Survey
* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
* Your assessment is very important for improving the work of artificial intelligence, which forms the content of this project
Discrete Mathematics
Chapter 7
Advanced Counting
Techniques
Transparency No. 7-1
Advanced counting techniques
Contents
7.1 Recurrence Relations
7.2 Solving Recurrence Relations
7.4 Generating Functions (skipped)
7.3 Divide-and-conquer Relations
7.5 The Inclusion-Exclusion principle
7.6 Applications of the Inclusion-Exclusion principle
Transparency No. 7-2
Advanced counting techniques
7.1 Recurrence relations
#bacteria doubles every hour. Initially(t=0), there are 5 bacteria
==> #bacteria after n hours = ?
sol: Let {an} be the sequence where an = #bacteria after n hours.
=> a0 = 5
--- (1) initial condition
an = 2 an-1 for n > 0. --- (2) recurrence relation
Notes:
(1&2) is called a recursive definition of the sequence {an}.
(1&2) uniquely determines a sequence {an}nN =<a0,a1,..>.
(2) is the recurrence part of the definition.
Most general form: an= f(n,an-1, an-2,…, a0), where f is a
function of n and previous terms an-1, an-2,…, a0 of an.
More examples: an = an-1+an-2 + …+ a0.
an = 2 an-1 + an-2 x an-3 + n2.
an = 5xan/2 + n3.
Transparency No. 7-3
Advanced counting techniques
Recurrence relations are very useful in the study
and solving of counting problems.
Many counting problems can be modeled (or
expressed) naturally by recurrence relations.
Goal of section 7.1~7.3:
Modeling counting problems in terms of
recurrence relations
Solving recurrence relations. Namely, find explicit
formula f(n) for an (i.e., without using previous
terms ) satisfying the recurrence relation (and
initial conditions)
Ex: an = 5x2n is an explicit solution of the above example.
Transparency No. 7-4
Advanced counting techniques
Definition of recurrence relations
A recurrence relation for a sequence {an} is a formula of the
form:
an = f(n, an-1,an-2,…,a0) for all n n0 ---- (*)
where n0 is a non-negative number and f is a function of n and
an-1,…,a0. In other words, we express an in terms of one or more
previous terms of an in the sequence.
A sequence {an} is called a solution to the recurrence relation
(*) if its terms satisfy the recurrence relation.
I.e., for all n n0 , an = f(n, an-1,an-2,…,a0) .
Ex1: If a sequence {an} satisfies
(1) an = an-1 - an-2 for n 2, and
(2) a0=3, a1 = 5. --- initial conditions
=> a2 = ? and a3 = ?
Hint: Initial conditions (2) tell us the values of the first two terms,
while recurrence relation (1) tells us how the value of every
other term is determined by its previous two terms.
Transparency No. 7-5
Advanced counting techniques
Recurrence relation example
Ex3: Deposit $10,000 in an account with
11% compound interest annually.
==> How much will be in the account after 30 years ?
Sol: let Pn = amount of the account after n years
==> 1. p0 = 10,000
2. pn = pn-1 + pn-1 x 0.11.
==> Pn = 1.11 Pn-1 = 1.112 Pn-2=...= 1.11n P0 = 1.11n x 10000.
==> P30 = 1.1130 x 10000 = 22,892,297.
Ex4: Rabbits and Fibonacci number.
A pair of rabbits produce one pair per month after 2 month old.
Initially there is only one pair.
=> How many pairs of rabbits are there after n months?
sol: Let fn = #pairs after n months.
=>1. f0 = f1 = 1 --initial conditions 2. fn = fn-1 + fn-2 for n > 1 ,
where fn-1: #old-rabbits and fn-2 is #new born rabbits.
Transparency No. 7-6
Advanced counting techniques
More recurrence examples
(The tower of Hanoi) 3 pegs: A,B,C. Initially n disks placed on
peg A. Disks can be moved from peg to peg only if the disk
is on top of the original disk and smaller than that on top of
the target peg.The goal is to have all disks moved to the 2nd
pegs.
Let Hn = #moves required to solve the problems with n disks
=> Hn = ?
Sol: 1. H1 = 1.
2. Hn = H n-1
+1
+ H n-1 = 2Hn-1 + 1.
A--n-->B A--n-1-->C
A--1-->B
C--n-1-->B.
Hence Hn = 2 Hn-1 + 1 = 22 Hn-2 + 2 + 1 = ...
= 2n-1 H1 + 2n-2 + ... + 1 = 2 n -1.
How big is H64 ?
: assume one move takes 1 sec => 264 - 1 = 1.8 x 10 19 = 500 billion years!!
Transparency No. 7-7
Advanced counting techniques
More recurrence examples (continued)
Ex6: #bit strings of length n not containing two consecutive 0s.
sol: an = #bit strings of such kind of length n.
==> 1. a0 = 1, a1 = 2.
2. an = #bits string ending with 1 w/o two consecutive 0s
+ #bit-strings-ending with 00 or 10 w/o two consecutive 0s
= an-1 + an-2 if n 2
Ex7: an = # n-digit-strings containing an even number of 0.
Sol: valid strings must be in one of the forms:
1. x1 x2 ... xn-1 xn with xn = 1..9 or
2. x1 x2 ... xn-1 0 with x1 x2 ... xn-1 containing odd number of 0.
==> 1. a0 = 1, a1 = 9.
2. an = an-1 x 9 + (10n-1 - an-1) = 8an-1+ 10n-1 for n > 1.
Transparency No. 7-8
Advanced counting techniques
Degree of recurrence relations
A recurrence relation : an = f(n, an-1,an-2,…,a0) for all n n0 is
said to has degree k > 0 if the farthest previous term f
depends on is an-k .
i.e., f depends on an-k but not on an-s for any s > k.
Ex:
an = an-1 an-1 + an-3 has degree 3,
an = a0 has no degree
an = 5 an/2 + n3 has no degree.
If the recurrence relation : an = f(n, an-1,an-2,…,a0) for all n
n0 has degree k, then we can express it simply as
an = f(n, an-1,an-2,an-k) for all n n0
where f is a function of n and an-1,an-2,…,an-k .
