ZMO0152 ZMO0152 ZMO0152 ZMO0178 ZMO1478 ZMO0482 Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Glycolysis/Gluconeogenesis Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I ZMO0329 glk pykA pykA pykA pykA pykA pykA pykA pgk pgl glpX pdc pdc pckA fbaB tpiA pgi pmgI hisD hisD hisD ZMO0179 ZMO0179 ZMO0465 ZMO1212 ZMO1240 ZMO1551 ZMO1551 ZMO1551 Glycerophospholipid Metabolism Glycerophospholipid Metabolism Glycerophospholipid Metabolism Glycerophospholipid metabolism Glycerophospholipid metabolism Glycerophospholipid metabolism glycine betaine biosynthesis II *** ** ** ** ** ** * * * * * * ** ** ** ** * * * * * * * * * * * ** ** ** *** **** *** **** *** *** *** *** *** *** **** **** **** **** **** **** *** *** *** *** *** *** *** *** *** *** *** *** **** **** **** **** **** **** **** **** **** **** **** **** **** **** *** *** *** *** *** *** *** *** **** **** **** **** ** * * * ** ** ** ** ** ** ** **** **** **** hist10 prlp + gln-L <-> 1eryimi + glu-L + aicar 2.4.2.- hisF ZMO1502, ZMO1837 Histidine biosynthesis I ** *** hist8 hist3 hist4 hist5 hist6 hist7 hist9 tyr8 tyr9 met7 met6 anorg2 prpp + atp <-> PR-ATP + ppi 3imiop + glu-L <-> akg + hisp hisp + h2o <-> histd + pi PR-AMP + h2o <-> prfp PR-ATP + h2o <-> PR-AMP + ppi 1eryimi <-> 3imiop + h2o prfp <-> prlp nad + argen-L <-> tyr-L + co2 + nadh nadp + argen-L <-> tyr-L + co2 + nadph accoa + hom-L <-> coa + achms ahcys + h2o <-> adn + hcys-L aps + atp <-> paps + adp 2.4.2.17 2.6.1.9 3.1.3.15 3.5.4.19 3.6.1.31 4.2.1.19 5.3.1.16 1.3.1.43 1.3.1.43 2.3.1.31 3.3.1.1 2.7.1.25 hisG hisC hisB hisI hisI hisB hisA tyrC tyrC metX ahcY cysC ZMO1550 ZMO0002 Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I Histidine biosynthesis I Individual Amino Acids Biosynthesis Individual Amino Acids Biosynthesis Individual Amino Acids Biosynthesis Individual Amino Acids Biosynthesis Inorganic Nutrients Degradation/Utilisation/Assimilation ** ** ** ** ** ** *** *** **** **** **** **** **** **** **** **** **** **** **** anorg3 so4 + atp <-> aps + ppi 2.7.7.4 cysN / D ZMO0004, ZMO0005 Inorganic Nutrients Degradation/Utilisation/Assimilation **** anorg4 tsul + cyan <-> so3 + tcynt 2.8.1.1 sseA ZMO1460 Inorganic Nutrients Degradation/Utilisation/Assimilation anorg1 h + hCO3- <-> co2 + h2o 4.2.1.1 ZMO1133 ZMO1133 Inorganic Nutrients Degradation/Utilisation/Assimilation ileu1 2ahbut + nadph -> 23dhmp+ nadp 1.1.1.86 ilvC ZMO1141 ileu2 pyr + 2obut -> 2ahbut + co2 2.2.1.6 ilvG ileu3 23dhmb <-> 3mob + h2o 4.2.1.9 ileu4 leu-L + akg <-> 4mop + glu-L ileu5 ZMO1178 ZMO1499 ZMO1503 ZMO1501 ZMO0420 ZMO0420 ZMO0225 ZMO0182 ZMO0003 * * ** *** *** *** *** *** *** *** *** *** * ** *** ** *** ** *** **** Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV ** *** **** ZMO0687, ZMO1139, ZMO1140 Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV ** *** **** ilvD ZMO1792 Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV ** *** **** 2.6.1.42 ilvE ZMO0913 Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV, isoleucine degradation II, isoleucine degradation I * *** **** val-L + akg <-> glu-L + 3mob 2.6.1.42 ilvE ZMO0913 Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV, isoleucine degradation II, isoleucine degradation I * *** **** ileu6 ile-L + akg <-> glu-L + 3mop 2.6.1.42 ilvE ZMO0913 Isoleucine biosynthesis from threonine, isoleucine biosynthesis IV, isoleucine degradation II, isoleucine degradation I * *** **** ileu7 2metbutn + nadh <-> 2metbutl + nad 1.1.1.1 adhA/adhB ZMO1236, ZMO1596, ZMO1722 Isoleucine degradation II *** **** * * * ** ** ** * ** ** ileu8 arg25 3mop <-> 2metbutn + co2 orn-L + cbp <-> citr-L + pi 4.1.1.72 2.1.3.3 pdc argI ** ** *** **** leu1 leu2 leu3 3c2hmp + nad <-> 3c4mop + nadh + h 3c3hmp + coa <-> accoa + h2o + 3mob 3c2hmp <-> 3c3hmp 1.1.1.85 2.3.3.13 4.2.1.33 leuB leuA leuC/D ZMO0677 ZMO0903 ZMO0105, ZMO0106 Leucine biosynthesis Leucine biosynthesis Leucine biosynthesis ** ** ** *** *** *** **** **** **** leu4 3metbutn + nadh <-> isalc + nad 1.1.1.1 adh Leucine degradation III thr5 thr6 hom-L + nad <-> aspald + nadh + h atp + asp-L <-> adp + 4pasp 1.1.1.3 2.7.2.4 metL lysC ZMO1236, ZMO1596, ZMO1722 ZMO0483 ZMO1653 ** *** **** L-homoserine biosynthesis L-homoserine biosynthesis, lysine biosynthesis I * * *** *** **** **** thr7 nadp + pi + aspald <-> nadph + 4pasp 1.2.1.11 asd ZMO1407 L-homoserine biosynthesis,lysine biosynthesis I * *** **** lys1 lys2 lys3 lys4 lys5 lys6 2345thdpcl + nadp <-> 23dhpcl + nadph + h h2o + succoa + 2345thdpcl <-> nsuckm + coa akg + succdioate <-> glu-L + nsuckm succdioate + h2o <-> succ + 26ahept 26DAP-m <-> co2 + lys-L pyr + aspald <-> 23dhpcl + 2 h2o 1.3.1.26 2.3.1.117 2.6.1.17 3.5.1.18 4.1.1.20 4.2.1.52 dapB dapD yfdZ dapE lysA dapA ZMO0707 ZMO0431 ZMO0408 ZMO1632 ZMO1768 ZMO0720, ZMO1853 Lysine biosynthesis I Lysine biosynthesis I Lysine biosynthesis I Lysine biosynthesis I Lysine biosynthesis I Lysine biosynthesis I * *** *** *** *** *** *** **** **** lys7 lys8 26ahept <-> 26DAP-m 3hbtcoa + nad <-> aacoa + nadh 5.1.1.7 1.1.1.35 dapF fadJ ZMO1072 Lysine biosynthesis I Lysine degradation, tyrptophan metabolism * *** **** membran8 C120SN 2 accoa <-> aacoa + coa actACP + 14 h + 4 malACP + 10 nadph -> 4 ACP + 4 co2 + ddcaACP + 5 h2o + 10 nadp 2.3.1.9 C140SN ZMO0409 Isoleucine degradation II L-citrulline degradation, proline biosynthesis V(from arginine), L-citrulline biosynthesis, arginine biosynthesis IV, arginine biosynthesis II (Acetyl cycle) * * * ** ** * ** * ** Membrane lipid metabolism Membrane Lipid Metabolism * ** actACP + 17 h + 5 malACP + 12 nadph -> 5 ACP + 5 co2 + 6 h2o + myrsACP + 12 nadp Membrane Lipid Metabolism * C141SN actACP + 16 h + 5 malACP + 11 nadph -> 5 ACP + 5 co2 + 6 h2o + 11 nadp + tdeACP Membrane Lipid Metabolism * C160SN actACP + 20 h + 6 malACP + 14 nadph -> 6 ACP + 6 co2 + 7 h2o + 14 nadp + palmACP Membrane Lipid Metabolism * C161SN actACP + 19 h + 6 malACP + 13 nadph -> 6 ACP + 6 co2 + 7 h2o + hdeACP + 13 nadp Membrane Lipid Metabolism * C180SN actACP + 23 h + 7 malACP + 16 nadph -> 7 ACP + 7 co2 + 8 h2o + octaACP + 16 nadp Membrane Lipid Metabolism * ** **** **** **** C181SN actACP + 22 h + 7 malACP + 15 nadph -> 7 ACP + 7 co2 + 8 h2o + 15 nadp + octeACP gpl13 gpl15 2.3.1.15 2.7.8.5 plsB pgsA gpl16 gpl14 gpl17 met1 met2 met3 sn-glyc3p + aacp <-> ACP + lppdat CDP-diacylglyc + sn-glyc3p <-> L1pglyp + CMP CDP-diacylglyc + ser-L <-> CMP + ppser L1pglyp + h2o <-> L1pgly + pi gsnppi + h2o <-> ppi + GDP suchms + cys-L <-> succ + cyst-L cyst-L + h2o <-> nh3 + pyr + hcys-L hcys-L + 5mthf <-> met-L + thf 2.7.8.8 3.1.3.27 3.1.7.2 2.5.1.48 4.4.1.8 2.1.1.13 pssA pgpB spoT metB metC metH ZMO1159 met4 3metthpron + nadh + h <-> methionol + nad 1.1.1.1 adhA/adhB ZMO1236, ZMO1596, ZMO1722 Methionine degradation III met5 pur33 ncltd9 ncltd10 denovo6 5mthglu + hcys-L -> thglu + met-L h2o + nad + ins5p <-> xmp + nadh phthr + nad <-> 2a3o4pbuty + nadh 4per + nad <-> ohpb + nadh CDP + trdrd <-> dCDP + h2o + trdox 2.1.1.14 1.1.1.205 1.1.1.262 1.1.1.290 1.17.4.1 metA guaB ZMO1313 serA nrdA/nrdB ZMO1000 ZMO1321 ZMO1313 Methionine metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * denovo7 UDP + trdrd <-> dUDP + h2o + trdox 1.17.4.1 nrdA/nrdB ZMO0443, ZMO1039 pur25 adp + trdrd <-> dADP + h2o + trdox 1.17.4.1 nrdA/nrdB pur26 GDP + trdrd <-> dGDP + h2o + trdox 1.17.4.1 pur10 pur11 pur7 pur8 pur9 ncltd11 denovo8 ncltd5 dutp + trdox + h2o <-> utp + trdrd 2drn3p + trdox + h2o <-> rns3p + trdrd dATP + trdox + h2o -> atp + trdrd dGTP + trdox + h2o <-> GTP + trdrd dCTP + trdox + h2o <-> CTP + trdrd nad + h2o + e4p <-> 4per + nadh dhor-S + o2 <-> orot + h2o2 pyam5p + h2o + o2 <-> pydx5p + nh3 + h2o2 pdx5p + o2 <-> h2o2 + pydx5p dUMP + mlthf <-> dhf + dTMP atp + 5prg + formate <-> pi + 5pnfgd + adp ncltd6 denovo5 pur20 Membrane Lipid Metabolism ZMO0096 ZMO0086 * Metabolic Regulators Biosynthesis Metabolic Regulators Biosynthesis Metabolic Regulators Biosynthesis Metabolic Regulators Biosynthesis Metabolic Regulators Biosynthesis Methionine biosynthesis I Methionine biosynthesis I Methionine biosynthesis I, folate transformation, formyl THF biosynthesis I, II ** ** * ** ** * *** **** *** **** *** ** ** ** *** *** **** **** ** *** **** *** *** *** **** **** **** * ** ** ** ** ** *** **** Nucleosides and Nucleotides Metabolism * ** *** **** ZMO0443, ZMO1039 Nucleosides and Nucleotides Metabolism * ** *** **** nrdA/nrdB ZMO0443, ZMO1039 Nucleosides and Nucleotides Metabolism * ** *** **** 1.17.4.2 1.17.4.2 1.17.4.2 1.17.4.2 1.17.4.2 1.2.1.72 1.3.3.1 1.4.3.5 nrdD nrdD nrdD nrdD nrdD gap ZMO0120 pdxH ZMO1025 ZMO1025 ZMO1025 ZMO1025 ZMO1025 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * * * 1.4.3.5 2.1.1.45 2.1.2.- pdxH thyA purK ZMO0851 ZMO1755 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * ZMO0327 ZMO1745 ZMO0443, ZMO1039 ZMO0851 * * *** *** *** *** *** ** ** ** ** ** ** *** **** **** *** *** **** **** thf13 pur34 denovo9 ncltd13 N10fthf + 5prg <-> thf + 5pnfgd N10fthf + aicar <-> thf + phoforcboxm asp-L + cbp -> carbasp + pi pyr + g3p <-> dxyl5p + co2 2.1.2.2 2.1.2.3 2.1.3.2 2.2.1.7 purN purH pyrI dxs pur14 pur15 pur16 pur17 pur18 pur3 pur39 pur4 pur6 salv2 denovo13 pur23 salv16 salv9 ncltd12 ncltd7 salv10 salv11 salv1 pyrmdn2 pyrmdn5 salv15 salv3 denovo3 ncltd1 ncltd4 denovo4 ncltd2 ncltd3 pur19 pyrmdn3 salv4 salv5 salv8 dgsn + pi <-> gua + 2dr1p N-Ribosylncam + pi <-> ncam + r1p nicrns + pi <-> nac + r1p dad-2 + pi <-> ade + 2dr1p din + pi <-> hxan + 2dr1p gsn + pi <-> gua + r1p ins + pi <-> hxan + r1p xtsn + pi <-> xan + r1p adn + pi <-> ade + r1p duri + pi <-> ura + 2dr1p prpp + orot <-> ppi + orot5p prpp + h2o + gln-L <-> 5pra + glu-L + ppi prpp + xan -> ppi + xmp GMP + ppi <-> gua + prpp ohpb + glu-L <-> phthr + akg dxyl5p + 1am2p3p <-> 2 h2o + pi + pdx5p atp + thymd <-> adp + dTMP atp + duri <-> adp + dUMP uri + atp <-> UMP + adp atp + dCMP <-> adp + dCDP UMP + atp <-> UDP + adp atp + CMP <-> adp + CDP atp + AMP <-> 2 adp dTDP + atp <-> dTTP + adp GMP + atp <-> GDP + adp GMP + atp <-> GDP + adp atp + dTMP <-> adp + dTDP atp + dUMP <-> adp + dUDP atp + r5p <-> AMP + prpp nicrns + pi <-> nicrnt + h2o dcyt + pi <-> dCMP + h2o AMP + h2o <-> adn + pi ins5p + h2o <-> ins + pi xmp + h2o <-> pi + xtsn 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.1 2.4.2.10 2.4.2.14 2.4.2.22 2.4.2.8 