Transparency No. 7-9
Advanced counting techniques
Well definition of sequences using recurrence relations of constant degree
Theorem 0: A recurrence relation of degree k:
an = f(n, an-1,an-2,an-k) for all n k,
and k initial conditions:
a0 = C0, ..., ak-1 = Ck-1, where C0,...,Ck-1 are arbitrary k numbers
uniquely determine a sequence satisfying all equations)
Pf: 1. Uniqueness, 2. Existence. cf.:Exercise 56&57 of Section 4.3
1. Uniqueness: If {an} and {bn} both satisfy all equations =>
{an} = {bn} (i.e., an = bn for all n .)
Assume {an} , {bn} are distinct sequences, then by well-order
property of natural numbers, there must exist a least t such that at
bt. Such t must not < k due to the initial conditions. But if t k,
the minimum of t implies as = bs for all s < t, and hence by the
recurrence relation at = bt. , As a result, t does not exist and there
are no distinct sequences satisfying all equations.
Transparency No. 7-10
Advanced counting techniques
Proof of existence
Pf: Proof by construction: Define a sequence {an} by the following process:
1. for ( t = 0 to k-1) at Ct .
2. for ( t = k to ) at f(t, at-1, at-2,…,at-k)
1. Such process must assign at most one value at for each position t 0
since the index t in each execution of at … is distinct from one
another.
2. Such process must assign exactly one value at for each position t 0 s.t.
at = Ct for 0 t k-1 and at = f(t, at-1, at-2,…,at-k) for t k since
for 0 t k-1, position t will be assigned a value Ct during the
execution of Line 1, and
for t = k, since all at-1, at-2,…,a0 have been assigned values by Line1,
f(t, at-1, at-2,…,at-k) is well-defined and execution of at f(…) results in
a new position t to be assigned value at = f(t, at-1, at-2,…,at-k).
Now for t > k, by Ind.hyp., all at-1, at-2,…,at-k have been assigned
values, hence f(t, at-1, at-2,…,at-k) is well-defined and execution of at
f(…) assigns the value at = f(t, at-1, at-2,…,at-k) to a new position t.
By 2, {an} is a sequence satisfying all equations.
Transparency No. 7-11
Advanced counting techniques
Compute recursive sequences
Given a recursive definition of a sequence:
an = f(n, an-1,an-2,an-k) for all n k, and
a0 = C0, ..., ak-1 = Ck-1.
It is very easy to derive recursive and/or iterative algorithms
to compute the value of any item an in the sequence.
A1(n : int) : real { // recursive version
switch(n) {
case 0 : return C0 ;
…
case k-1 : return Ck-1 }
return f(n, A(n-1),…, A(n-k));
}
A1 is not effieicnt since it requires exponential time if k > 1.
Transparency No. 7-12
Advanced counting techniques
Iterative algoritm for computing recursive sequences
A2( n: int) : real { // iterative version
real[] A = new real[n+1] ;
A[0]=C0; …,A[k-1] = Ck-1;
if(n < k) return A[n] ;
for(int t = k; t <= n; t++) A[t] = f(t, A[t-1],…,A[t-k]) ;
return A[n]; }
A2 requires space O(n) and time O(n) if f(...) uses constant
time.
A3 is a more space efficient version which uses O(1) space if
the recurrence relation has a degree k.
A3(n: int) :real { real[] A = new real[k] ;
A[0]=C0; …,A[k-1] = Ck-1; if(n < k) return A[n] ;
for(int t=k; t <= n; t++) A[t % k ] = f(t, A[(t-1)%k],…,A[(t-k)%k]) ;
return A[n%k]; }
Transparency No. 7-13
Advanced counting techniques
7.2 Solving linear recurrence relations
A linear homogeneous recurrence relation of degree k with
constant coefficients(lhrrcc) is any recurrence relation of the
form:
an = c1 an-1 + c2an-2+...+ckan-k, ---- (1)
where k > 0, every cj is a constant number with ck 0.
Ex: an = an-1 + an-2 is a lhrrcc of degree 2
an = an-5 is a lhrrcc of degree 5
Notes:
(1) is linear since c1,…,ck are functions of n only.
Hence an is a linear combination of an-1,an-2,an-k.
counter example: an = an-1*an-2+ an-3
(1) is homogenous since every term at RHS is a multiple
of some previous term an-j.
counter example: Hn = 2Hn-1 + 1 -- inhomogeneous
constant coefficients since all c1,…,ck are constants.
Transparency No. 7-14
Advanced counting techniques
Solving linear homogeneous recurrence relations with constant
coefficients (lhrrcc)
Let an = c1 an-1 + c2an-2+...+ ckan-k -- (1)
be a lhrrcc relation of degree k > 0.
Let {an} be a sequence such that an = rn where r is a number 0,
then
{an} (or {rn}) is a solution of (1) iff
rk = c1 rk-1 + c2 rk-2+...+ck rk-k -------(2)
(2) is called the characteristic equation of (1)
pf: {rn} is a solution of (1) iff rn = c1 rn-1 + c2rn-2+...+ ckrn-k
iff rn-k (rn - c1 rn-1 - c2rn-2-...- ck) = 0
iff (rn - c1 rn-1 - c2rn-2-...- ck) = 0
Ex:
an = an-1 + an-2 has characteristic equation r2 = r + 1.
an = 3an-1 + an-5 has characteristic equation r5 = 3r4 + 1.
Transparency No. 7-15
Advanced counting techniques
Theorem 1
an = c1 an-1 + c2an-2 -- (3) a lhrrcc relation of degree 2.
Theorem 1: If r2 = c1 r + c2 (**) has two distinct roots r1, r2 , then
sequence {an} is a solution of (3)
iff an = d1 r1n + d2 r2n for n = 0,1,2,.. (*)
where d1 and d2 are some/any constants.
pf: <= : simple substitution (like the proof in previous slide).
=>: Let <b0,b1,...> be any solution of (3).
For {bn} to satisfy (*), we must have:
b0 = d1 + d2; b1 = d1r1 + d2 r2 (Note since r1 r2, (d1,d2)
must exist!) and for any k > 1,
bk = c1bk-1 + c2bk-2
= (by ind.hyp.) c1(d1r1k-1+d2r2k-1) + c2 (d1r1k-2 +d2r2k-2)
= d1(c1r1k-1+c2r1k-2) +d2(c1r2k-1+c2r2k-2)
= d1r1k-2(c1r1+c2) +d2r2k-2 (c1r2+c2) = (by **) d1 r1k + d2 r2 k. QED
Transparency No. 7-16
Advanced counting techniques
Examples:
Ex3: Find the solution of an = an-1 + 2 an-2 for n > 1, with initial
conditions: a0 = 2 and a1 = 7.
sol: char equ: r2 = r +2 has roots 2, -1.
Hence an = d1 2n + d2 (-1)n for all n for some d1, d2.
==> a0 = d1 + d2
a1 = 2 d1 - d2 => d1 = 3; d2 = -1
==> an = 3 x 2n - (-1)n for n 0.
Transparency No. 7-17
Advanced counting techniques
Solution of the Fibonacci sequence
Ex4: Find the solution to the Fibonacci sequence:
f1=f0=1 and
fn = fn-1 + fn-2 for n > 1.
Sol: The char equ: r2 = r + 1 has roots:
a=(1+rt(5)) /2, // golden ratio
b=(1-rt(5))/2.
note: 1< a1.618< 2 and -1 < b <0.
Hence fn = d1 an + d2 bn with
f0 = 1 = d1 + d2 and
f1 = 1 = d1a + d2b
=> d1 = rt(5)/5 and d2 = -rt(5)/5.
=> fn = d1an + d2bn = O(an) grows exponentially.
Transparency No. 7-18
Advanced counting techniques
Solving recurrence relation
Theorem 2: If r2 = c1 r + c2 has only one root r0 (with duplicate
multiplicity) then any sequence {an} is a solu of (3) iff
an = d1 r0n + d2 n r0n for n = 0,1,2,.. (*)
where d1 and d2 are some/any constants.
Pf: => : Similar to Theorem 1 (see textbook).
<= : a n-1 = d1 r0n-1 + d2 (n-1) r0n-1
a n-2 = d1 r0n-2 + d2 (n-2) r0n-2
==> c1 an-1 + c2 an-2
= d1 (c1 r0n-1 + c2 r0n-2) + d2 (c1(n-1) r0n-1 + c2(n-2) r0n-2)
= d1 r0n-2(c1 ro + c2) + d2 r0n-2( (n-1)(c1ro+c2) - c2)
= d1 r0n + d2 r0n-2((n-1) r02 + r02) -- since r2- c1r -c2 = (r-r0)2
= r 2 - 2 r 0 r + r 02 .
= d1 r0n + d2 n r0n
Transparency No. 7-19
Advanced counting techniques
Ex5: find the solution of
an = 6an-1 - 9 an-2 with
a0 = 1 and a1 = 6.
sol: the char. equation: r2 = 6 r – 9 has only one root 3.
=> an = d1 3n + d2 n 3 n.
=> d1 = 1, and
3d1 + 3 d2 = 6
=> an = 3n + n 3n for n ≥ 0.
Transparency No. 7-20
Advanced counting techniques
Generalization
Theorem 4: If the equation rk = c1 rk-1 + c2rk-2+...+ ck has
solutions r1m1, r2m2,..,rsms (with m1+...+ms = k) where mi is the
multiplicity of the root ri.
(i.e. rk - c1 rk-1 +...-ck = Pi=1..s (x-ri)mi ) then
{an} is a solution of the recurrence relation:
an = c1 an-1 +...+ck an-k iff
an = Si=1,s (Sj=0,mi-1 dij nj ) rin , where dij's are constants and
(Sj=0,mi-1 dij nj ) is a polynomial of order mi -1.
Ex: The recurrence relation an = 5 an-1 + 9 an-2 -7 an-3 + 2 an-4
has char. equ. r4 = 5r3 -9r2 -7r + 2, which is equ. to
(r-2)(r-1)3 = 0. Hence r has roots: 2, 13.
Then the relation has general solution:
an = d02n + (e01+e1n+e2 n2 )1n, where d0, e0,e1 and e2 are
constants determined by initial conditions.
Transparency No. 7-21
Advanced counting techniques
Simultaneous recurrence relations of degree 1
Ex: Solving the simultaneous recurrence relations:
1. an = 3 an-1 + 2 bn-1
2. bn = an-1 + 2 bn-1, with a0 = 1 and b0 = 2.
sol: (1,2) can be represented in matrix form:
an 3 2 an - 1
an
3 2
bn 1 2 bn - 1 (1) Let bn Xn, 1 2 A.
Xn AXn 1 A( AX n 2 ) ... An X 0.
Let Y be the eigenvector of A: (I.e., AY = lY for some l.)
=> (A-lI)Y = 0 => det(A-lI) = 0 => (3-l)(2-l) - 2 = 0 => l =1,4.
=> Y1 = (1,-1)T and Y2 = (2,1)T.
Now assume X0 = d1Y1 + d2 Y2
=> Xn = A Xn-1 = ... = An Xo = An-1 (AX0) = An-1 (d1AY1 + d2AY2) =
An-1 (d1 l1Y1 + d2l2Y2) = ... = d1 l1n Y1 + d2l2n Y2.
Transparency No. 7-22
Advanced counting techniques
Linear Nonhomogeneous Recurrecne Relations
(lnhrr) with Constant Coefficients ( 以下至7.4 skipped!)
has known how to solve lhrr with constant coefficients.
Is there a similar method to solve lnhrr with constant coefficients
like an = 3an-1 + 4n ?
Ans: yes but only for some families of lnhrrcc.
Definition: A linear nonhomogeneous recurrence relation with
constant coefficients (of degree k) is a recurrence relation of
the form:
an = c1an-1 + c2 an-2 + … + ck an-k + F(n) --- (4) where
c1,c2,…,ck are constant numbers, ck 0,
F(n) 0 is a function depending on n only.