2.6.1.52 2.6.99.2 2.7.1.21 2.7.1.21 2.7.1.48 2.7.4.14 2.7.4.14 2.7.4.14 2.7.4.3 2.7.4.6 2.7.4.8 2.7.4.8 2.7.4.9 2.7.4.9 2.7.6.1 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 deoD deoD deoD deoD deoD deoD deoD deoD deoD ZMO0708 ZMO0027 ZMO0791 ZMO1234, ZMO1598 pyrE purF gpt ZMO1707 ZMO1557 ZMO0656 serC ZMO1708 tdk tdk udk cmk pyrH cmk adk ndk gmk gmk tmk tmk prsA ushA ushA yjjG yjjG Gm ZMO1684 ZMO1708 ZMO0552 ZMO0552 ZMO1797 ZMO1797 ZMO1797 ZMO0538 ZMO0433 ZMO0433 ZMO1090 ZMO1090 ZMO1519 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0985 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * * ** ** ** ** Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * * * * * * * * * * ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** ** * * * * * * * * * * * * * * * * *** *** *** *** **** *** *** *** **** **** *** *** *** *** **** **** **** **** *** *** *** *** **** **** **** **** *** *** *** *** *** *** *** *** *** *** **** **** **** **** **** **** **** **** **** **** **** **** pur12 dGTP + h2o <-> dgsn + PPPi 3.1.5.1 dgt ZMO0842, ZMO1485 Nucleosides and Nucleotides Metabolism * salv7 denovo10 ins + h2o <-> hxan + rib-D dhor-S + h2o <-> carbasp 3.2.2.2 3.5.2.3 LI pyrC Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * salv13 pur27 denovo1 salv6 pur5 h2o + csn <-> nh3 + ura ins5p + h2o <-> phoforcboxm h2o + dCTP <-> nh3 + dutp h2o + gua <-> nh3 + xan h2o + adn <-> nh3 + ins 3.5.4.1 3.5.4.10 3.5.4.13 3.5.4.3 3.5.4.4 codA purH dcd ZMO0939 add Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * * salv12 salv14 denovo2 pur13 pur32 h2o + dcyt <-> nh3 + duri h2o + cytd <-> nh3 + uri dutp + h2o <-> dUMP + ppi h2o + 55adetp <-> 2 adp 4carn <-> air + co2 3.5.4.5 3.5.4.5 3.6.1.23 3.6.1.41 4.1.1.21 cdd cdd yrfE apaH purK ZMO0864 ZMO0864 ZMO1191 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism * * * * * denovo11 pur28 pur29 pur24 pur30 pur31 pur21 pur35 pur22 pyrmdn1 orot5p <-> UMP + co2 5pimi <-> fum + aicar adenylo-succ <-> fum + AMP N5camimirn <-> 4carn atp + 4carn + asp-L <-> adp + pi + 5pimi atp + 5pnfg <-> adp + pi + air nh3 + xmp + atp <-> AMP + ppi + GMP 5pra + atp + gly <-> adp + pi + 5prg air + atp + hCO3- <-> N5camimirn + adp + pi atp + gln-L + h2o + utp -> adp + ctp + glu-L + 2 h + pi 4.1.1.23 4.3.2.2 4.3.2.2 5.4.99.18 6.3.2.6 6.3.3.1 6.3.4.1 6.3.4.13 6.3.4.18 6.3.4.2 pyrF purB purB purE purC purM yfeJ purD purK pyrG ZMO0587 ZMO0662 ZMO0662 * * * ZMO0462 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism pyrmdn4 atp + utp + gln-L + h2o <-> adp + pi + CTP + glu-L 6.3.4.2 pyrG ZMO0462 pur36 asp-L + ins5p + GTP <-> adenylo-succ + pi + GDP 6.3.4.4 purA pur38 atp + xmp + gln-L + h2o <-> AMP + ppi + GMP + glu-L 6.3.5.2 pur37 atp + 5pnfgd + gln-L + h2o <-> glu-L + adp + pi + 5pnfg denovo12 2 atp + gln-L + hCO3- + h2o <-> 2 adp + pi + glu-L + cbp ZMO0792, ZMO1689 ZMO0027 ZMO0863 ZMO0939 ZMO0655, ZMO0971 *** ** ** ** ** ** ** **** *** *** *** *** *** **** **** **** **** ** ** ** ** ** *** *** *** **** **** **** *** **** *** *** *** **** **** **** *** *** **** **** *** **** * ** ** ** ** ** ** ** ** ** ** *** **** Nucleosides and Nucleotides Metabolism * ** *** **** ZMO1687 Nucleosides and Nucleotides Metabolism * ** *** **** guaA ZMO1267, ZMO1855 Nucleosides and Nucleotides Metabolism * ** *** **** 6.3.5.3 purL ZMO0820, ZMO1531, ZMO1532 Nucleosides and Nucleotides Metabolism * ** *** **** 6.3.5.5 carB ZMO1617, ZMO1618 Nucleosides and Nucleotides Metabolism * ** *** **** ZMO1420, ZMO1421 ZMO1052 ZMO0709 ZMO0299 * * * denovo14 2 atp + hCO3- + nh3 <-> 2 adp + pi + cbp 6.3.5.5 ncltd8 salv34 salv32 salv17 salv18 salv19 salv20 salv21 salv22 salv23 salv24 salv25 salv26 salv27 salv28 salv29 salv30 salv31 salv33 ot3 ot1 2a3o4pbuty <-> co2 + 1am2p3p adn + atp -> adp + amp + h gtp + uri -> gdp + h + ump atp + udp <-> adp + utp atp + cdp <-> adp + ctp atp + dgdp <-> adp + dgtp atp + dudp <-> adp + dutp atp + dcdp <-> adp + dctp atp + dadp <-> adp + datp dump + h2o -> duri + pi h2o + imp -> ins + pi h2o + ump -> pi + uri cmp + h2o -> cytd + pi dtmp + h2o -> pi + thymd damp + h2o -> dad-2 + pi dgmp + h2o -> dgsn + pi gmp + h2o -> gsn + pi gtp + h2o -> gsn + pppi amp + gtp <-> adp + gdp 2 h2o2 -> o2 + 2 h2o h2o + 4cmol <-> 4o2ene resp17 atp + h2o -> adp + h + pi 3.6.3.14 pengluc1 xltol + nad <-> xylu-D + nadh + h 1.1.1.9 pengluc5 atp + rbl-L <-> adp + ru5p-L 2.7.1.16 pengluc3 atp + xylu-D <-> adp + xu5p-D 2.7.1.17 carB 2.7.1.20 2.7.1.48 2.7.4.6 2.7.4.6 2.7.4.6 2.7.4.6 2.7.4.6 2.7.4.6 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.3.5 3.1.5.1 dgtP 1.11.1.6 3.1.1.45 cat clcD ZMO1617, ZMO1618 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0985 ZMO0842 Nucleosides and Nucleotides Metabolism Nucleosides and Nucleotides Metabolism Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Nucleotide Salvage Pathways Others Others * * ** *** ** ** ** ** ** ** ** ** ** **** **** *** *** *** *** *** *** *** *** *** **** **** **** **** **** **** **** **** **** ** *** *** **** **** Oxidative phosphorylation ** *** **** Pentose and glucuronate interconvensions ** araB Pentose and glucuronate interconversions ** xylB Pentose and glucuronate interconversions ** ZMO0918 ZMO1351, ZMO1992 ZMO0238, ZMO0239, ZMO0240, ZMO0241, ZMO0242, ZMO0637, ZMO0667, ZMO0668, ZMO0669, ZMO0671 ** ** ** * pengluc4 ru5p-L <-> xu5p-D 5.1.3.4 ulaF/sgbE/araD Pentose and glucuronate interconversions ** pengluc6 arab-L <-> rbl-L 5.3.1.4 araA Pentose and glucuronate interconversions ** pengluc2 xyl-D <-> xylu-D 5.3.1.5 xylA Pentose and glucuronate interconversions ** ppp1 ppp9 ppp7 ppp3 ppp4 ppp2 ppp8 ppp5 ppp6 phe1 phe2 pgl + nadp -> co2 + nadph + ru5p-D g3p + s7p <-> e4p + f6p glc-D + nad -> gllc + nadh + h xu5p-D + r5p <-> s7p + g3p xu5p-D + e4p <-> f6p + g3p atp + glcn <-> adp + pgl gllc + h2o -> glcn dgp <-> g3p + pyr r5p <-> ru5p-D pphn <-> phpyr + h2o + co2 chor <-> pphn 1.1.1.44 2.2.1.2 1.1.1.47 2.2.1.1 2.2.1.1 2.7.1.12 3.1.1.17 4.1.2.14 5.3.1.6 4.2.1.51 5.4.99.5 gnd Pentose Phosphate Cycle Pentose Phosphate Cycle Pentose phosphate pathway Pentose Phosphate Pathway Pentose Phosphate Pathway Pentose Phosphate Pathway Pentose phosphate pathway Pentose Phosphate Pathway Pentose Phosphate Pathway Phenylalanine biosynthesis I Phenylalanine biosynthesis I, tyrosine biosynthesis I ** ** ** ** ** phe3 pacald + nadh <-> 2pheethl + nad 1.1.1.1 adhA/adhB ZMO1236, ZMO1596, ZMO1722 Phenylalanine degradation II phe4 phe-L + akg <-> phpyr + glu-L 2.6.1.57 tyrB ZMO0937 Phenylalanine degradation II, phenylalanine biosynthesis I * phe5 tyr-L + akg <-> 34hpp + glu-L 2.6.1.57 tyrB ZMO0937 Phenylalanine degradation II, phenylalanine biosynthesis I * pro1 pro2 glu5sa <-> h2o + py5c py5c + nadph + h <-> pro-L + nadp 1.5.1.2 proC ZMO0311, ZMO1303 pro3 pi + nadp + glu5sa <-> glu5p + nadph + h 1.2.1.41 proA ZMO1661 Proline biosynthesis II, L-citrulline biosynthesis, proline biosynthesis I, urea cycle and amino acid metabolism pro4 glu-L + atp <-> glu5p + adp 2.7.2.11 proB ZMO0206 Proline biosynthesis II,L-citrulline biosynthesis, proline biosynthesis I pur40 resp5 resp18 resp2 h2o + imp + nad -> h + nadh + xmp hmgth + nadp <-> Sfglutth + h + nadph o2 + 2 q8h2 <-> 2 h2o + 2 q8 2 fctchc + q8h2 <-> 2 foctchc + q8 1.1.1.205 1.1.1.284 1.10.2.1.10.2.2 ZMO1321 ZMO1722 Purine and Pyrimidine Biosynthesis Respiration Respiration Respiration tktA tklB gntK eda rpiA pheA aroQ cydA ZMO0956 ZMO0176 ZMO0176 ZMO1757 ZMO1649 ZMO0997 ZMO1200 ZMO1678 ZMO0563 ZMO0956, ZMO0957, ZMO0958 Proline biosynthesis I Proline biosynthesis I, proline biosynthesis V (from arginine), proline biosynthesis I ** ** ** *** *** *** *** *** *** *** *** ** *** **** ** *** **** *** **** * *** **** * *** **** ** *** **** ** *** *** **** **** *** **** * * * **** **** **** ** * ** ** resp6 resp11 resp3 resp4 resp1 resp12 Methanol + h2o2 <-> fald + 2 h2o 2op6mph + o2 <-> 2op6m14bq + h2o q8 + succ <-> q8h2 + fum q8 + nadh + h <-> q8h2 + nad enz6dly + nad <-> enzn6ly + nadh 2op6m14bq + amet <-> opmmbq + ahcys 1.11.1.6 1.14.3.1.3.5.1 1.6.5.3 1.8.1.4 2.1.1.- cat ZMO1703 nadB ZMO1949 lpdA ubiE resp7 amet + 3dmq8 <-> ahcys + q9 2.1.1.64 ubiG resp8 octdp + phbz <-> 3ophb + ppi 2.5.1.- ubiA resp10 resp13 resp9 secmet5 secmet6 secmet4 amet + 2op6ph <-> ahcys + 2op6mph opmmbq + o2 <-> 3dmq8 + h2o 2oph + o2 <-> 2op6ph 2dhglcn + nadph <-> idon-L + nadp 25dkglcn + nadph <-> 5dglcn + nadp 5exhcamp + nad <-> 25dkcam + nadh 1.1.1.1.1.1.1.1.1.1 ubiG ZMO1703 ZMO1189 yiaE yiaE adh secmet7 secmet11 secmet8 secmet10 secmet9 secmet1 secmet2 secmet3 nadp + glcn <-> 2dhglcn + nadph idon-L + nad <-> 5dglcn + nadh 2dhglcn + nadp <-> 25dkglcn + nadph glcn + nad <-> 5dglcn + nadh + h glcn + nadp <-> 5dglcn + h + nadph orn + cbp <-> citr-L + pi canavaninosucc <-> canavanine + fum urei-L + asp-L + atp <-> canavaninosucc + AMP + ppi 1.1.1.215 1.1.1.264 1.1.1.274 1.1.1.69 1.1.1.69 2.1.3.3 4.3.2.1 6.3.4.5 yiaE idnD dkgB idnO idnO argF argH argG ZMO0918 ZMO0512 ZMO0017, ZMO0232, ZMO0402, ZMO0570, ZMO0823, ZMO0952, ZMO1032, ZMO1179, ZMO1188, ZMO1203, ZMO1314, ZMO1554, ZMO1654, ZMO1889 ZMO1654, ZMO1889 ZMO0473, ZMO0564, ZMO1419 ZMO1771 ZMO1771 ZMO1236, ZMO1596, ZMO1722 ZMO0787 ZMO1344 ZMO0409 ZMO1770 ZMO1036 Respiration Respiration Respiration Respiration Respiration Respiration * *** **** ** ** ** ** ** *** *** **** Respiration ** *** **** Respiration ** *** Respiration Respiration Respiration Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism ** ** ** ** ** ** *** *** *** Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism Secondary Metabolites Metabolism ** ** ** ** ** ** ** ** * **** *** *** **** *** *** *** **** **** **** ser1 3pg + nad <-> 3phpyr + nadh 1.1.1.95 serA ZMO1685, ZMO1883 Serine biosynthesis * ser2 ser3 ser4 anorg5 anorg6 altcarb8 3pser + akg <-> glu-L + 3phpyr 3pser + h2o <-> pi + ser-L ser-L <-> pyr + nh3 2 h <-> h2 3 h2 + n2 <-> 2 nh3 h2o + sucr -> fru + glc-D 2.6.1.52 3.1.3.3 4.3.1.17 serC serB sdaA ZMO1684 ZMO1137 ZMO0189 * * * 3.2.1.26 invA ZMO0375, ZMO0942 Serine biosynthesis Serine biosynthesis Serine biosynthesis Simple Reactions Simple Reactions Starch and sucrose metabolism thr1 atp + hom-L <-> adp + phom 2.7.1.39 thrB ZMO1600 * thr3 thr-L <-> 2obut + nh3 4.3.1.19 tdcB ZMO1275 Threonine biosynthesis from Lhomoserine Threonine degradation I, isoleucine biosynthesis from threonine * ** thr4 T001 T004 T005 T006 T007 T009 T010 T011 T012 T013 T014 T015 T017 T020 T021 T022 T023 T024 T025 T026 T027 T029 T030 T031 T032 T033 gly + accoa <-> 2aobut + coa glc-D_e -> glc-D amet_e <-> amet 5mta_e <-> 5mta udcpp_e <-> udcpp s7p_e <-> s7p 14aDg(n)_e <-> 14aDg(n) FMN_e <-> FMN etoh -> etoh_e succ <-> succ_e h2 <-> h2_e h <-> h_e n2 <-> n2_e acald_e <-> acald ac_e + h_e <-> ac + h alltn_e + h_e <-> alltn + h atp + h2o + spmd_e -> adp + h + pi + spmd atp + h2o + his-L_e -> adp + h + his-L + pi h_e + his-L_e <-> h + his-L atp + h2o + ile-L_e -> adp + h + ile-L + pi h_e + ile-L_e <-> h + ile-L atp + h2o + tsul_e -> adp + h + pi + tsul glyclt_e + h_e <-> glyclt + h asp-L_e + atp + h2o -> adp + asp-L + h + pi asp-L_e + h_e -> asp-L + h asp-L_e + 2 h_e -> asp-L + 2 h asp-L_e + 3 h_e -> asp-L + 3 h 2.3.1.29 kbl glf Threonine degradation II Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions * ** ** ** ** ** ** *** **** *** *** *** **** **** **** *** **** *** **** *** **** T034 T035 T036 T037 T038 T039 T041 T042 T043 T044 T045 T046 T047 T048 T049 T050 T051 T052 T053 T054 T055 T056 T057 T058 T059 T060 T061 T062 T064 T065 T066 T067 T068 T069 T072 T073 T077 T078 atp + fe2_e + h2o -> adp + fe2 + h + pi co2_e <-> co2 acnam_e + h_e -> acnam + h nac_e -> nac atp + h2o + xyl-D_e -> adp + h + pi + xyl-D h_e + xyl-D_e -> h + xyl-D adn_e + h_e -> adn + h adn_e + h_e <-> adn + h atp + chol_e + h2o -> adp + chol + h + pi chol_e + h_e <-> chol + h ade_e + h_e <-> ade + h h_e + indole_e <-> h + indole dha_e <-> dha h_e + ura_e -> h + ura h_e + ura_e <-> h + ura ala-L_e + atp + h2o -> adp + ala-L + h + pi ala-L_e + h_e <-> ala-L + h cit_e + succ -> cit + succ_e atp + h2o + succ_e -> adp + h + pi + succ 2 h_e + succ_e -> 2 h + succ 3 h_e + succ_e -> 3 h + succ h + succ -> h_e + succ_e fum_e + succ <-> fum + succ_e succ + tartr-L_e <-> succ_e + tartr-L gua_e <-> gua gua_e + h_e -> gua + h hxan_e <-> hxan o2_e <-> o2 atp + h2o + val-L_e -> adp + h + pi + val-L h_e + val-L_e <-> h + val-L fru_e + pep -> f1p + pyr fru_e + pep -> f6p + pyr akg_e + h_e <-> akg + h gly_e + h_e <-> gly + h acgam_e + pep -> acgam6p + pyr h2o_e + tre_e -> 2 glc-D_e h_e + trp-L_e <-> h + trp-L man_e + pep -> man6p + pyr Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions T079 26dap-M_e + atp + h2o -> 26dap-M + adp + h + pi Transport Reactions T080 T081 T082 T083 T084 T085 T086 T087 h_e + idon-L_e <-> h + idon-L h_e + thymd_e -> h + thymd h_e + thymd_e <-> h + thymd succ + tartr-L_e <-> succ_e + tartr-L h_e + xtsn_e <-> h + xtsn din_e + h_e -> din + h h_e + lac-D_e <-> h + lac-D atp + glyc3p_e + h2o -> adp + glyc3p + h + pi glyc3p_e + pi -> glyc3p + pi_e dad-2_e + h_e -> dad-2 + h arg-L_e + orn <-> arg-L + orn_e arg-L_e + atp + h2o -> adp + arg-L + h + pi duri_e + h_e -> duri + h atp + h2o + thr-L_e -> adp + h + pi + thr-L h_e + thr-L_e <-> h + thr-L g6p_e + 2 pi -> g6p + 2 pi_e atp + glu-L_e + h2o -> adp + glu-L + h + pi glu-L_e + h_e <-> glu-L + h csn_e + h_e -> csn + h urea_e <-> urea atp + h2o + malttr_e -> adp + h + malttr + pi gsn_e + h_e -> gsn + h man6p_e + 2 pi -> man6p + 2 pi_e h_e + ins_e -> h + ins h_e + ins_e <-> h + ins cytd_e + h_e -> cytd + h cytd_e + h_e <-> cytd + h atp + gal_e + h2o -> adp + gal + h + pi gal_e + h_e -> gal + h ala-D_e + h_e <-> ala-D + h gly_e + h_e <-> gly + h atp + h2o + leu-L_e -> adp + h + leu-L + pi h_e + leu-L_e <-> h + leu-L arab-L_e + atp + h2o -> adp + arab-L + h + pi arab-L_e + h_e <-> arab-L + h Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions T088 T089 T090 T091 T092 T093 T094 T096 T099 T100 T102 T103 T104 T105 T106 T109 T110 T111 T112 T113 T114 T117 T118 T121 T122 T123 T124 Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions T125 T126 T128 T129 T130 T131 T132 T133 T134 T135 T136 T137 T138 T141 T142 T143 T144 T145 T146 T147 T148 T150 T151 T154 T155 T156 T157 T158 T159 T160 T161 T162 T163 T164 T165 T166 T167 T168 T169 dgsn_e + h_e -> dgsn + h h_e + phe-L_e <-> h + phe-L h_e + uri_e -> h + uri h_e + uri_e <-> h + uri atp + gln-L_e + h2o -> adp + gln-L + h + pi orn + ptrc_e <-> orn_e + ptrc atp + h2o + ptrc_e -> adp + h + pi + ptrc h_e + ptrc_e <-> h + ptrc h_e + tyr-L_e <-> h + tyr-L xan_e <-> xan h_e + xan_e -> h + xan cit_e + succ -> cit + succ_e h_e + ser-D_e <-> h + ser-D atp + h2o + pro-L_e -> adp + h + pi + pro-L h_e + pro-L_e <-> h + pro-L atp + cys-L_e + h2o -> adp + cys-L + h + pi glcn_e + h_e <-> glcn + h asn-L_e + atp + h2o -> adp + asn-L + h + pi asn-L_e + h_e <-> asn-L + h h_e + pyr_e <-> h + pyr atp + h2o + so4_e -> adp + h + pi + so4 h_e + mal-L_e -> 2 h + mal-L 3 h_e + mal-L_e -> 3 h + mal-L fum_e + 2 h_e -> fum + 2 h fum_e + 3 h_e -> fum + 3 h fum_e + succ <-> fum + succ_e atp + h2o + rib-D_e -> adp + h + pi + rib-D dcyt_e + h_e -> dcyt + h fru_e -> fru 5mthf <-> 5mthf_e h2o_e <-> h2o nh4_e <-> nh4 h_e + pi_e <-> h + pi atp + h2o + so4_e -> adp + h + pi + so4 h_e + tyr-L_e <-> h + tyr-L h_e + lys-L_e <-> h + lys-L sucr_e <-> sucr sbt_e<-> sbt-D acin <-> acin_e Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport Reactions Transport reactions Transport reactions Transport reactions ** T170 T171 T172 T173 tryp6 tryp1 tryp2 glyc <-> glyc_e formate <-> formate_e xltol -> xltol_e butol -> butol_e anth + prpp <-> ppi + N5panth 11cd5p <-> in3gp + co2 + h2o chor + gln-L <-> anth + pyr + glu-L Transport reactions Transport reactions Transport reactions Transport reactions Tryptophan biosynthesis Tryptophan biosynthesis Tryptophan biosynthesis 2.4.2.18 4.1.1.48 4.1.3.27 trpD trpC trpGD/trpG/trpE ZMO0200 ZMO0545 ZMO0201, ZMO0468 * * ** ** ** *** *** *** **** **** **** tryp3 ser-L + indole -> trp-L + h2o 4.2.1.20 trpA/trpB ZMO0584, ZMO0585 Tryptophan biosynthesis * ** *** **** tryp4 in3gp <-> indole + g3p 4.2.1.20 trpA ZMO0584, ZMO0585 Tryptophan biosynthesis * ** *** **** tryp5 tryp7 N5panth <-> 11cd5p 2 3hanth + 4 o2 <-> cval + 2 h2o2 + 2 o2 + 2 h 5.3.1.24 1.11.1.6 trpF cat ZMO0586 ZMO0918 Tryptophan biosynthesis Tryptophan degradation to 2-amino-3carboxymuconate semialdehyde * ** ** *** *** **** **** tyr2 tyr3 tyr1 co2 + hgent -> 34hpp + o2 4hphelac + nadh + o2 <-> hgent + nad + h2o 4hphelac + o2 + nadh <-> 34dyphelac + nad + h2o 1.13.11.27 1.14.13.18 1.14.13.3 tyr6 nad + pphn -> 34hpp + co2 + nadh tyr7 *** **** *** *** **** **** Tyrosine metabolism Tyrosine metabolism Tyrosine metabolism ** ** ** 1.3.1.12 Tyrosine, Tryptophan, and Phenylalanine Metabolism ** akg + tyr-L <-> 34hpp + glu-L 2.6.1.5 Tyrosine, Tryptophan, and Phenylalanine Metabolism ** tyr5 akg + phe-L <-> glu-L + phpyr 2.6.1.58 Tyrosine, Tryptophan, and Phenylalanine Metabolism ** tyr4 3ig3p + ser-L -> g3p + h2o + trp-L 4.2.1.20 trpA/trpB ZMO0584, ZMO0585 Tyrosine, Tryptophan, and Phenylalanine Metabolism ** anorg7 arg14 2 h + 2 o2 -> h2o2 + o2 h2o + arg-L <-> urea + orn-L 1.15.1.1 3.5.3.1 sod speB ZMO1060 ZMO0432 Unassigned Urea cycle, arginine degradation I (Arginase pathway), L-citrulline biosynthesis val1 val2 23dhmb + nadp <-> alac + nadph + h 2 pyr <-> alac + co2 1.1.1.86 2.2.1.6 ilvC ilvI/ilvH ZMO1141 ZMO0687, ZMO1139, ZMO1140 Valine biosynthesis Valine biosynthesis ** ** *** *** **** **** val3 val4 23dhmp <-> 3mop + h2o isobutanal + nadh <-> isobutanol + nad 4.2.1.9 1.1.1.1 ilvD adhA/adhB ZMO1792 ZMO1236, ZMO1596, ZMO1722 Valine biosynthesis Valine degradation II ** ** *** *** **** **** val5 3mob <-> isobutanal + co2 4.1.1.1 pdc hpaB Valine degradation II * * ** **** val7 3c3hmp <-> ippm + h2o 4.2.1.33 ZMO0105, ZMO0106 Valine, leucine, and isoleucine metabolism val8 ippm + h2o <-> 3c2hmp 4.2.1.33 ZMO0105, ZMO0106 Valine, leucine, and isoleucine metabolism val6 3c4mop + h -> 4mop + co2 Valine, leucine, and isoleucine metabolism Protein 2.144 ala-L + 0.371 arg-L + 0.435 asn-L + 0.435 asp-L + 0.037 cys-L + 0.308 gln-L + 0.307 glu-L + 0.146 his-L + 0.672 ile-L + 0.672 leu-L + 0.447 lys-L + 0.145 met-L + 0.019 phe-L + 0.391 pro-L + 0.383 ser-L + 0.415 thr-L + 0.093 trp-L + 0.122 tyr-L + 1.057 val-L + 44.92 atp -> 44.92 adp + 44.92 pi + protein 0.869 datp + 0.75 dctp + 0.869 dttp + 0.75 dgtp + 4.4 atp -> 4.4 adp + 4.4 pi + 3.237 ppi + dna Biomass Synthesis RNA 0.926 gtp + 0.734 ctp + 0.774 utp + 1.906 atp -> 1.24 adp + 1.24 pi + 3.1 ppi + rna Biomass Synthesis Phospholipid 0.118 cardiolipin + 0.665 peam + 0.054 L1pgly + 0.141 pi + 0.25 pc -> phospholipid Biomass Synthesis Cell Wall 0.956 uamr + 0.956 uacgam + 0.956 ala-L + 0.956 26dap-M + 0.956 ala-D + 0.956 glu-D + 3.824 atp -> cw + 0.956 udp + 0.956 ump + 3.824 adp + 3.824 pi 0.167 nad + 0.149 nadp + 0.145 coa + 1.26 ptrc + 0.765 spmd + 0.249 thf + 0.273 FMN + 0.141 fad -> sm Biomass Synthesis Carbohydrates 1.897 udpg + 3.794 udpgal -> carbo + 5.691 udp Biomass Synthesis Biomass 0.605 protein + 0.027 dna + 0.195 rna + 0.053 phospholipid + 0.038 sm + 0.025 cw + 0.025 carbo -> Biomass Biomass Synthesis DNA Small molecules * ** *** **** ** *** **** *** **** ** Biomass Synthesis Biomass Synthesis Kanehisa M, Goto S, Hattori M, Aoki-Kinoshita KF, Itoh M, Kawashima S, Katayama T, Araki M, Hirakawa M. 2006. From genomics to chemical genomics: new developments in KEGG. Nucleic Acids Research 34(Database issue):D354-357. Caspi R, Foerster H, Fulcher CA, Hopkinson R, Ingraham J, Kaipa P, Krummenacker M, Paley S, Pick J, Rhee SY et al. 2006. MetaCyc: a multiorganism database of metabolic pathways and enzymes. Nucleic Acids Research 34(Database issue):D511-516. Seo J-S, Chong H, Park HS, Yoon K-O, Jung C, Kim JJ, Hong JH, Kim H, Kim J-H, Kil J-I et al. 2005. The genome sequence of the ethanologenic bacterium Zymomonas mobilis ZM4. Nature Biotechnology 23(1):63-68. Yang S, Pappas KM, Hauser LJ, Land ML, Chen G-L, Hurst GB, Pan C, Kouvelis VN, Typas MA, Pelletier DA et al. 2009. Improved genome annotation for Zymomonas mobilis. Nature Biotechnology 27(10):893-894. Metabolites Metabolite KEGGID Molecular Formula Abbreviation 10fthf 10fthfglu 11cd5p C00234 C05928 C01302 C20H23N7O7 C25H30N8O10 C12H16NO9P 10-Formyltetrahydrofolate; 10-Formyl-THF; 10-Formyltetrahydrofolyl L-glutamate; 10-Formyl-THF-L-glutamate; 1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate; 13dpg C00236 C3H8O10P2 3-Phospho-D-glyceroyl phosphate; 1,3-Bisphospho-D-glycerate; (R)-2-Hydroxy-3-(phosphonooxy)-1monoanhydride with phosphoric propanoic acid; 14aDg(n) 14aDg(n+1) 1am2p3p