Note: In the above definition, the lhrrcc:
an = c1an-1 + c2 an-2 + … + ck an-k ----- (5)
is called the associated homogeneous recurrence relation
of (4)
Transparency No. 7-23
Advanced counting techniques
Examples
1.
2.
3.
4.
an = an-1 + 2n
an = an-1+an-2 + n2+n + 1
an = 3 an-1 + n 3n
an = an-1+an-2+an-3 + n!
All the above 4 rrs are lnhrr with constant coefficients. Their
associated lhrr are :
1.
2.
3.
4.
an = an-1
an = an-1+an-2
an = 3 an-1
an = an-1+an-2+an-3
Transparency No. 7-24
Advanced counting techniques
Theorem 5 (Find all solutions from any given soltution)
If {pn} is a (particular) solution of the lnhrr with constant
coefficients: an = c1an-1 + c2 an-2 + … + ck an-k + F(n) ---(4)
Then {bn} is a solution of (4) iff {bn} = {pn+hn} where {hn} is a
solution of the associated lhrr of (4).
Pf: If-part: Since {bn} = {pn+hn} , we have
bn = pn + hn = c1pn-1 + c2 pn-2 + … + ck pn-k + F(n)
+ c1hn-1 + c2 hn-2 + … + ck hn-k
= c1(pn-1 + hn-1)+ c2(pn-2 + hn-2)+…+ ck(pn-k + hn-k)+ F(n)
= c1bn-1 + c2 bn-2 + … + ck bn-k + F(n) .
Hence {bn} is a solution of (4)
Only-if: On the other hand, if {bn} is a solution of (4), since {pn} is also a
solution, we have bn–pn = (c1bn-1+c2bn-2+…+ckbn-k+F(n)) - (c1pn-1+c2pn2+… + ckpn-k+F(n)) = c1(bn-1-pn-1) + c2 (bn-1-pn-2)+ … + ck(bn-k-pn-k).
Hence {bn–pn} is a solution of the associated lhrr of (4) and
{bn} = {pn + (bn–pn)} = {pn+hn} where {hn} = {bn–pn}.
Transparency No. 7-25
Advanced counting techniques
Example 10
Find all solutions of the recurrence relation an = 3 an-1 + 2n,
and what is the solution with a1 = 3 ?
Sol: The key to the problem is to find a particular solution pn.
We first guess that pn is in linear form, i.e., pn = cn + d for some
constants c and d.
We then have cn+d = 3 (c(n-1) + d) + 2n = (3c + 2) n + (3d – 3c).
As a result (2c+2) n + (2d – 3c) = 0.
Hence c = -1 and d =-3/2.
Next Find general solution of the associated lhrr: an = 3 an-1 .
Which we know is of the form a 3n.
Hence by Theorem 5, all solutions are of the form: an=a3n-n-3/2.
If a1 = 3, then 3 = a31 - 1 -3/2 and a=11/6.
Hence an = 11/6 x 3n - n-3/2.
Transparency No. 7-26
Advanced counting techniques
Example 11
Find all solutions of the recurrence relation :
an = 5 an-1 - 6 an-2 + 7n --- (*)
Sol: First try to find a particular solution pn . We guess pn = c 7n for
some c. Then we require
pn = c7n = 5 pn-1 - 6 pn-2 + 7n.
= 5c7n-1 -6c7n-2 +7n
= (35c - 6c +49) 7n-2 .
So 49c = 29c + 49 and c = 49/20.
Then find the solution of the associated lhrr: an = 5 an-1 - 6 an-2.
Its characteristic equation is r2 =5r-6, which has roots:2 and 3.
As a result, the homogeneous solution is a 2n + b 3n,
and the general solution to (*) is
a2n+b3n+(49/20)7n.
Transparency No. 7-27
Advanced counting techniques
Theorem 6
Let an = c1an-1 + c2 an-2 + … + ck an-k + F(n) be a lnhrr with
constant coefficients with F(n) = b(n) sn, where
b(n) = btnt + bt-1nt-1 +…+ b1n1 + b0 is a polynomial of degree t,
and s is a constant.
Notes: In Ex10, b(n) = 2n and s = 1; In Ex11, b(n) = 1 and s = 7.
1. if s is not the root of the characteristic equation of the associated
lhrr, then there is a particular solution of the form:
p(n) sn, where p(n) is a polynomial of degree t (= degree(b(n) ).
2. If s is a root of the characteristic equation with multiplicity m, then
there is a particular solution of the form :
p(n) nm sn where p(n) is a polynomial of degree t.
Transparency No. 7-28
Advanced counting techniques
Example 12
Find the form of a particular solution for the recurrence relation
an = 6 an-1 – 9 an-2 +F(n), when F(n) =
1. 3n,
2. n3n
3. n2 3n
4. n2 2n or 5. (n2+1) 3n.
Sol: The associated hrr has char. equation r2 = 6r -9, whose roots are
3,3. So the form of a particular solution of each of the above are :
particular solution general solution
1. (cn+d)
// (cn+d)1n + (an+b) 3n
2. (cn+d)n23n
// (cn+d) n23n +(an+b)3n =(cn3+dn2+an+b) 3n
3. (cn2+dn+e)n23n // (cn2+dn+e)n23n +(an+b) 3n
4. (cn2+dn+e)2n
// (cn2+dn+e)2n + (an+b) 3n
5. (cn2+dn+e)n23n. // (cn2+dn+e) n23n + (an+b) 3n =
(cn4+dn3+en2+an+b) 3n
Notes: The coefficients(c,d,e) of particular solutions are determined by the
lnrrcc (5) while remaining coefficients(a,b) are determined by initial
conditions.
Transparency No. 7-29
Advanced counting techniques
Example 13
Find the solution of the recurrence relation an = an-1 + n (*)
with a1 = 1.
sol: In this case we have F(n) = n x 1n. The characteristic equation
of the associated hrr is r = 1, which has root 1.
So the form of the solution of the assocaited hrr is e1n = e.
By Theorem 6 a particular solution is of the form
pn = (cn+d) n11n = cn2 + dn.
Substitute pt for at in (*), we get cn2 + dn = c(n-1)2 + d(n-1) + n.
-2cn+c –d + n = 0 => c = ½, d=c=1/2.
The general solution is of the form
an = e + (n2+n)/2.
But since a1 = 1, we thus have e= 0 and an = (n2+n)/2.
Exercises: Find solutions of an = an-1 + F(n) with a1 = 1, where
F(n) = n2 and n3, respectively. –solu: n(n+1)(2n+1)/6, n2(n+1)2/4
Transparency No. 7-30
Advanced counting techniques
Exercise 31 of Section 7.2
Find all solutions of the recurrence relation:
an = 5 an-1 – 6 an-2 + 2n + 3n --- (*).
Note we cannot apply Theorem 6 to this case since here F(n) =
2n + 3nx1n,which is not of the form p(n)sn for some number s.
Lemma: if {gn} is a particular solution of
an = c1an-1 + c2 an-2 + … + ck an-k + F1(n) and
{hn} a particular solution of
an = c1an-1 + c2 an-2 + … + ck an-k + F2(n), then
{gn+hn} is a particular solution of the recurrence relation
an = c1an-1 + c2 an-2 + … + ck an-k + F1(n) + F2(n) ---(**).
Pf: gn+hn = c1gn-1 + c2 gn-2 + … + ck gn-k + F1(n) +
c1hn-1 + c2 hn-2 + … + ck hn-k + F2(n)
= c1(gn-1+hn-1)+c2(gn-2+hn-2)+ … + ck(gn-k+hn-k)+ F1(n)+F2(n).
Hence {gn+hn} satisfies (**).
Transparency No. 7-31
Advanced counting techniques
Solution of Exercise 31
The problem can be reduced to that of finding particular solutions to
an = 5 an-1 – 6 an-2 + 2n --- (1), and
an = 5 an-1 – 6 an-2 + 3n --- (2), respectively.
Since the associated homogeneous relation
an = 5 an-1 – 6 an-2 --- (3) has char equation r2 = 5 r – 6, with root
r = 2 and 3.
The particular solution of (1) has the form gn = c n1 2n.
Hence cn2n=5c(n-1)2n-1–6c(n-2)2n-2+2n -- div both sides by 2n-2
=> 4cn = 5c(n-1)x2 – 6c(n-2) + 4
=> (4c-10c + 6c)n=-10c+12c + 4=2c+4 => 0n=2c+4=> c = -2.
Similarly, particular solution of (2) has the form hn = (dn+e) 1n.
Hence (dn+e)1n = 5[d(n-1)+e]1n-1–6[d(n-2)+e]1n-2 + 3n
=> (d-5d+6d-3)n = -e – 5d +5e + 12d – 6e = 7d – 2e = 0.
=> d = 3/2 and e = 7d/2 = 21/4
=> the general solution is a2n + b 3n + (-2) n 2n + (3n/2+ 21/4).
Transparency No. 7-32
Advanced counting techniques
7.4 Generating Functions (skipped!)
Motivation:
Condition: A problem in one domain is hard to solve.
Strategy: transform the problem into another domain, solve it with
easier method and then transform the result to the original domain as
a solution to the original problem.
Such strategy is a very popular technique in CS and Math.
Ex: Hard to perform a great amount of multiplications on a list of
numbers a1,… an, then
Transform input <a1,..,an> to <log a1,…,log an>,
replace each multiplication a x b by log a + log b,
take 10R as the final solution where R is the result in the new domain.
Ex: Fourier transform: time domain s(t) <-> frequency domain F(f)
s(t) ----- - + s(t)e-2pift dt ---> F(f)
s(t) <--- - + F(f)e2pift df ------ F(f)
Transparency No. 7-33
Advanced counting techniques
Definition of oridinary generating functions
Goal: transform counting/sequence problems into algebraic
problems.
Definition 1: The generating function for the sequence
a0,a1,…,an,… of real numbers is the infinite series:
G(x) = a0 + a1 x + … + ak xk + … = Sk = 0.. akxk.
also called the ordinary generating function to distinguish
it from other kind of generating functions such as
exponential generating functions:
E(x) = a0 + a1 x/1! + … + ak xk/k!+ … = Sk = 0.. akxk/k! .
EX:
{an} = 3,3,…,3,… => G(x) = Sk = 0.. 3xk.
{bn} =1,2,3,…
=> G(x) = 1 + 2x + 3x2+… = Sk = 0.. (k+1)xk.
{cn} = 1,2,4,8,… => G(x) = 1 + 2x + 4x2+… = Sk = 0.. 2kxk.
Transparency No. 7-34
Advanced counting techniques
More Examples
Ex2: {ak }k = 0..5 = <1,1,1,1,1,1> Then
G(x) = 1 + x + x2 + x3 + x4 + x5.
= (x6 -1) / (x -1)
Ex3: m: a positive integer, ak = C(m,k) for k = 0..m. Then
G(x) = C(m,0) + C(m,1)x + C(m,2) x2 +…+ C(m,m) xm
= (1+x)m.
Transparency No. 7-35
Advanced counting techniques
Some facts about formal power series
When generating functions are used to solve counting
problems, they are usually represented as formal power
series(形式冪級數).
convergence problem ignorable here.
Ex4: f(x) = 1/(1-x) is the generating function of the series:
1,1,1,…
since
1/(1-x) = 1 + x + x2+… for |x| < 1.
Ex5: f(x) = 1/(1-ax) is the generation function of the series:
1,a,a2,a3,…
since
1/(1-ax) = 1 + ax + a2x2+ … for |x| < 1 / |a| .
Transparency No. 7-36
Advanced counting techniques
Sum and product of generating functions
Theorem 1 : Let f(x) = Sk = 0.. akxk, g(x) = Sk = 0.. bkxk. Then
f(x) + g(x) = Sk = 0.. (ak+bk ) xk.
f(x) g(x) = (a0 + a1x + a2x2+…) * (b0 + b1x1+ b2x2+…)
= Sk = 0.. (Sj= 0..k akbk-j) xk.