G10495 G10495 C11638 (Glc)1 (*)2 (Glc)1 (*)2 C3H8NO5P 1,4-alpha-D-Glucan; 1,4-alpha-Glucan; Amylose; Maltodextrin 1,4-alpha-D-Glucan; 1,4-alpha-Glucan; Amylose; Maltodextrin 3-Amino-2-oxopropyl phosphate; 1-Amino-3-(phosphohydroxy)propan-2-one 1eryimi C04666 C6H11N2O6P D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate; D-erythro-Imidazole-glycerol 3-phosphate; D-erythro-Imidazoleglycerol phosphate; 2345thdpcl C03972 C7H9NO4 2,3,4,5-Tetrahydrodipicolinate; delta1-Piperidine-2,6-dicarboxylate; L-2,3,4,5-Tetrahydrodipicolinate; (S)-2,3,4,5Tetrahydropyridine-2,6-dicarboxylate; 23ddhb 23dhb 23dhmb C04171 C00196 C04039 C7H8O4 C7H6O4 C5H10O4 (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate; (2S,3S)-2,3-Dihydroxy-2,3-dihydroxybenzoate 2,3-Dihydroxybenzoate; 2,3-Dihydroxybenzoic acid 2,3-Dihydroxy-3-methylbutanoate; 2,3-Dihydroxy-isovalerate; 2,3-Dihydroxy-isovaleric acid 23dhmp C06007 C6H12O4 (R)-2,3-Dihydroxy-3-methylpentanoate; (R)-2,3-Dihydroxy-3-methylvalerate; (2R,3R)-2,3-Dihydroxy-3methylpentanoate 23dhpcl 25dkcam 25dkglcn 26ahept C03340 BioCyc C02780 C00666 C7H7NO4 C10H14O2 C6H8O7 C7H14N2O4 L-2,3-Dihydrodipicolinate; Dihydrodipicolinic acid; Dihydrodipicolinate; 2,3-Dihydrodipicolinate; 2,5-diketocamphane; 2,5-dioxocamphane 2,5-Didehydro-D-gluconate; 2,5-Diketogluconic acid LL-2,6-Diaminoheptanedioate; LL-2,6-Diaminopimelate; LL-2,6-Diaminopimelic acid; 26dap-M C00680 C7H14N2O4 meso-2,6-Diaminoheptanedioate; meso-2,6-Diaminopimelate; meso-2,6-Diaminopimelic acid; mesoDiaminoheptanedioate; 2a3o4pbuty C07335 C4H8NO7P 2-Amino-3-oxo-4-phosphonooxybutyrate; L-2-Amino-3-oxo-4-phosphonooxybutyrate; (2S)-2-Amino-3-oxo-4phosphonooxybutanoate; 2ahbut C06006 C6H10O4 (S)-2-Aceto-2-hydroxybutanoate; (S)-2-Hydroxy-2-ethyl-3-oxobutanoate 2aobut C03508 C4H7NO3 L-2-Amino-3-oxobutanoic acid; L-2-Amino-3-oxobutanoate; L-2-Amino-acetoacetate; (S)-2-Amino-3-oxobutanoic acid; 2cmer24cp C11453 C5H12O9P2 2-C-Methyl-D-erythritol 2,4-cyclodiphosphate; 3-Methyl-1,2,3,4-tetrahydroxybutane-1,3-cyclic bisphosphate; 2cmery4pi C11434 C5H13O7P 2-C-Methyl-D-erythritol 4-phosphate; 2DDA7P C04691 C7H13O10P 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate; 3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate; 3Deoxy-arabino-heptulonate 7-phosphate; 3-Deoxy-D-arabino-heptulosonic acid 7-phosphate; DAHP; 2-Dahp; 2dhglcn C06473 C6H10O7 2-Keto-D-gluconic acid; 2-Dehydro-D-gluconate; 2-Dehydro-D-gluconic acid; alpha-D-arabino-2-Hexulosonic acid 2dhp 2dr1p 2dr5p 2drn3p 2h3oppan 2hacgth 2hhdiene 2kmb 2mahmp 2metbutl 2metbutn C00966 C00672 C00673 C04283 C01146 C03451 C05600 Ecoli C04752 BioCyc C02223 C6H10O4 C5H11O7P C5H11O7P C5H12O12P3R C3H4O4 C13H21N3O8S C7H8O5 C5H7O3S C6H11N3O7P2 C5H12O C5H10O 2-Dehydropantoate 2-Deoxy-D-ribose 1-phosphate; 2-Deoxy-alpha-D-ribose 1-phosphate; 2-Deoxy-D-ribose 5-phosphate 2'-Deoxyribonucleoside triphosphate; 2-Hydroxy-3-oxopropanoate; Tartronate semialdehyde (R)-S-Lactoylglutathione; 2-Hydroxyhepta-2,4-dienedioate; 2-Hydroxyhepta-2,4-diene-1,7-dioate 2-keto-4-methylthiobutyrate 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate; 4-Amino-2-methyl-5-diphosphomethylpyrimidine; active amyl alcohol, 2-methyl-n-butanol, 2-methylbutyl alcohol, sec-butylcarbinol, 2-methylbutanol 2-Methylbutanal; 2-Methylbutyraldehyde 2obut C00109 C4H6O3 2-Oxobutanoate; 2-Ketobutyric acid; 2-Oxobutyric acid; 2-Oxobutyrate; 2-Oxobutanoic acid; alpha-Ketobutyric acid; alpha-Ketobutyrate; 2op6m14bq 2op6mph 2op6ph 2oph 2p4c2me 2pg 2pglyclt 2pheethl 2thippi C05813 C05812 C05811 C05810 C11436 C00631 C00988 BioCyc C05125 C47H70O3 C47H72O2 C46H70O2 C46H70O C14H26N3O17P3 C3H7O7P C2H5O6P C8H10O C14H23N4O8P2S 2-Octaprenyl-6-methoxy-1,4-benzoquinone 2-Octaprenyl-6-methoxyphenol 2-Octaprenyl-6-hydroxyphenol 2-Octaprenylphenol 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol 2-Phospho-D-glycerate; D-Glycerate 2-phosphate; 2-Phosphoglycolate; Phosphoglycolic acid; benzeneethanol, phenethanol, 2-phenylethanol 2-(alpha-Hydroxyethyl)thiamine diphosphate; 2-Hydroxyethyl-ThPP; 34dyphelac C01161 C8H8O4 3,4-Dihydroxyphenylacetate; 3,4-Dihydroxyphenylacetic acid; 3,4-Dihydroxyphenyl acetate; 3,4-Dihydroxyphenyl acetic acid; Homoprotocatechuate 34hpp C01179 C9H8O4 3-(4-Hydroxyphenyl)pyruvate; 4-Hydroxyphenylpyruvate; p-Hydroxyphenylpyruvic acid; 3c2hmp C04411 C7H12O5 (2R,3S)-3-Isopropylmalate; 3-Isopropylmalate; 3-Carboxy-2-hydroxy-4-methylpentanoate; 2-D-threo-Hydroxy-3carboxy-isocaproate; 3c3hmp C02504 C7H12O5 (2S)-2-Isopropylmalate; 2-Isopropylmalate; 2-Isopropylmalic acid; 3-Carboxy-3-hydroxy-4-methylpentanoate; 3Carboxy-3-hydroxy-isocaproate; 3-Carboxy-3-hydroxyisocaproate; 2-Hydroxy-2-isopropylbutanedioate; 3-Hydroxy4-methyl-3-carboxypentanoate; 3dhq 3dhsk 3dmq8 3hanth 3hbtcoa 3hdecoylacp C00944 C02637 C05815 C00632 C01144 C04619 C7H10O6 C7H8O5 C48H72O4 C7H7NO3 C25H42N7O18P3S C10H19O2SR 3-Dehydroquinate; 5-Dehydroquinate; 3-Dehydroquinic acid; 5-Dehydroquinic acid 3-Dehydroshikimate; 2-Octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone 3-Hydroxyanthranilate; 3-Hydroxyanthranilic acid; (S)-3-Hydroxybutanoyl-CoA; (S)-3-Hydroxybutyryl-CoA (3R)-3-Hydroxydecanoyl-[acyl-carrier protein]; (R)-3-Hydroxydecanoyl-[acyl-carrier protein] 3ig3p C03506 C11H14NO6P Indoleglycerol phosphate; 1-C-(Indol-3-yl)glycerol 3-phosphate; (3-Indolyl)-glycerol phosphate; C1-(3-Indolyl)glycerol 3-phosphate; (1S,2R)-1-C-(Indol-3-yl)glycerol 3-phosphate; Indole-3-glycerol phosphate; 3imiop 3metbutn C01267 BioCyc C6H9N2O5P C5H10O 3-(Imidazol-4-yl)-2-oxopropyl phosphate; Imidazole-acetol phosphate; 3-methylbutanal, isoamylaldehyde, isopentaldehyde 3metthpron BioCyc C4H8OS methional, 3-methylthiopropional, 3-methylthio-propionaldehyde, 3-methylsulfanyl-propanal, 3-methylmercaptopropionaldehyde 3mob C00141 C5H8O3 3-Methyl-2-oxobutanoic acid; 3-Methyl-2-oxobutyric acid; 3-Methyl-2-oxobutanoate; 2-Oxo-3-methylbutanoate; 2-Oxoisovalerate; 2-Oxoisopentanoate; alpha-Ketovaline; 2-Ketovaline; 2-Keto-3-methylbutyric acid; 3mop C00671 C6H10O3 (S)-3-Methyl-2-oxopentanoic acid; (S)-3-Methyl-2-oxopentanoate; (3S)-3-Methyl-2-oxopentanoic acid; (3S)-3Methyl-2-oxopentanoate; 3oddcaACP 3oddcoa 3odylACP 3ohdACP 3ohexACP 3ohexdeccoa 3ooctACP 3ophb 3ottylACP 3ottylcoa 3pg C05756 C05263 C05753 C05762 C05746 C05269 C05750 C05809 C05759 C05261 C00197 C12H21O2SR C33H56N7O18P3S C10H17O2SR C16H29O2SR C6H9O2SR C27H44N7O18P3S C8H13O2SR C47H70O3 C14H25O2SR C35H60N7O18P3S C3H7O7P 3-Oxododecanoyl-acp]; 3-Oxododecanoyl-acyl-carrier protein]; 3-Oxododecanoyl-CoA 3-Oxodecanoyl-acp]; 3-Oxodecanoyl-acyl-carrier protein]; 3-Oxohexadecanoyl-acp]; 3-Oxohexadecanoyl-acyl-carrier protein]; 3-Oxohexanoyl-acp]; 3-Oxohexanoyl-acyl-carrier protein]; 3-Oxohexanoyl-CoA; 3-Ketohexanoyl-CoA 3-Oxooctanoyl-acp]; 3-Oxooctanoyl-acyl-carrier protein]; 3-Octaprenyl-4-hydroxybenzoate 3-Oxotetradecanoyl-acp]; 3-Oxotetradecanoyl-acyl-carrier protein]; 3-Oxotetradecanoyl-CoA 3-Phospho-D-glycerate; D-Glycerate 3-phosphate; 3-Phospho-(R)-glycerate; 3phpyr C03232 C3H5O7P 3-Phosphonooxypyruvate; 3-Phosphonooxypyruvic acid; 3-Phosphohydroxypyruvate; 3-Phosphohydroxypyruvic acid 3pser 3sala 3spyr 4abz 4adcho 4ahmmp 4ampm C01005 C00606 C05527 C00568 C11355 C01279 C04556 C3H8NO6P C3H7NO4S C3H4O5S C7H7NO2 C10H11NO5 C6H9N3O C6H10N3O4P O-Phospho-L-serine; L-O-Phosphoserine; 3-Phosphoserine; Dexfosfoserine 3-Sulfino-L-alanine; L-Cysteinesulfinic acid; 3-Sulphino-L-alanine; 3-Sulfinoalanine 3-Sulfinylpyruvate; 3-Sulfinopyruvate 4-Aminobenzoate; ABEE; 4-Aminobenzoic acid; p-Aminobenzoate; 4-Amino-4-deoxychorismate; ADC 4-Amino-5-hydroxymethyl-2-methylpyrimidine; Toxopyrimidine; 4-Amino-2-methyl-5-pyrimidinemethanol 4-Amino-2-methyl-5-phosphomethylpyrimidine; 4-Amino-5-phosphomethyl-2-methylpyrimidine; 4c2me C11435 C14H25N3O14P2 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol 4carn C04751 C9H14N3O9P 1-(5-Phospho-D-ribosyl)-5-amino-4-imidazolecarboxylate; 1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxylate; 1-(5'-Phosphoribosyl)-5-amino-4-carboxyimidazole; 5'-Phosphoribosyl-5-amino-4-imidazolecarboxylate; 1-(5'Phosphoribosyl)-4-carboxy-5-aminoimidazole; 5'-Phosphoribosyl-4-carboxy-5-aminoimidazole; 5-Amino-1-(5phospho-D-ribosyl)imidazole-4-carboxylate; 4cmol 4h2ktp 4hphelac C12834 C05601 C00642 C6H2Cl2O4 C7H10O6 C8H8O3 2,5-Dichloro-carboxymethylenebut-2-en-4-olide 4-Hydroxy-2-oxo-heptanedioate; 4-Hydroxy-2-ketopimelate; 4-Hydroxy-2-oxoheptanedioic acid 4-Hydroxyphenylacetate; 4-Hydroxyphenylacetic acid 4mhetz C04294 C6H9NOS 5-(2-Hydroxyethyl)-4-methylthiazole; 4-Methyl-5-(2'-hydroxyethyl)-thiazole; 4-Methyl-5-(2-hydroxyethyl)-thiazole 4mop C04236 C7H10O5 (2S)-2-Isopropyl-3-oxosuccinate; 3-Carboxy-4-methyl-2-oxopentanoate; 2-Oxo-4-methyl-3-carboxypentanoate; 4mpetz 4o2ene 4pasp 4per 4ppan 4r5au C04327 C12835 C03082 C03393 C03492 C04732 C6H10NO4PS 6H4Cl2O5 C4H8NO7P C4H9O8P C9H18NO8P C9H16N4O6 4-Methyl-5-(2-phosphoethyl)-thiazole; 4-Methyl-5-(2-phosphono-oxyethyl)-thiazole 2,5-Dichloro-4-oxohex-2-enedioate 4-Phospho-L-aspartate; L-4-Aspartyl phosphate; 4-Phospho-D-erythronate; 4-Phosphoerythronate D-4'-Phosphopantothenate; (R)-4'-Phosphopantothenate; 4-(1-D-Ribitylamino)-5-amino-2,6-dihydroxypyrimidine; 4-(1-D-Ribitylamino)-5-aminouracil; 55adetp C01260 C20H28N10O19P4 P1,P4-Bis(5'-adenosyl) tetraphosphate; AppppA 5a6rpmd BioCyc C9H16N4O6 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione, 6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine, 6-(1D-ribitylamino)-5-aminouracil, ARP 5aprbu C04454 C9H17N4O9P 5-Amino-6-(5'-phosphoribitylamino)uracil; 5-Amino-2,6-dioxy-4-(5'-phosphoribitylamino)pyrimidine; 5-Amino-6(5-phosphoribitylamino)uracil 5apru C01268 C9H15N4O9P 5-Amino-6-(5'-phosphoribosylamino)uracil; 5-Amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate; 5-Amino-6-(5-phosphoribosylamino)uracil; 5c2hm 5c2o3ene 5'-dad-2 5dglcn 5eskm3p 5exhcamp C04186 C04052 C05198 C01062 C01269 BioCyc C8H8O7 C8H8O7 C10H13N5O3 C6H10O7 C10H13O10P C10H16O2 5-Carboxymethyl-2-hydroxymuconate 5-Carboxy-2-oxohept-3-enedioate; 5-Oxopent-3-ene-1,2,5-tricarboxylate 5'-Deoxyadenosine; 5-Dehydro-D-gluconate; 5-Dehydrogluconate 5-O-(1-Carboxyvinyl)-3-phosphoshikimate; O5-(1-Carboxyvinyl)-3-phosphoshikimate (+)-exo-5-hydroxycamphor, (+)-5-exo-hydroxycamphor, 5-exo-hydroxycamphor 5mdr1p C04188 