I.e., f(x) + g(x) is the generating function of the sum of
both sequences:
{ ak+bk },
while
f(x)g(x) is the generating function of the sequence:
{ck} where ck = Sj= 0..k akbk-j ,
{ ck} is called the convolution of {ak} and {bk}.
Transparency No. 7-37
Advanced counting techniques
Ex 6
Since 1/(1-x) = 1 + x + x2 + x3+ …
(*)
we have 1/(1-x)2
= (1 + x + x2 + x3+ …)(1 + x + x2 + x3+ … )
= 1 + (1x + x 1) + (1 x2 + x x + x2 1) + …
= Sk = 0.. (Sj= 0..k 1)xk = Sk = 0.. (k+1)xk.
Hence 1/(1-x)2 is the generating function of the seq:
1,2,3,4,… = { k+1 }k = 0..
Another approach: take derivatives on both sides of (*), we get
(1-x)-2 = 1 + 2x + 3x2 + … = Sk = 0.. (k+1)xk.
Transparency No. 7-38
Advanced counting techniques
Extended Binominal Coefficients
Definition 2: u: real number, k : nonnegative integer. Then the
extended binominal coefficient C(u,k) is defined by
C(u,k) = u (u-1) … (u-k+1) / k! if k > 0, and
1
if k = 0.
EX 7: 1. C(-2, 3) = -2 -3 -4 / 3! = - 4.
2. C(1/2, 3 ) = (1/2)(1/2-1) (1/2 – 2) /3!
= 1 (-1) (-3) / (2 * 2 * 2 * 6) = 1/16.
EX 8: n, r: nonnegative integers . Then
C(-n, r) = (-n) (-n-1) … (-n –r+1) /r!
= (-1) r P(n+r-1, r) /r!
= (-1)r C(n+r-1, r) = (-1)r H(n,r).
Transparency No. 7-39
Advanced counting techniques
The Extended Binominal Theorem
Theorem 2: Let x be a real number with |x| < 1 and let u be a
real number. Then
(1+x)u = Sk = 0.. C(u, k) xk, and hence
(x+y)u = yu(1+ (x/y))u = Sk = 0.. C(u, k) xkyu-k.
pf: Let f(x) = (1+x)u. By Tayler ‘s theorem
f(x) = f(a) + (x-a)f'(a) + (x-a)2f(2)(a)/2! +...+ (x-a)nf(n)(a)/n! + …
Now select a = 0, we have
f(x) = f(0) + f'(0) x + f(2)(0)/2! x2 +...+ f(n)(0)/n! xn + …
where f(k)(0) = u (u-1) … (u-k+1) (1+x)u-k |x = 0 = P(u,k) .
hence f(x) = Sk = 0.. C(u, k) xk.
Note: when u is a positive integer, Theorem 2 reduces to the
normal Binominal theorem since ,when k > u,
C(u,k) = 0 and Sk = 0.. C(u, k) xk = Sk = 0..u C(u, k) xk.
Transparency No. 7-40
Advanced counting techniques
Ex 9
Ex9 : Find the formal power series for (1+x) –n and (1-x)-n,where
n > 0.
Sol:
(1+x) –n = Sk = 0.. C(-n, k) xk.
= Sk = 0.. (-1)k C(n+k-1, k) xk.
= Sk = 0.. (-1)k H(n, k) xk.
Replacing x by –x, we have
(1-x) -n = Sk = 0.. (-1)k C(n+k-1, k) (-x) k
= Sk = 0.. C(n+k-1, k) xk.
= Sk = 0.. H(n, k) xk.
Transparency No. 7-41
Advanced counting techniques
Some useful generating functions
G(x)
(1+x)n = Sk = 0..n C(n, k) xk
= 1 + C(n,1)x + C(n,2) X2 + …+ xn
(1+ax)n = Sk = 0..n C(n, k)ak xk
= 1 + C(n,1)ax + C(n,2)a2 X2 + …+ anxn
(1+xr)n = Sk = 0..n C(n, k) xkr
= 1 + C(n,1)xr + C(n,2) x2r + …+ xnr
(1- x n + 1 ) / (1-x) = Sk = 0..n xk
= 1 + x + x2 + …+xn
{ak}
C(n,k)
C(n,k)ak
C(n, k/r ) if r | k and
0
otherwise
1 if k n
0 if k > n.
Transparency No. 7-42
Advanced counting techniques
Some useful generating functions (continued)
G(x)
{ak}
1/(1-x) = 1+x+ x2 + x3+…
1
1/(1-ax) = 1 + ax + (ax)2 + …
ak
1/(1-xr) = 1 + xr + x2r + …
1/(1-x)2 = Sk = 0.. (k+1) xk
= 1 + 2x + 3x2 + 4x3+…
1/(1-x)n = Sk = 0.. C(n+k-1,k) xk
= 1 + C(n,1) x + C(n+1,2) x2 + C(n+2,3)x3+…
1 if r | k,
0 O/W
k+1
C(n+k-1, k)
or H(n,k)
Transparency No. 7-43
Advanced counting techniques
Some generating functions (continued)
G(x)
1/(1+x)n = Sk = 0.. C(n+k-1,k) (-1)kxk
= 1 - C(n,1) x + C(n+1,2) x2 - C(n+2,3)x3+…
1/(1-ax)n = Sk = 0.. C(n+k-1,k) akxk
= 1 + C(n,1) ax + C(n+1,2) a2x2 + C(n+2,3)a3x3+…
ex = Sk = 0.. xk/k!
= 1 + x/1! + x2 /2! + x3/3!+ …
ln(x+1) = Sk = 1.. (-1)k+1xk/k
= x – x2/2 + x3 /3 - x4/4+ …
since dkln(1+x)/dx(0)= (-1)k-1(k-1)! (1+x)–k|x=0 = (-1)k-1(k-1)!
{ak}
(-1)kC(n+k-1, k)
(-1)kH(n, k)
C(n+k-1, k) ak
H(n, k) ak
1/k!