C6H13O7PS S-Methyl-5-thio-D-ribose 1-phosphate; S-Methyl-5-thio-alpha-D-ribose 1-phosphate; S-Methyl-5-thio-5-deoxy-Dribose 1-phosphate 5mdru1p C04582 C6H13O7PS S-Methyl-5-thio-D-ribulose 1-phosphate 5mta C00170 C11H15N5O3S 5'-Methylthioadenosine; Methylthioadenosine; S-Methyl-5'-thioadenosine; 5-Methylthioadenosine; 5'-Deoxy-5'(methylthio)adenosine; Thiomethyladenosine; MTA 5mthf 5mthglu 5mtr C00440 C04489 C03089 C20H25N7O6 C30H39N9O12 C6H12O4S 5-Methyltetrahydrofolate; 5-Methyltetrahydropteroyltri-L-glutamate; 5-Methylthio-D-ribose; S-Methyl-5-thio-D-ribose 5pimi C04823 C13H19N4O12P 1-(5'-Phosphoribosyl)-5-amino-4-(N-succinocarboxamide)-imidazole; 1-(5'-Phosphoribosyl)-4-(Nsuccinocarboxamide)-5-aminoimidazole; 5'-Phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole; (S)-2-[5Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamido]succinate; SAICAR 67dl 6hmhpt BioCyc C01300 C13H17N4O6 C7H9N5O2 6,7-dimethyl-8-(1-D-ribityl)lumazine 2-Amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine; 6hmhptpp C04807 C7H11N5O8P2 2-Amino-7,8-dihydro-4-hydroxy-6-(diphosphooxymethyl)pteridine; 2-Amino-4-hydroxy-6-hydroxymethyl-7,8dihydropteridine diphosphate; 7,8-Dihydropterin pyrophosphate; 78dapg 7k8apg aacoa aacp ac C01037 C01092 C00332 C00173 C00033 C9H20N2O2 C9H17NO3 C25H40N7O18P3S C3H4OSR2 C2H4O2 7,8-Diaminononanoate; 8-Amino-7-oxononanoate; 8-Amino-7-oxononanoic acid; Acetoacetyl-CoA; Acetoacetyl coenzyme A; 3-Acetoacetyl-CoA Acyl-acyl-carrier protein]; Long-chain-acyl-acyl-carrier protein]; Acetate; Acetic acid; Ethanoic acid; Glacial acetic acid acACP acald accoa acgald acgam1p acgam6p acglu acglu-p achms acin aclipoly C03939 C00084 C00024 C01250 C04501 C00357 C00624 C04133 C01077 C00810 C16255 C2H3OSR C2H4O C23H38N7O17P3S C7H11NO4 C8H16NO9P C8H16NO9P C7H11NO5 C7H12NO8P C6H11NO4 C4H8O2 C10H18NO2S2R Acetyl-acyl-carrier protein]; Acetaldehyde; Ethanal; Acetyl-CoA; Acetyl coenzyme A; N-Acetyl-L-glutamate 5-semialdehyde; 2-Acetamido-5-oxopentanoate N-Acetyl-alpha-D-glucosamine 1-phosphate; N-Acetyl-D-glucosamine 6-phosphate N-Acetyl-L-glutamate; N-Acetyl-L-glutamic acid; N-Acetyl-L-glutamate 5-phosphate; N-Acetyl-L-glutamyl 5-phosphate O-Acetyl-L-homoserine (R)-Acetoin; (R)-2-Acetoin; (R)-3-Hydroxy-2-butanone; (R)-Dimethylketol; (R)-3-Hydroxybutan-2-one [Dihydrolipoyllysine-residue acetyltransferase] S-acetyldihydrolipoyllysine; S-Acetyldihydrolipoamide-E acnam C00270 C11H19NO9 N-Acetylneuraminate; N-Acetylneuraminic acid; 5-Acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulosonic acid; Neu5Ac acorn ACP acryl acser actACP ade adenylo-succ adn adp adpglc ahcys C00437 C00229 C02218 C00979 C05744 C00147 C03794 C00212 C00008 C00498 C00021 C7H14N2O3 HSR C3H5NO2 C5H9NO4 C4H5O2SR C5H5N5 C14H18N5O11P C10H13N5O4 C10H15N5O10P2 C16H25N5O15P2 C14H20N6O5S N-Acetylornithine; N2-Acetyl-L-ornithine; Acyl-carrier protein; ACP; Acyl-carrier protein]; Holo-acyl-carrie-protein]; 2-Aminoacrylate; Dehydroalanine; O-Acetyl-L-serine; O3-Acetyl-L-serine Acetoacetyl-acp]; Acetoacetyl-acyl-carrier protein]; Adenine; 6-Aminopurine; N6-(1,2-Dicarboxyethyl)-AMP; Adenylosuccinate; Adenylosuccinic acid Adenosine; ADP; Adenosine 5'-diphosphate; ADP-glucose; Adenosine diphosphoglucose S-Adenosyl-L-homocysteine; S-Adenosylhomocysteine; ahdt C04895 C9H16N5O13P3 2-Amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine triphosphate; 6-(L-erythro-1,2Dihydroxypropyl 3-triphosphate)-7,8-dihydropterin; 6-(1S,2R)-1,2-Dihydroxy-3-triphosphooxypropyl]-7,8dihydropterin; aicar C04677 C9H15N4O8P 1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxamide; 5'-Phosphoribosyl-5-amino-4-imidazolecarboxamide; 5'Phospho-ribosyl-5-amino-4-imidazole carboxamide; AICAR; 5-Aminoimidazole-4-carboxamide ribotide; 5Phosphoribosyl-4-carbamoyl-5-aminoimidazole; 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide air C03373 C8H14N3O7P Aminoimidazole ribotide; AIR; 1-(5'-Phosphoribosyl)-5-aminoimidazole; 5'-Phosphoribosyl-5-aminoimidazole; 1-(5Phospho-D-ribosyl)-5-aminoimidazole; 5-Amino-1-(5-phospho-D-ribosyl)imidazole; akg alaala ala-B alac ala-D ala-L alltn C00026 C00993 C01401 C00900 C00133 C00041 C01551 C5H6O5 C6H12N2O3 C3H7NO2 C5H8O4 C3H7NO2 C3H7NO2 C4H6N4O3 2-Oxoglutarate; Oxoglutaric acid; 2-Ketoglutaric acid; alpha-Ketoglutaric acid; D-Alanyl-D-alanine; D-Ala-D-Ala; Alanine; 2-Aminopropionic acid; 2-Aminopropanoic acid; (S)-2-Acetolactate; (S)-2-Hydroxy-2-methyl-3-oxobutanoate D-Alanine; D-2-Aminopropionic acid; D-Ala; L-Alanine; L-2-Aminopropionic acid; L-alpha-Alanine; Allantoin; 5-Ureidohydantoin; Glyoxyldiureide alltt amet C00499 C00019 C4H8N4O4 C15H23N6O5S Allantoate; Allantoic acid S-Adenosyl-L-methionine; S-Adenosylmethionine; Acylcarnitine; ametam C01137 C14H23N6O3S S-Adenosylmethioninamine; (5-Deoxy-5-adenosyl)(3-aminopropyl)methylsulfonium; (5-Deoxy-5-adenosyl)(3aminopropyl)methylsulfonium cation; S-Adenosyl-(5')-3-methylthiopropylamine amp C00020 C10H14N5O7P AMP; Adenosine 5'-monophosphate; Adenylic acid; Adenylate; 5'-AMP; 5'-Adenylic acid; 5'-Adenosine monophosphate; Adenosine 5'-phosphate; anth apoACP aps ara5p arab-L argen-L arg-L C00108 C16240 C00224 C01112 C00259 C00826 C00062 C7H7NO2 NH3R C10H14N5O10PS C5H11O8P C5H10O5 C10H13NO5 C6H14N4O2 Anthranilate; Anthranilic acid; o-Aminobenzoic acid; Vitamin L1; 2-Aminobenzoate Apoprotein; Adenylyl sulfate; Adenosine 5'-phosphosulfate; APS; 5'-Adenylyl sulfate; D-Arabinose 5-phosphate; L-Arabinose; L-Arabinopyranose L-Arogenate; L-Arogenic acid; Pretyrosine L-Arginine; (S)-2-Amino-5-guanidinovaleric acid; argsuc C03406 C10H18N4O6 N-(L-Arginino)succinate; N(omega)-(L-Arginino)succinate; L-Argininosuccinate; L-Argininosuccinic acid; LArginosuccinic acid argtrnaarg C02163 C21H33N9O11PR(C5H8O6PR)n L-Arginyl-tRNA(Arg); L-Arginyl-tRNA asn-L aspald asp-L asptrnasp atp bald C00152 C00441 C00049 C02984 C00002 C00261 C4H8N2O3 C4H7NO3 C4H7NO4 C14H22NO13PR2(C5H8O6PR)n C10H16N5O13P3 C7H6O L-Asparagine; 2-Aminosuccinamic acid; L-Aspartate 4-semialdehyde; Aspartate beta-semialdehyde; L-Aspartic 4-semialdehyde; L-Aspartate; L-Aspartic acid; 2-Aminosuccinic acid; L-Aspartyl-tRNA(Asp); ATP; Adenosine 5'-triphosphate; Benzaldehyde; Benzoic aldehyde BCCP(monomer) C04735 C7H13N3O2R2 Apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] bccpd bccpm benzoate betald btcoa btn but2enoylacp butACP canavanine C06250 C04681 C00180 C00576 C00136 C00120 C04246 C05745 BioCyc C17H27N5O4SR2 C17H27N5O4SR2 C7H6O2 C5H12NO C25H42N7O17P3S C10H16N2O3S C4H5OSR C4H7OSR C5H13N4O3 Holo-carboxylase]; Biotin-carboxyl-carrier protein; [Acetyl-CoA:carbon-dioxide ligase (ADP-forming)] Benzoate; Benzoic acid; Benzenecarboxylic acid; Phenylformic acid; Dracylic acid; Betaine aldehyde Butanoyl-CoA; Butyryl-CoA Biotin; D-Biotin; Vitamin H; Coenzyme R; But-2-enoyl-acyl-carrier protein]; Butyryl-acp]; Butyryl-acyl-carrier protein]; L-canavanine, 2-amino-4-(guanidinooxy)butyrate, 2-amino-4-(guanidinooxy)butyric acid canavaninosucc BioCyc C9H15N4O7 canavaninosuccinate carbasp carbo cardiolipin cbbtn-BCCP C00438 #N/A C05980 C04419 C5H8N2O5 N-Carbamoyl-L-aspartate; #N/A C13H18O17P2R4 C18H26N5O6SR2 #N/A Cardiolipin; Diphosphatidylglycerol; 1',3'-Bis(1,2-diacyl-sn-glycero-3-phospho)-sn-glycerol Carboxybiotin-carboxyl-carrier protein; cbp cdp cdp-diacylglyc chol chor cis-aconitate cit citr-L ckdo C00169 C00112 C00269 C00114 C00251 C00417 C00158 C00327 C04121 CH4NO5P C9H15N3O11P2 C14H19N3O15P2R2 C5H14NO C10H10O6 C6H6O6 C6H8O7 C6H13N3O3 C17H26N3O15P Carbamoyl phosphate; CDP; Cytidine 5'-diphosphate; Cytidine diphosphate; CDP-diacylglycerol; CDP-1,2-diacylglycerol; 1,2-Diacyl-sn-glycero-3-cytidine-5'-diphosphate; Choline; Bilineurine Chorismate; Chorismic acid; cis-Aconitate; cis-Aconitic acid; Citrate; Citric acid; 2-Hydroxy-1,2,3-propanetricarboxylic acid; 2-Hydroxytricarballylic acid; L-Citrulline; 2-Amino-5-ureidovaleric acid; Citrulline CMP-3-deoxy-D-manno-octulosonate; CMP-KDO; cmcald C04642 C8H8O6 2-Hydroxy-5-carboxymethylmuconate semialdehyde; 5-Carboxymethyl-2-hydroxymuconate semialdehyde; 5Carboxymethyl-2-hydroxymuconic semialdehyde cmp co2 coa cpppg3 csn ctp cval cw cyan Cys-Gly cys-L cyst-L cystrnacys cytd dad-2 dadp C00055 C00011 C00010 C03263 C00380 C00063 C05640 #N/A C00177 C01419 C00097 C02291 C03125 C00475 C00559 C00206 C9H14N3O8P CO2 C21H36N7O16P3S C36H44N4O8 C4H5N3O C9H16N3O14P3 C14H8N2O6 #N/A CN C5H10N2O3S C3H7NO2S C7H14N2O4S C18H26N6O11PSR(C5H8O6PR)n C9H13N3O5 C10H13N5O3 C10H15N5O9P2 damp C00360 C10H14N5O6P dAMP; 2'-Deoxyadenosine 5'-phosphate; 2'-Deoxyadenosine 5'-monophosphate; Deoxyadenylic acid; Deoxyadenosine monophosphate; datp C00131 C10H16N5O12P3 dATP; 2'-Deoxyadenosine 5'-triphosphate; Deoxyadenosine 5'-triphosphate; Deoxyadenosine triphosphate; db4p BioCyc C4H7O6P L-3,4-dihydroxybutan-2-one-4-phosphate, 3,4-dihydroxy-2-butanone-4-phosphate, tetrolose phosphate, 3,4dihydroxy-2-butanone-4-P dcACP dcdp C05755 C00705 C10H19OSR C9H15N3O10P2 Decanoyl-acp]; Decanoyl-acyl-carrier protein]; dCDP; 2'-Deoxycytidine diphosphate; 2'-Deoxycytidine 5'-diphosphate dcmp C00239 C9H14N3O7P dCMP; Deoxycytidylic acid; Deoxycytidine monophosphate; Deoxycytidylate; 2'-Deoxycytidine 5'-monophosphate dctp dcyt ddcaACP ddecenacp C00458 C00881 C05223 C05758 C9H16N3O13P3 C9H13N3O4 C12H23OSR C12H21OSR dCTP; Deoxycytidine 5'-triphosphate; Deoxycytidine triphosphate; 2'-Deoxycytidine 5'-triphosphate; Deoxycytidine; 2'-Deoxycytidine; Dodecanoyl-acyl-carrier protein]; Dodecanoyl-acp]; Lauroyl-acyl-carrier protein]; trans-Dodec-2-enoyl-acp]; trans-Dodec-2-enoyl-acyl-carrier protein]; (2E)-Dodecenoyl-acp]; CMP; Cytidine-5'-monophosphate; Cytidylic acid; CO2; Carbon dioxide; CoA; Coenzyme A; CoA-SH; Coproporphyrinogen III; Cytosine CTP; Cytidine 5'-triphosphate; Cytidine triphosphate; Cinnavalininate; #N/A Cyanide; Prussiate; CN-; Cyano Cys-Gly; L-Cysteinylglycine L-Cysteine; L-2-Amino-3-mercaptopropionic acid; L-Cystathionine L-Cysteinyl-tRNA(Cys) Cytidine; Deoxyadenosine; 2'-Deoxyadenosine dADP; 2'-Deoxyadenosine 5'-diphosphate; ddecencoa deamido-nad dec2enoylacp dec2enoylcoa deccoa dgdp C03221 C00857 C05754 C05275 C05274 C00361 C33H56N7O17P3S C21H27N6O15P2 C10H17OSR C31H52N7O17P3S C31H54N7O17P3S C10H15N5O10P2 2-trans-Dodecenoyl-CoA; (2E)-Dodec-2-enoyl-CoA; (2E)-Dodecenoyl-CoA Deamino-NAD+; Deamido-NAD+; Deamido-NAD; trans-Dec-2-enoyl-acp]; trans-Dec-2-enoyl-acyl-carrier protein]; (2E)-Decenoyl-acp]; trans-Dec-2-enoyl-CoA; (2E)-Decenoyl-CoA Decanoyl-CoA dGDP; 2'-Deoxyguanosine 5'-diphosphate; dgmp C00362 C10H14N5O7P dGMP; 2'-Deoxyguanosine 5'-monophosphate; 2'-Deoxyguanosine 5'-phosphate; Deoxyguanylic acid; Deoxyguanosine monophosphate dgp C04442 C6H11O9P 2-Dehydro-3-deoxy-6-phospho-D-gluconate; 6-Phospho-2-dehydro-3-deoxy-D-gluconate; 2-Keto-3-deoxy-6phosphogluconate; 2-Dehydro-3-deoxy-D-gluconate 6-phosphate; dgsn dgtp C00330 C00286 C10H13N5O4 C10H16N5O13P3 Deoxyguanosine; 2'-Deoxyguanosine; dGTP; 2'-Deoxyguanosine 5'-triphosphate; Deoxyguanosine 5'-triphosphate; Deoxyguanosine triphosphate; dha C00184 C3H6O3 Glycerone; Dihydroxyacetone; 1,3-Dihydroxyacetone; 1,3-Dihydroxy-2-propanone; 1,3-Dihydroxypropan-2-one; dhap dhf dhnpt dhor-S C00111 C00415 C04874 C00337 C3H7O6P C19H21N7O6 C9H13N5O4 C5H6N2O4 Glycerone phosphate; Dihydroxyacetone phosphate; Dihydrofolate; Dihydrofolic acid; 7,8-Dihydrofolate; 7,8-Dihydrofolic acid; 7,8-Dihydropteroylglutamate; 2-Amino-4-hydroxy-6-(D-erythro-1,2,3-trihydroxypropyl)-7,8-dihydropteridine; Dihydroneopterin; (S)-Dihydroorotate; (S)-4,5-Dihydroorotate; L-Dihydroorotate; L-Dihydroorotic acid; Dihydro-L-orotic acid; dhpmp C05925 C9H14N5O7P Dihydroneopterin phosphate; 2-Amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate dhpt din dkmpp C00921 C05512 Ecoli C14H14N6O3 C10H12N4O4 C6H9O6PS Dihydropteroate; 7,8-Dihydropteroate; Deoxyinosine; 2,3-diketo5-methylthio-1-phosphopentane dmethppi C00235 C5H12O7P2 Dimethylallyl diphosphate; Prenyl diphosphate; 2-Isopentenyl diphosphate; delta2-Isopentenyl diphosphate; deltaPrenyl diphosphate; DMAPP; dmlz dmmq8 C04332 C05818 C13H18N4O6 C15H14O2(C5H8)n 6,7-Dimethyl-8-(1-D-ribityl)lumazine; 2-Demethylmenaquinone dna C00039 C10H17O8PR2(C5H8O5PR)n DNA; DNAn; DNAn+1; (Deoxyribonucleotide)n; (Deoxyribonucleotide)m; (Deoxyribonucleotide)n+m; Deoxyribonucleic acid dodeccoa dpcoa dpyrpi dtbt dtdp C01832 C00882 C01304 C01909 C00363 C33H58N7O17P3S C21H35N7O13P2S C9H16N5O8P C10H18N2O3 C10H16N2O11P2 Lauroyl-CoA; Lauroyl coenzyme A; Dodecanoyl-CoA Dephospho-CoA; 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone; Dethiobiotin; Desthiobiotin; dTDP; Deoxythymidine 5'-diphosphate; dtmp C00364 C10H15N2O8P dTMP; Thymidine 5'-phosphate; Deoxythymidine 5'-phosphate; Thymidylic acid; 5'-Thymidylic acid; Thymidine monophosphate; Deoxythymidylic acid; Thymidylate; dttp dudp C00459 C01346 C10H17N2O14P3 C9H14N2O11P2 dTTP; Deoxythymidine triphosphate; Deoxythymidine 5'-triphosphate; TTP dUDP; 2'-Deoxyuridine 5'-diphosphate; dump C00365 C9H13N2O8P dUMP; Deoxyuridylic acid; Deoxyuridine monophosphate; Deoxyuridine 5'-phosphate; 2'-Deoxyuridine 5'phosphate; duri dutp dxyl5p e4p enz6dly enzn6ly ethylp etoh f1p f6p fad fadh2 fald fctchc fdp fe2 C00526 C00460 C11437 C00279 C15973 C15972 BioCyc C00069 C01094 C00085 C00016 C01352 C00067 C00125 C00354 C14818 C9H12N2O5 C9H15N2O14P3 C5H11O7P C4H9O7P C8H16NOS2R C8H14NOS2R C2H5O4P HOR C6H13O9P C6H13O9P C27H33N9O15P2 C27H35N9O15P2 CH2O fgam C04376 C8H15N2O9P FMN foctchc Folate formate C00061 C00126 C00504 C00058 C17H21N4O9P fpram C04640 C8H16N3O8P 2-(Formamido)-N1-(5'-phosphoribosyl)acetamidine; 1-(5'-Phosphoribosyl)-N-formylglycinamidine; 5'Phosphoribosyl-N-formylglycinamidine; 5'-Phosphoribosylformylglycinamidine; 2-(Formamido)-N1-(5-phospho-Dribosyl)acetamidine fru fum g1p g3p g3pe g6p gal gam1p gam6p gar C02336 C00122 C00103 C00118 C03120 C00668 C00124 C06156 C00352 C03838 C6H12O6 C4H4O4 C6H13O9P C3H7O6P C3H8O6PR C6H13O9P C6H12O6 C6H14NO8P C6H14NO8P C7H15N2O8P beta-D-Fructose; beta-Fruit sugar; beta-D-arabino-Hexulose; beta-Levulose; Fructose; Fumarate; Fumaric acid; trans-Butenedioic acid; D-Glucose 1-phosphate; alpha-D-Glucose 1-phosphate; Cori ester; D-Glucose alpha-1-phosphate (2R)-2-Hydroxy-3-(phosphonooxy)-propanal; D-Glyceraldehyde 3-phosphate; Glycerophosphodiester alpha-D-Glucose 6-phosphate; D-Galactose alpha-D-Glucosamine 1-phosphate; D-Glucosamine 1-phosphate; D-Glucosamine 6-phosphate; D-Glucosamine phosphate; 5'-Phosphoribosylglycinamide; GAR; N1-(5-Phospho-D-ribosyl)glycinamide; Glycinamide ribonucleotide gcald C00266 C2H4O2 Glycolaldehyde; Hydroxyacetaldehyde gdp gl6p glc-D C00035 C01236 C00031 C10H15N5O11P2 C6H11O9P C6H12O6 GDP; Guanosine 5'-diphosphate; Guanosine diphosphate; D-Glucono-1,5-lactone 6-phosphate; 6-Phospho-D-glucono-1,5-lactone; D-Glucose; Grape sugar; Dextrose; 0 C6H14O12P2 Fe 5'-Phosphoribosyl-N-formylglycinamide; N-Formyl-GAR; N-Formylglycinamide ribonucleotide; N2-Formyl-N1-(5phospho-D-ribosyl)glycinamide 0 C19H19N7O6 CH2O2 Deoxyuridine; 2-Deoxyuridine; 2'-Deoxyuridine; dUTP; 2'-Deoxyuridine 5'-triphosphate; 1-Deoxy-D-xylulose 5-phosphate; D-Erythrose 4-phosphate; Enzyme N6-(dihydrolipoyl)lysine; Dihydrolipoamide-E Enzyme N6-(lipoyl)lysine; Lipoamide-E Ethylphosphate Alcohol; D-Fructose 1-phosphate D-Fructose 6-phosphate; FAD; Flavin adenine dinucleotide; FADH2; Formaldehyde; Methanal; Oxomethane; Oxomethylene; Methylene oxide; Formalin; Ferricytochrome c; Cytochrome c3+ D-Fructose 1,6-bisphosphate; Fe2+; Fe(II); Ferrous ion; Iron(2+); FMN; Riboflavin-5-phosphate; Flavin mononucleotide; Ferrocytochrome c; Cytochrome c2+; Reduced cytochrome c Folate; Pteroylglutamic acid; Folic acid; Formate; Methanoic acid; Formic acid; glcn gln-L glu5p glu5sa C00257 C00064 C03287 C01165 C6H12O7 C5H10N2O3 C5H10NO7P C5H9NO3 D-Gluconic acid; D-Gluconate; D-gluco-Hexonic acid; L-Glutamine; L-2-Aminoglutaramic acid; L-Glutamyl 5-phosphate; L-Glutamate 5-phosphate; L-Glutamate 5-semialdehyde; L-Glutamate gamma-semialdehyde; glucys C00669 C8H14N2O5S gamma-L-Glutamyl-L-cysteine; L-gamma-Glutamylcysteine; 5-L-Glutamyl-L-cysteine; gamma-Glutamylcysteine; glu-D glu-L glutrnaglu glx gly glyc glyc3p glyclt C00302 C00025 C02987 C00048 C00037 C00116 C00093 C00160 C5H9NO4 C5H9NO4 C20H28N6O13PR(C5H8O6PR)n C2H2O3 C2H5NO2 C3H8O3 C3H9O6P C2H4O3 Glutamate; Glutaminic acid; 2-Aminoglutaric acid; L-Glutamate; L-Glutamic acid; L-Glutaminic acid; L-Glutamyl-tRNA(Glu) Glyoxylate; Glyoxalate; Glyoxylic acid; Glycine; Aminoacetic acid; Gly; Glycerol; Glycerin; 1,2,3-Trihydroxypropane; 1,2,3-Propanetriol sn-Glycerol 3-phosphate; Glycerophosphoric acid; sn-Gro-1-P; Glycerol-3-phosphate; Glycolate; Glycolic acid; Hydroxyacetic acid; glycogen G10545/C00369 (C12H20O10)n Starch; Dextrin glyc-R glycyl-trnagly gmp grdp gsn C00258 C02412 C00144 C00341 C00387 C3H6O4 C12H20NO11PR2(C5H8O6PR)n C10H14N5O8P C10H20O7P2 C10H13N5O5 D-Glycerate; Glycerate; (R)-Glycerate; Glyceric acid Glycyl-tRNA(Gly); GMP; Guanosine 5'-phosphate; Guanosine monophosphate; Guanosine 5'-monophosphate; Guanylic acid; Geranyl diphosphate; Guanosine; gsnppi C01228 C10H17N5O17P4 Guanosine 3',5'-bis(diphosphate); Guanosine 3'-diphosphate 5'-diphosphate; Guanosine 5'-diphosphate,3'diphosphate; gthox C00127 C20H32N6O12S2 Glutathione disulfide; GSSG; Oxiglutatione; Oxidized glutathione; gthrd C00051 C10H17N3O6S Glutathione; 5-L-Glutamyl-L-cysteinylglycine; N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine; gamma-L-Glutamyl-Lcysteinyl-glycine; GSH; Reduced glutathione; gtp gua h h2 h2mb4p h2o h2o2 h2s hbald hbenzf hco3 hcys-L hddcoa hdeACP C00044 C00242 C00080 C00030 C11811 C00001 C00027 C00283 C00633 C03590 C00288 C00155 C05262 C16520 C10H16N5O14P3 C5H5N5O H H2 C5H12O8P2 H2O H2O2 H2S C7H6O2 C8H6O4 HCO3 C4H9NO2S C33H58N7O18P3S C16H29OSR GTP; Guanosine 5'-triphosphate; Guanine; 2-Amino-6-hydroxypurine; H+; Reduced acceptor; AH2; 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate; (E)-4-Hydroxy-3-methylbut-2-en-1-yl diphosphate; H2O; Water; H2O2; Hydrogen peroxide; Oxydol; Hydrogen sulfide; Hydrogen-sulfide; H2S; 4-Hydroxybenzaldehyde; p-Hydroxybenzaldehyde 4-Hydroxyphenylglyoxylate; 4-Hydroxybenzoylformate HCO3-; Bicarbonate; Hydrogencarbonate; Acid carbonate; L-Homocysteine; L-2-Amino-4-mercaptobutyric acid; (S)-3-Hydroxydodecanoyl-CoA Hexadecenoyl-[acyl-carrier protein] heme hex2enoylacp hex2enoylcoa hexACP C00032 C05748 C05271 C05749 C34H32FeN4O4 C6H9OSR C27H44N7O17P3S C6H11OSR Heme; Haem; Protoheme; Heme B; Protoheme IX; trans-Hex-2-enoyl-acp]; trans-Hex-2-enoyl-acyl-carrier protein]; (2E)-Hexenoyl-acp]; trans-Hex-2-enoyl-CoA; (2E)-Hexenoyl-CoA Hexanoyl-acp]; Hexanoyl-acyl-carrier protein]; hexadecanoate C00249 C16H32O2 Hexadecanoic acid; Hexadecanoate; Hexadecylic acid; Palmitic acid; Palmitate; Cetylic acid hexadeccoa hexcoa hgent hhdeccoa his-L hisp histd histidinal histrnahis hmbil hmgth hom-L hprol hproly httdcoa hxan iasp ichor icit idon-L IDP ile-L iletrnaile C00154 C05270 C00544 C05268 C00135 C01100 C00860 C01929 C02988 C01024 C14180 C00263 C02051 C02972 C05260 C00262 C05840 C00885 C00311 C00770 C00104 C00407 C03127 C37H66N7O17P3S C27H46N7O17P3S C8H8O4 C27H46N7O18P3S C6H9N3O2 C6H12N3O4P C6H11N3O C6H9N3O C16H24N3O11PR2(C5H8O6PR)n C40H46N4O17 C11H19N3O7S C4H9NO3 C8H14NOS2R C8H16NOS2R C35H62N7O18P3S C5H4N4O C4H5NO4 C10H10O6 C6H8O7 C6H12O7 C10H14N4O11P2 C6H13NO2 C21H32N6O11PR(C5H8O6PR)n Palmitoyl-CoA; Hexadecanoyl-CoA Hexanoyl-CoA Homogentisate; Homogentisic acid; 2,5-Dihydroxyphenylacetic acid; 2,5-Dihydroxyphenylacetate (S)-Hydroxyhexanoyl-CoA; (S)-3-Hydroxyhexanoyl-CoA L-Histidine; (S)-alpha-Amino-1H-imidazole-4-propionic acid; L-Histidinol phosphate L-Histidinol L-Histidinal L-Histidyl-tRNA(His); Hydroxymethylbilane; S-(Hydroxymethyl)glutathione; L-Homoserine; 2-Amino-4-hydroxybutyric acid; Lipoylprotein; H-Protein-lipoyllysine Dihydrolipoylprotein; [Protein]-dihydrolipoyllysine (S)-3-Hydroxytetradecanoyl-CoA Hypoxanthine; Purine-6-ol; Iminoaspartate Isochorismate; Isochorismic acid Isocitrate; Isocitric acid; 1-Hydroxytricarballylic acid; 1-Hydroxypropane-1,2,3-tricarboxylic acid; L-Idonate IDP; Inosine 5'-diphosphate; Inosine diphosphate; L-Isoleucine; 2-Amino-3-methylvaleric acid; L-Isoleucyl-tRNA(Ile) imp C00130 C10H13N4O8P IMP; Inosinic acid; Inosine monophosphate; Inosine 5'-monophosphate; Inosine 5'-phosphate; 5'-Inosinate; 5'Inosinic acid; 5'-Inosine monophosphate; 5'-IMP indole C00463 C8H7N Indole; 2,3-Benzopyrrole; inost C00137 C6H12O6 myo-Inositol; D-myo-Inositol; 1D-myo-Inositol; L-myo-Inositol; 1L-myo-Inositol; meso-Inositol; Inositol; Dambose; Cyclohexitol; Meat sugar; Bios I ins ipdp ippm isalc isobutanal C00294 C00129 C02631 BioCyc