(-1)k+1 /k
Transparency No. 7-44
Advanced counting techniques
More facts
Let G(x) = Sk = 0.. akxk = «a0,a1,…» is the generating function
(gf) of the seq {an}. Note we use «a0,a1,…» to abbreviate Sk =
k
0.. akx . Then
1. xG(x) =«0, a0,a1,a2,…» is the gf of {an} >>1. [shift right]
2. xk G(x) =«0,0,…,0, a0,a1,…» is the gf of {an} >> k.
3. (G(x)-a0)/x = «a1,a2,…» is the gf of {an} << 1 [shift left]
4. d G(x) / dx = «a1, 2a2, 3a3,…» is the gf of { (n+1) an+1 }n=0…
5. G(x) dx = a0 x + a1x2/2 + a2 x3/3 + …
= «0, a0, a1/2, a2/3,…»
is the gf of { an /(n+1) } >> 1.
Transparency No. 7-45
Advanced counting techniques
Counting problems and generating functions
Ex10: Find the number of solutions to e1 + e2 + e3 = 17,
where e1,e2 and e3 are nonnegative integers with
2 e1 5, 3 e2 6 and 4e37.
Sol: The #solutions is equal to the coefficient of x17 in the
expansion of the product:
(x12+x13+x14+x15)(x23+x24+x25+x26)(x34+x35+x36+x37)
e1=5
e2=6
e3=6
The #Solutions is 3 (x5x5x7, x4x6x7 , x5x6x6)
Transparency No. 7-46
Advanced counting techniques
Ex11: 8 identical cookies distributed among 3 different children
with each child receiving at lest 2 cookies and no more than
4 cookies. #possible distributions = ?
Sol: the number is the coefficient of x8 in the product:
(x2+x3+x4)3,
which is equal to 6
( 4+2+2, 2+4+2, 2+2+4, 2+3+3, 3+3+2, 2+3+3).
Ex12: Determine the number of ways to insert coins worth
$1,$2 and $5 into a vending machine to pay for an item
costing $r, in case (1) the insertion order matters and (2)
does not matter.
Sol: (1) order matters: => The possible ways of inserting n
coins can be represented by (x + x2 + x5)n.
Transparency No. 7-47
Advanced counting techniques
So the possible ways of inserting coins is
1 + (x+x2+x3) + (x + x2 + x5)2+ (x + x2 + x5)3+ …
= 1/(1 –x – x2 –x3)
=> possible ways of inserting coins with total value r is
the coeff. of the term xr in the above generating function.
for example, if r = 7, then the answer is 26.
can be computed by computer algebra system (CAS)
(Some CASs: Yacas, Maxima, Axioms, Euler, Maple).
Order does not matter: possible ways of inserting coins
: x1 $1 + x2 $2 + x3 $5 = $r.
(1+x+x2+x3+…) (1+ x2+ x4 + …) (1+ x5 + x10+ x15+…)
= 1/(1-x ) 1/(1-x2) 1/(1-x5)
if r = 7, then xr has coefficient 6.
Transparency No. 7-48
Advanced counting techniques
Ex13 : Find #k-combinations of a set of size n.
solu: = coefficient of xk in the product:
(x0+x1) (x0+x1) … (x0+x1) = (1+x)n = f(x).
By Binominal theorem :
f(x) = Sk = 0..n C(n, k) xk where C(n,k) = n! / (k!(n-k)!)
hence #k-combinations = C(n,k).
Ex14: Find #r-comb from a set with n objects when repetition
is allowed.
Sol: Let {ar} be the seq where ar = #r-comb with repetition
allowed. Then {ar} has generating function:
(1+x+x2+…)… (1+x+x2+…) = (1+x+x2+…)n = (1+(-x))-n.
= Sk = 0.. C(-n,k)(-1)k xk , Thus #r-comb with repetition
= C(n+r-1, r) = H(n,r).
Transparency No. 7-49
Advanced counting techniques
Ex15: Find the number of ways to select r objects of n different
kinds if each kind must be selected at least 1 object.
Sol: G(x)
= (x + x2+ x3+ …)n.
= Xn (1+x+x2+…)n = Xn / (1-x)n
= xn(1-x)-n.
= xn Sk = 0.. H(n,k)xk
= Sk = 0.. H(n,k) xk+n
= St = n.. H(n,t-n) xt
=> there are H(n, r-n) = C(r-1, r-n) ways to select r objects.
Transparency No. 7-50
Advanced counting techniques
Using generating functions to solve recurrence relations
Ex16: Solve the recurrence relation :
ak = 3 a k-1 for k >0 , and
a0 = 2.
Sol: Let G(x) be the generating function of the seq {ak}.
I.e., G(x) = Sk = 0.. akxk. = «a0, a1,a2,… »
=> xG(x) = Sk = 0.. akxk+1 = St = 1.. at-1xt. = «0, a0,a1,… »
=> G(x) – 3xG(x) = Sk = 0.. akxk - St = 1.. 3 at-1 xt.
= «a0, a1-3a0, a2-3a1,…»
= a0 + Sk = 1.. (ak - 3 ak-1 )xk = «2, 0,0,0…» = 2.
=> G(x) = 2/ (1-3x)
= 2(1+ 3x + (3x)2 + … )
Hence ak = 2 3k.
Transparency No. 7-51
Advanced counting techniques
Ex17: Solve the recurrence relation:
a0 = 1,
an = 8an-1 + 10n-1 for n > 0. (*)
Sol: Let G(x) be the generating function of the seq {an}.
By (*) we have an xn = 8an-1 xn + 10n-1 xn if n > 0
Since G(X) = «a0=1, a1,…»
G(x) – 1 = « 0,a1,a2,…» = « 0, 8a0 + 100, 8 a1+ 101,…»
= 8 « 0, a0,a1,…» + « 0, 100,101,102,…»
= 8x G(x) + (x + 10x2 + 102x3 + … )
= 8x G(x) + x/(1-10x).
G(X) (1-8x) = 1+ x/(1-10x) => G(x) = (1-9x) /(1-8x)(1-10x)
= (½) (1/(1-8x) + 1/(1-10x)) = (½) « 1,8,82,…»+ (½) « 1,10,102,..»
Hence an = ½ (8n + 10n).