BioCyc C10H12N4O5 C5H12O7P2 C7H10O4 C5H12O C4H8O Inosine; Isopentenyl diphosphate; delta3-Isopentenyl diphosphate; delta3-Methyl-3-butenyl diphosphate; 2-Isopropylmaleate; beta-Isopropylmaleate isoamyl alcohol, isopentanol, 3-methylbutanol isobutyraldehyde, isobutylaldehyde, isobutanal isobutanol ITP BioCyc C00081 C4H10O C10H15N4O14P3 butanol, isobutanol ITP; Inosine 5'-triphosphate; Inosine triphosphate; Inosine tripolyphosphate; kdo C01187 C8H14O8 3-Deoxy-D-manno-octulosonate; KDO; 2-Dehydro-3-deoxy-D-octonate; 3-Deoxy-D-manno-2-octulosonate; 3Deoxyoctulosonic acid; kdo8p L1pgly C04478 C00344 C8H15O11P C8H13O10PR2 3-Deoxy-D-manno-octulosonate 8-phosphate; 2-Dehydro-3-deoxy-D-octonate 8-phosphate; Phosphatidylglycerol; 3-(3-sn-Phosphatidyl)glycerol; 3(3-Phosphatidyl-)glycerol; PtdGro L1pglyp C03892 C8H14O13P2R2 Phosphatidylglycerophosphate; 3(3-sn-Phosphatidyl)-sn-glycerol 1-phosphate; 3(3-Phosphatidyl-)L-glycerol 1phosphate; 1,2-Diacyl-sn-glycero-3-phospho-sn-glycerol 3'-phosphate lac-D L-Alanyl-trna leu-L leutrnaleu lgt-S llnate L-lysyl-trnalys lppdat L-valyl-trnaval lys-L mal malACP malcoa mald malttr man1p man6p mcdtbt Methanol methf C00256 C00886 C00123 C02047 C03899 C00430 C01931 C02786 C02554 C16237 C00149 C01209 C00083 C00222 C00492 C00636 C00275 BioCyc C00132 C00445 C3H6O3 C13H22NO11PR2(C5H8O6PR)n C6H13NO2 C21H32N6O11PR(C5H8O6PR)n C12H18N3O8SR C5H9NO3 C16H29N2O11PR2(C5H8O6PR)n C8H12O10PR2 C20H30N6O11PR(C5H8O6PR)n C8H14NOS2R C4H6O5 C3H3O3SR C24H38N7O19P3S C3H4O3 C18H32O16 C6H13O9P C6H13O9P C10H17N2O3S CH4O C20H22N7O6 (R)-Lactate; D-Lactate; D-Lactic acid; D-2-Hydroxypropanoic acid; D-2-Hydroxypropionic acid; L-Alanyl-tRNA; L-Alanyl-tRNA(Ala); L-Leucine; 2-Amino-4-methylvaleric acid; (2S)-alpha-2-Amino-4-methylvaleric acid; (2S)-alpha-Leucine; L-Leucyl-tRNA; L-Leucyl-tRNA(Leu) S-(2-Hydroxyacyl)glutathione; 5-Aminolevulinate; 5-Amino-4-oxopentanoate; 5-Amino-4-oxovaleric acid; L-Lysyl-tRNA; L-Lysyl-tRNA(Lys) 2-Lysophosphatidate L-Valyl-tRNA(Val); Protein N6-(lipoyl)lysine; (S)-Malate; L-Malate; L-Apple acid; L-Malic acid; L-2-Hydroxybutanedioic acid; Malonyl-acyl-carrier protein]; Malonyl-CoA; Malonyl coenzyme A; 3-Oxopropanoate; Malonate semialdehyde Raffinose; Melitose; Melitriose; Gossypose; 6G-alpha-D-galactosylsucrose; D-Mannose 1-phosphate; alpha-D-Mannose 1-phosphate D-Mannose 6-phosphate; 9-mercaptodesthiobiotin Methanol; Methyl alcohol; 5,10-Methenyltetrahydrofolate; methionol BioCyc C4H10OS 3-methylthiopropanol, 3-methylmercapto-1-propanol, 3-hydroxypropyl methyl sulfide, γ-methylmercaptopropyl alcohol, 3-methylsulfanyl-1-propanol met-L mettrnamet C00073 C02430 C5H11NO2S C20H30N6O11PSR(C5H8O6PR)n L-Methionine; Methionine; L-2-Amino-4methylthiobutyric acid; L-Methionyl-tRNA; L-Methionyl-tRNA(Met) mi1p-D C01177 C6H13O9P Inositol 1-phosphate; myo-Inositol 1-phosphate;1D-myo-Inositol 1-phosphate;D-myo-Inositol 1-phosphate;1Dmyo-Inositol 1-monophosphate mlthf mq8 C00143 C00828 C20H23N7O6 C16H16O2(C5H8)n 5,10-Methylenetetrahydrofolate; (6R)-5,10-Methylenetetrahydrofolate; 5,10-Methylene-THF; Menaquinone; Menatetrenone mthgxl C00546 C3H4O2 Methylglyoxal; Pyruvaldehyde; Pyruvic aldehyde; 2-Ketopropionaldehyde; 2-Oxopropanal myrsACP n2 C05761 C00697 C14H27OSR N2 Tetradecanoyl-acp]; Tetradecanoyl-acyl-carrier protein]; Myristoyl-acyl-carrier protein]; Nitrogen; N2 N5camimirn N5-formyl-ThF C15667 C03479 C9H14N3O9P C20H23N7O7 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole 5-Formyltetrahydrofolate; L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid; Folinic acid N5panth C04302 C12H16NO9P N-(5-Phospho-D-ribosyl)anthranilate; N-(5-Phospho-beta-D-ribosyl)anthranilate; N-(5-Phosphoribosyl)anthranilic acid nac nacmsam nad nadh C00253 C00645 C00003 C00004 C6H5NO2 C8H15NO6 C21H28N7O14P2 C21H29N7O14P2 Nicotinate; Nicotinic acid; Niacin; 3-Pyridinecarboxylic acid; N-Acetyl-D-mannosamine; 2-Acetamido-2-deoxy-D-mannose NAD+; NAD; Nicotinamide adenine dinucleotide; DPN; Diphosphopyridine nucleotide; Nadide; NADH; DPNH; nadp C00006 C21H29N7O17P3 NADP+; NADP; Nicotinamide adenine dinucleotide phosphate; beta-Nicotinamide adenine dinucleotide phosphate; TPN; Triphosphopyridine nucleotide; nadph C00005 C21H30N7O17P3 NADPH; TPNH; napdc C05897 C87H143N7O23P2 Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine; ncam C00153 C6H6N2O Nicotinamide; Nicotinic acid amide; Niacinamide; Vitamin PP; ncammnu C00455 C11H15N2O8P Nicotinamide D-ribonucleotide; NMN; Nicotinamide mononucleotide; Nicotinamide ribonucleotide; Nicotinamide nucleotide; beta-Nicotinamide D-ribonucleotide; beta-Nicotinamide ribonucleotide; beta-Nicotinamide mononucleotide ncamr nh4 nicrns C03150 C00014 C05841 C11H15N2O5 NH3 C11H14NO6 N-Ribosylnicotinamide; 1-(beta-D-Ribofuranosyl)nicotinamide; NH3; Ammonia; Nicotinate D-ribonucleoside; nicrnt C01185 C11H15NO9P Nicotinate D-ribonucleotide; beta-Nicotinate D-ribonucleotide; Nicotinate ribonucleotide; Nicotinic acid ribonucleotide; nsuckm C04462 C11H15NO8 N-Succinyl-2-L-amino-6-oxoheptanedioate; N-Succinyl-L-2-amino-6-oxoheptanedioate; N-Succinyl-L-2-amino-6oxopimelate; N-Succinyl-2-amino-6-oxo-L-pimelic acid; N-Succinyl-epsilon-keto-L-aminopimelic acid; (S)-2(Succinylamino)-6-oxoheptanedioate o2 o2- C00007 C00704 O2 O2 Oxygen; O2; O2.-; Superoxide anion; O2- oaa C00036 C4H4O5 Oxaloacetate; Oxalacetic acid; Oxaloacetic acid; 2-Oxobutanedioic acid; Oxosuccinic acid; keto-Oxaloacetate; oct2enoylacp C05751 C8H13OSR trans-Oct-2-enoyl-acp]; trans-Oct-2-enoyl-acyl-carrier protein]; 2-Octenoyl-acyl-carrier protein]; (2E)-Octenoylacp]; oct2enoylcoa octaACP octACP octanoate octcoa octdp octeACP C05276 C04088 C05752 BioCyc C01944 C04146 C01203 C29H48N7O17P3S C18H35OSR C8H15OSR C8H15O2 C29H50N7O17P3S C40H68O7P2 C18H33OSR trans-Oct-2-enoyl-CoA; (2E)-Octenoyl-CoA Octadecanoyl-[acyl-carrier protein]; Stearoyl-[acyl-carrier protein] Octanoyl-acp]; Octanoyl-acyl-carrier protein]; Octanoate Octanoyl-CoA all-trans-Octaprenyl diphosphate; Farnesylfarnesylgeraniol Oleoyl-[acyl-carrier protein]; Octadecenoyl-[acyl-carrier protein]; Octadecenoyl-[acp] ohpb C06054 C4H7O8P 2-Oxo-3-hydroxy-4-phosphobutanoate; alpha-Keto-3-hydroxy-4-phosphobutyrate; (3R)-3-Hydroxy-2-oxo-4phosphonooxybutanoate ophenlac C02137 C8H6O3 alpha-Oxo-benzeneacetic acid; Benzoylformate; Benzoylformic acid; Phenylglyoxylic acid; Phenylglyoxylate; 2-Oxo2-phenylacetate opmmbq orn-L orot orot5p C05814 C00077 C00295 C01103 C48H72O3 C5H12N2O2 C5H4N2O4 C10H13N2O11P 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinone L-Ornithine; (S)-2,5-Diaminovaleric acid; (S)-2,5-Diaminopentanoic acid; (S)-2,5-Diaminopentanoate; Orotate; Orotic acid; Uracil-6-carboxylic acid; Orotidine 5'-phosphate; Orotidylic acid; oxalosucc C05379 C6H6O7 Oxalosuccinate; Oxalosuccinic acid pacald palmACP pan4p pant-R pap paps BioCyc C05764 C01134 C00522 C00054 C00053 C8H8O C16H31OSR C11H23N2O7PS C6H12O4 C10H15N5O10P2 C10H15N5O13P2S phenylacetaldehyde Hexadecanoyl-acp]; Hexadecanoyl-acyl-carrier protein]; Pantetheine 4'-phosphate; 4'-Phosphopantetheine; Phosphopantetheine; D-Pantetheine 4'-phosphate; (R)-Pantoate; Pantoate; Pantoic acid Adenosine 3',5'-bisphosphate; PAP; 3'-Phosphoadenylate; Phosphoadenosine phosphate 3'-Phosphoadenylyl sulfate; 3'-Phosphoadenosine 5'-phosphosulfate; 3'-Phospho-5'-adenylyl sulfate; PAPS; pc C00157 C10H18NO8PR2 Phosphatidylcholine; Lecithin; Phosphatidyl-N-trimethylethanolamine; 1,2-Diacyl-sn-glycero-3-phosphocholine; Choline phosphatide; 3-sn-Phosphatidylcholine pdate pds pdt pdx5p C00416 C00138 C00139 C00627 C5H7O8PR2 peam C00350 C7H12NO8PR2 Phosphatidylethanolamine; (3-Phosphatidyl)ethanolamine; (3-Phosphatidyl)-ethanolamine; Cephalin; O-(1-betaAcyl-2-acyl-sn-glycero-3-phospho)ethanolamine; 1-Acyl-2-acyl-sn-glycero-3-phosphoethanolamine; pep pgl phbz phe-L phetrnaphe C00074 C00345 C00156 C00079 C03511 C3H5O6P C6H13O10P C7H6O3 C9H11NO2 C19H26NO11PR2(C5H8O6PR)n Phosphoenolpyruvate; Phosphoenolpyruvic acid; PEP; 6-Phospho-D-gluconate; 4-Hydroxybenzoate; Hydroxybenzoic acid; 4-Hydroxybenzoic acid; Hydroxybenzenecarboxylic acid L-Phenylalanine; (S)-alpha-Amino-beta-phenylpropionic acid; L-Phenylalanyl-tRNA(Phe); phoforcboxm C04734 C10H15N4O9P 1-(5'-Phosphoribosyl)-5-formamido-4-imidazolecarboxamide; 5'-Phosphoribosyl-5-formamido-4imidazolecarboxamide; 5-Formamido-1-(5-phosphoribosyl)imidazole-4-carboxamide; 5-Formamido-1-(5-phosphoD-ribosyl)imidazole-4-carboxamide phom phospholipid C01102 #N/A C4H10NO6P 0 0 C8H12NO6P Phosphatidate; Phosphatidic acid; 1,2-Diacyl-sn-glycerol 3-phosphate; 3-sn-Phosphatidate; Reduced ferredoxin Oxidized ferredoxin Pyridoxine phosphate; Pyridoxine 5-phosphate; Pyridoxine 5'-phosphate; O-Phospho-L-homoserine; #N/A #N/A phpyr C00166 C9H8O3 Phenylpyruvate; Phenylpyruvic acid; alpha-Ketohydrocinnamic acid; keto-Phenylpyruvate; 3-Phenyl-2oxopropanoate; phthr pi C06055 C00009 C4H10NO7P H3PO4 O-Phospho-4-hydroxy-L-threonine; 4-(Phosphonooxy)-threonine; 4-(Phosphonooxy)-L-threonine; Orthophosphate; Phosphate; Phosphoric acid; Orthophosphoric acid; pinost C01194 C11H17O13PR2 1-Phosphatidyl-D-myo-inositol; 1-Phosphatidyl-1D-myo-inositol; 1-Phosphatidyl-myo-inositol; Phosphatidyl-1Dmyo-inositol; (3-Phosphatidyl)-1-D-inositol; 1,2-Diacyl-sn-glycero-3-phosphoinositol plac BioCyc C6H10O3 (3R)-dihydro-3-hydroxy-4,4-dimethyl-2(3H)-furanone, (R)-pantoyl lactone, pantoyl lactone, (R)-pantolactone, (R)Pantoyl lactone, (3R)-dihydro-3-hydroxy-4,4-dimethyl-2(3H)-furanone pmcoa pme pnto-R ppbng ppdel pphn ppi ppp9 pppg9 pppi C01063 C01241 C00864 C00931 C04308 C00254 C00013 C02191 C01079 C00536 C28H46N7O19P3S C8H14NO8PR2 C9H17NO5 C10H14N2O4 C9H16NO8PR2 C10H10O6 P2H4O7 C34H34N4O4 C34H40N4O4 P3H5O10 6-Carboxyhexanoyl-CoA; Pimeloyl-CoA; Phosphatidyl-N-methylethanolamine; Pantothenate; Pantothenic acid; (R)-Pantothenate Porphobilinogen Phosphatidyl-N-dimethylethanolamine Prephenate; Prephenic acid; Pyrophosphate; Pyrophosphoric acid; Diphosphate; PPi; Protoporphyrin; Protoporphyrin IX; Porphyrinogen IX; Protoporphyrinogen IX; Triphosphate; Tripolyphosphate; ppser C02737 C8H12NO10PR2 Phosphatidylserine; Phosphatidyl-L-serine; 1,2-Diacyl-sn-glycerol 3-phospho-L-serine; 3-O-sn-Phosphatidyl-Lserine; O3-Phosphatidyl-L-serine; pram C03090 C5H12NO7P 5-Phosphoribosylamine; 5-Phospho-beta-D-ribosylamine; 5-Phospho-D-ribosylamine; 5-Phosphoribosyl-1-amine PR-amp PR-ATP precorrin-1 precorrin-2 C02741 C02739 C15527 C02463 C15H23N5O14P2 C15H25N5O20P4 C41H46N4O16 C42H48N4O16 Phosphoribosyl-AMP; N1-(5-Phospho-D-ribosyl)-AMP; 1-(5-Phosphoribosyl)-AMP; Phosphoribosyl-ATP; N1-(5-Phospho-D-ribosyl)-ATP; 1-(5-Phosphoribosyl)-ATP; Precorrin 1 Precorrin 2; Dihydrosirohydrochlorin; prfp C04896 C15H25N5O15P2 5-(5-Phospho-D-ribosylaminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide; N-(5'-Phospho-Dribosylformimino)-5-amino-1-(5''-phospho-D-ribosyl)-4-imidazolecarboxamide; N-(5'-Phosphoribosylformimino)-5amino-1-(5''-phosphoribosyl)-4-imidazolecarboxamide; Phosphoribosyl-formimino-AICAR-phosphate; 1-(5Phosphoribosyl)-5-(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide; prlp C04916 C15H25N5O15P2 N-(5'-Phospho-D-1'-ribulosylformimino)-5-amino-1-(5''-phospho-D-ribosyl)-4-imidazolecarboxamide; 5-(5Phospho-1-deoxyribulos-1-ylamino)methylideneamino]-1-(5-phosphoribosyl)imidazole-4-carboxamide; Phosphoribulosyl-formimino-AICAR-phosphate; pro-L protein protrnapro C00148 #N/A C02702 C5H9NO2 L-Proline; 2-Pyrrolidinecarboxylic acid; #N/A C15H24NO11PR2(C5H8O6PR)n L-Prolyl-tRNA(Pro); prpp C00119 C5H13O14P3 5-Phospho-alpha-D-ribose 1-diphosphate; 5-Phosphoribosyl diphosphate; 5-Phosphoribosyl 1-pyrophosphate; PRPP; ptrc py5c pyam5p pydx5p pyr pyr23dcboyl q8 q8h2 q9 C00134 C03912 C00647 C00018 C00022 C03722 C00399 C00390 C01967 C4H12N2 C5H7NO2 C8H13N2O5P C8H10NO6P C3H4O3 C7H5NO4 C14H18O4(C5H8)n C14H20O4(C5H8)n C54H82O4 Putrescine; 1,4-Butanediamine; 1,4-Diaminobutane; Tetramethylenediamine (S)-1-Pyrroline-5-carboxylate; L-1-Pyrroline-5-carboxylate; 1-Pyrroline-5-carboxylate Pyridoxamine phosphate; Pyridoxamine 5-phosphate; Pyridoxamine 5'-phosphate; Pyridoxal phosphate; Pyridoxal 5-phosphate; Pyridoxal 5'-phosphate; Pyruvate; Pyruvic acid; 2-Oxopropanoate; 2-Oxopropanoic acid; Pyroracemic acid; Pyridine-2,3-dicarboxylate; Quinolinic acid; Quinolinate; 2,3-Pyridinedicarboxylic acid; Ubiquinone; Coenzyme Q; CoQ; Q Ubiquinol; QH2; CoQH2 Ubiquinone-9; Ubiquinone-45; Coenzyme Q(9) #N/A r1p R4hmnd r4phopncys-L r5p rbl-L rib-D ribflv Rmandelate C00620 C05343 C04352 C00117 C00508 C00121 C00255 C01983 C5H11O8P C8H8O4 C12H23N2O9PS C5H11O8P C5H10O5 C5H10O5 C17H20N4O6 C8H8O3 alpha-D-Ribose 1-phosphate; Ribose 1-phosphate; D-Ribose 1-phosphate; (R)-4-Hydroxymandelate; (R)-4'-Phosphopantothenoyl-L-cysteine; N-(R)-4'-Phosphopantothenoyl]-L-cysteine; D-Ribose 5-phosphate; Ribose 5-phosphate; L-Ribulose; L-erythro-Pentulose; L-Arabinoketose; L-Arabinulose; L-Riboketose D-Ribose Riboflavin; Lactoflavin; 7,8-Dimethyl-10-ribitylisoalloxazine; Vitamin B2; (R)-Mandelate; (R)-2-Hydroxy-2-phenylacetic acid; (R)-2-Hydroxy-2-phenylacetate; (R)-Mandelic acid; rna C00046 C10H18O13P2R2(C5H8O6PR)n RNA; RNAn; RNAn+1; RNA(linear); (Ribonucleotide)n; (Ribonucleotide)m; (Ribonucleotide)n+m; Ribonucleic acid; rns3p ru5p-D ru5p-L S4a5opnt S4hmnd s7p sade4m2obut sbt-D sedbispi ser-D ser-L sertrnaser Sfglutth shcl sheme skm skm3p sm Smandelate so3 so4 spmd succ succald succarg-L C03802 C00199 C01101 C03741 C03198 C05382 C04425 C00794 C00447 C00740 C00065 C02553 C01031 C05778 C00748 C00493 C03175 #N/A C01984 C00094 C00059 C00315 C00042 C00232 C03296 C5H12O13P3R C5H11O8P C5H11O8P C5H9NO3 C8H8O4 C7H15O10P C15H20N5O6S C6H14O6 C7H16O13P2 C3H7NO3 C3H7NO3 C13H22NO12PR2(C5H8O6PR)n C11H17N3O7S C42H46N4O16 C42H44FeN4O16 C7H10O5 C7H11O8P #N/A C8H8O3 H2SO3 H2SO4 C7H19N3 C4H6O4 C4H6O3 C10H18N4O5 Ribonucleoside triphosphate; D-Ribulose 5-phosphate; L-Ribulose 5-phosphate (S)-4-Amino-5-oxopentanoate; L-Glutamate 1-semialdehyde; (S)-4-Hydroxymandelate; (S)-2-Hydroxy-2-(4-hydroxyphenyl)acetate; D-Sedoheptulose 7-phosphate; D-altro-Heptulose 7-phosphate; S-Adenosyl-4-methylthio-2-oxobutanoate D-Sorbitol; D-Glucitol; L-Gulitol; Sorbitol D-Sedoheptulose 1,7-bisphosphate; D-altro-Heptulose 1,7-biphosphate; D-Serine L-Serine; L-2-Amino-3-hydroxypropionic acid; L-3-Hydroxy-alanine; L-Seryl-tRNA(Ser); S-Formylglutathione; Sirohydrochlorin; Siroheme Shikimate; Shikimic acid; 3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid; Shikimate 3-phosphate; Shikimate 5-phosphate; #N/A (S)-Mandelate; (S)-2-Hydroxy-2-phenylacetic acid; (S)-2-Hydroxy-2-phenylacetate; (S)-Mandelic acid; Sulfite Sulfate; Sulfuric acid Spermidine; N-(3-Aminopropyl)-1,4-butane-diamine Succinate; Succinic acid; Butanedionic acid; Ethylenesuccinic acid; Succinate semialdehyde; Succinic semialdehyde; 4-Oxobutanoate N2-Succinyl-L-arginine; (2S)-2-(3-Carboxypropanoylamino)-5-(diaminomethylideneamino)pentanoic acid; succdioate C04421 C11H18N2O7 N-Succinyl-LL-2,6-diaminoheptanedioate; N-Succinyl-LL-2,6-diaminopimelate; N-Succinyl-L-2,6diaminoheptanedioate; N-Succinyl-L-2,6-diaminopimelate; succgluald succoa C05932 C00091 C9H13NO6 C25H40N7O19P3S N-Succinyl-L-glutamate 5-semialdehyde; (2S)-2-(3-Carboxypropanoylamino)-5-oxopentanoic acid; Succinyl-CoA; Succinyl coenzyme A; sucglu suchms sucorn sucr sulfur t2enoylcoa tcynt tdeACP tdecenacp thdecencoa C05931 C01118 C03415 C00089 C00087 C00877 C01755 C05760 C05763 C05272 C9H13NO7 C8H13NO6 C9H16N2O5 C12H22O11 S C25H40N7O17P3S CHNS C14H25OSR C16H29OSR C37H64N7O17P3S N-Succinyl-L-glutamate; (2S)-2-(3-Carboxypropanoylamino)pentanedioic acid; O-Succinyl-L-homoserine N2-Succinyl-L-ornithine; (2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid Sucrose; Cane sugar; Saccharose; 1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside; Sulfur; S; Sulfur, precipitated; Crotonoyl-CoA; Crotonyl-CoA; 2-Butenoyl-CoA; trans-But-2-enoyl-CoA; But-2-enoyl-CoA Thiocyanate; Thiocyanic acid trans-Tetradec-2-enoyl-acp]; trans-Tetradec-2-enoyl-acyl-carrier protein]; (2E)-Tetradecenoyl-acp]; trans-Hexadec-2-enoyl-acp]; trans-Hexadec-2-enoyl-acyl-carrier protein]; (2E)-Hexadecenoyl-acp]; trans-Hexadec-2-enoyl-CoA; trans-2-Hexadecenoyl-CoA; (2E)-Hexadecenoyl-CoA thf C00101 C19H23N7O6 Tetrahydrofolate; 5,6,7,8-Tetrahydrofolate; Tetrahydrofolic acid; THF; (6S)-Tetrahydrofolate; (6S)-Tetrahydrofolic acid; (6S)-THFA; thglu thmmp thmpp thr-L thrtrnathr thymd trdox trdrd trna(Ala) trna(Asp) trna(his) trna(Phe) trna(Pro) trna(Ser) trnaarg trnacys trnaGlu trnagly trnaile trnaleu trnalys trnamet C04144 C01081 C00068 C00188 C02992 C00214 C00343 C00342 C01635 C01638 C01643 C01648 C01649 C01650 C01636 C01639 C01641 C01642 C01644 C01645 C01646 C01647 C29H37N9O12 C12H18N4O4PS C12H19N4O7P2S C4H9NO3 C14H24NO12PR2(C5H8O6PR)n C10H14N2O5 C6H7NO2S2R2 C6H9NO2S2R2 C10H17O10PR2(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C10H17O10PR2(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n Tetrahydropteroyltri-L-glutamate; Thiamin monophosphate; Thiamine monophosphate; Thiamin phosphate; Thiamine phosphate; TMP; Thiamin diphosphate; Thiamine diphosphate; Thiamin pyrophosphate; TPP; ThPP; L-Threonine; 2-Amino-3-hydroxybutyric acid; L-Threonyl-tRNA(Thr) Thymidine; Deoxythymidine; Oxidized thioredoxin; Thioredoxin disulfide; Thioredoxin sulfide; Thioredoxin; Reduced thioredoxin; tRNA(Ala); tRNA(Asp); tRNA(His); tRNA(Phe); tRNA(Pro); tRNA(Ser); tRNA(Arg) tRNA(Cys) tRNA(Glu) tRNA(Gly); tRNA(Ile) tRNA(Leu) tRNA(Lys) tRNA(Met) trnathr C01651 C10H17O10PR2(C5H8O6PR)n tRNA(Thr) trnatrp trnatyr trnaval C01652 C00787 C01653 C15H21N5O10PR(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n C15H21N5O10PR(C5H8O6PR)n tRNA(Trp) tRNA(Tyr) tRNA(Val); trp-L trp-Lyl-trnatrp tsul C00078 C03512 C00320 C11H12N2O2 C26H31N7O11PR(C5H8O6PR)n HS2O3 L-Tryptophan; Tryptophan; (S)-alpha-Amino-beta-(3-indolyl)-propionic acid; L-Tryptophanyl-tRNA(Trp) Thiosulfate; Hyposulfite ttdec2enoylcoa C05273 C35H60N7O17P3S trans-Tetradec-2-enoyl-CoA; (2E)-Tetradecenoyl-CoA ttdeccoa C02593 C35H62N7O17P3S Tetradecanoyl-CoA; Myristoyl-CoA ttfrdp C00448 C15H28O7P2 trans,trans-Farnesyl diphosphate; Farnesyl diphosphate; Farnesyl pyrophosphate; 2-trans,6-trans-Farnesyl diphosphate; tyr-L tyrtrnatyr C00082 C02839 C9H11NO3 C24H30N6O12PR(C5H8O6PR)n L-Tyrosine; (S)-3-(p-Hydroxyphenyl)alanine; (S)-2-Amino-3-(p-hydroxyphenyl)propionic acid; L-Tyrosyl-tRNA(Tyr) uaccg C04631 C20H29N3O19P2 UDP-N-acetyl-3-(1-carboxyvinyl)-D-glucosamine; UDP-N-acetyl-3-O-(1-carboxyvinyl)-D-glucosamine; UDP-Nacetylglucosamine-3-O-pyruvateether; UDP-N-acetylglucosamine enolpyruvate; uacgam uama uamag C00043 C01212 C00692 C17H27N3O17P2 C23H36N4O20P2 C28H43N5O23P2 UDP-N-acetyl-D-glucosamine; UDP-N-acetylglucosamine; UDP-N-acetylmuramoyl-L-alanine UDP-N-acetylmuramoyl-L-alanyl-D-glutamate; uamp C04882 C41H65N9O28P2 UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanylD-alanine; UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine uamr udcpdp udcpp udp udpg udpgal udpglcur C01050 C04574 C00348 C00015 C00029 C00052 C00167 C20H31N3O19P2 C55H92O7P2 C55H91O4P C9H14N2O12P2 C15H24N2O17P2 C15H24N2O17P2 C15H22N2O18P2 UDP-N-acetylmuramate; UDP-N-acetylmuramic acid; UDP-MurNAc; di-trans,poly-cis-Undecaprenyl diphosphate; Undecaprenyl phosphate; UDP; Uridine 5'-diphosphate; UDP-glucose; UDPglucose; UDP-D-glucose; Uridine diphosphate glucose; UDP-alpha-D-glucose; UDP-D-galactose; UDP-galactose; UDP-D-galactopyranose UDP-glucuronate; UDPglucuronate; UDP-D-glucuronate; UDP-alpha-D-glucuronate; udpnappu C05898 C95H156N8O28P2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6diaminopimeloyl-D-alanyl-D-alanine; ugmh C04877 C35H55N7O26P2 UDP-N-acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate; UDP-N-acetylmuramoyl-L-alanylD-gamma-glutamyl-meso-2,6-diamino-heptanedioate; ump undecaprenol uppg3 ura urea urei-L uri utp val-L xan xltol xmp C00105 C01968 C01051 C00106 C00086 BioCyc C00299 C00075 C00183 C00385 C00379 C00655 C9H13N2O9P C55H90O C40H44N4O16 C4H4N2O2 CH4N2O C5H11N3O4 C9H12N2O6 C9H15N2O15P3 C5H11NO2 C5H4N4O2 C5H12O5 C10H13N4O9P UMP; Uridylic acid; Uridine monophosphate; Uridine 5'-monophosphate; 5'Uridylic acid; Undecaprenol Uroporphyrinogen III; Uracil; Urea; Carbamide O-ureidohomoserine Uridine; UTP; Uridine 5'-triphosphate; Uridine triphosphate; L-Valine; 2-Amino-3-methylbutyric acid; Xanthine; Xylitol Xanthosine 5'-phosphate; Xanthylic acid; XMP; (9-D-Ribosylxanthine)-5'-phosphate; xtsn xu5p-D xyl-D C01762 C00231 C00181 C10H12N4O6 C5H11O8P C5H10O5 Xanthosine; D-Xylulose 5-phosphate D-Xylose; Wood sugar xylu-D C00310 C5H10O5 D-Xylulose; D-threo-Pentulose; D-Lyxulose
Related documents