Note: Using the method introduced in 7.2 is easier than using
generating function.
Transparency No. 7-52
Advanced counting techniques
Ex19: Show the Pascal’s identity C(n+1, k) = C(n,k) + C(n,k-1).
sol: Since (1+x)n+1 = (1+x)(1+x)n = (1+x)n + x(1+x)n,
=> C(n+1,k) xk = C(n,k) xk+ x C(n, k-1) xk-1
=> C(n+1, k) = C(n,k) + C(n,k-1).
Ex18: Show that Sk = 1..n C(n,k)2 = C(2n,n) using generating
functions.
pf: (1+x) 2n = [ (1+x)n ]2.
= «C(n,0), C(n,1),…,C(n,n)»«C(n,0), C(n,1),…,C(n,n)»
= «C(n,0)C(n,0), C(n,0)C(n,1)+C(n,1)C(n,0), …,
C(n,0)C(n,k)+C(n,1)C(n,k-1)+…+C(n,k)C(n,0),… »
Hence C(2n,n) =
C(n,0)C(n,n)+C(n,1)C(n,n-1)+…+C(n,n)C(n,0)
= C(n,0)C(n,0)+C(n,1)C(n,1)+…+C(n,n)C(n,n) -- C(n,k) = C(n,n-k).
= Sk = 1..n C(n,k)2
Transparency No. 7-53
Advanced counting techniques
Catalan Numbers
Find the number of ways to compute the product of a
sequence of n+1 numbers ?
Ex: input = 2,3,4 => (2x3) x 4, 2 x ( 3 x 4)
input = 2,3,4,5 => (((2x3)x4)x5), ((23)(45)), ((2(34))5),
(2((34)5)), (2(3(45)))
Equivalent problem(Section 7.1,Ex8): The number of ways to
parenthesize the product of n+1 number a0,a1,…,an.
Let Cn denote the number of ways to multiply n+1 numbers.
Then C0 =1 ---(1) ;
C1 = 1, C2 = 2, C3 = 5.
To find Cn, let the last multiplication be applied to the
results of the products of (a0,…,ak) and (ak+1,…,an).
As a result, Cn = Sk=0..n-1 CkCn-k-1. --- (2) // nonlinear
Problem: Is there a simple expression for the Catalan
number Cn? (Yes!)
Transparency No. 7-54
Advanced counting techniques
Solve the recurrence relation for Catalan numbers
Let G(X) = «C0,C1,…,Cn,…» be the generating function of {Cn}.
Then since Cn = Sk=0..n-1 CkCn-k-1,
G(x)G(x) = «C0,C1,…,Cn,…» «C0,C1,…,Cn,…»
= «C0C0, C0C1+C1C0, … , Sk=0..n-1 CkCn-k-1, … »
= «C1, C2, C3,…, »
G(x)2 x = «0, C1, C2,…» = «C0,C1,…»- C0 = G(x) – 1.
As a result, we have x G(x)2 –G(x) + 1 = 0,
and G(x) is [1+(1 – 4x)1/2] / 2x or [1 - (1-4x)1/2] /2x.
But we require C0 = 1 = lim x 0 G(x) = 1,
Hence G(x) = [1 - (1-4x)1/2]/2x.
(1-4x)1/2 = Sn=0…C(1/2,n)(-4x)n =1+Sn=1… (-2/n) C(2(n-1), n-1) xn
since C(1/2, n) = 1/2n C(2(n-1),n-1) / (-4)n-1 if n > 0 –see next
slide
Transparency No. 7-55
Advanced counting techniques
C(-1/2, k) = -½ (-½ -1)(-½ -2) … (-½ -(k-1)) / k!
= (-1)k (1 3 5 … (2k -1)) /2k k!
= (-1)k (1 3 5 … (2k -1)) (2 4 6 … 2k) / 2k k! (2 4 … 2k)
= (-1)k (2k)! / 2k 2k k! k!
= C(2k, k) / (-4)k.
Hence if n > 0, C(1/2, n)
= ½ (-½)(-½ -1)(-½ -2) … (-½ -(n-1-1)) / n!
= ½ 1/n C(-1/2, n-1)
= 1/2n C(2(n-1), n-1)/(-4)n-1
Hence G(x) = G(x) = [1 - (1-4x)1/2]/2x.
1/2x [1 Sn=0..C(1/2, n)(-4x)n ] =1/(2x) Sn=1.. 2/n C(2(n-1), n-1) xn
Sn=1.. 1/n C(2(n-1), n-1) xn-1
= Sn=0.. 1/(n+1) C(2n, n) xn
As a result, Cn = C(2n,n) / n+1.
Transparency No. 7-56
Discrete Mathematics
Chapter 7
Advanced Counting
Techniques
Transparency No. 7-1
Advanced counting techniques
Contents
7.1 Recurrence Relations
7.2 Solving Recurrence Relations
7.3 Divide-and-conquer Relations
7.4 Generating Functions
7.5 The Inclusion-Exclusion principle
7.6 Applications of the Inclusion-Exclusion principle
Transparency No. 7-58
Advanced counting techniques
7.3 Divide-and-conquer relations
f(n): resources (time or space) needed to solve a problem of
size n. Then
f(n) = a f(n/b) + g(n) : where
a : the number of subproblems
n/b : size of each subproblem
g(n) : cost for splitting problem and combining solutions
Problem: How to estimate the size of f(n) ?
f(n) = a f(n/b) +g(n) = a2f(n/b2) + a g(n/b) + g(n)
= .... = akf(n/bk) + Sj=0,k-1 ajg(n/bj).
Hence if n = bk ==> f(n) = akf(1) + Sj=0,k-1 ajg(n/bj) ----- (1)
Theorem 1: If f(n) = a f(n/b) + c, where a 1, b > 1 and c > 0, is
an increasing function, then
Notations:
log n = log10 n
f(n) = O(n(logba)) if a > 1 and
ln n = loge n
= O(log n) if a = 1.
lg n = log2 n
Transparency No. 7-59
Advanced counting techniques
proof:
Pf: If n = bk, by (1), f(n) = akf(1) + Sj=0,k-1 aj c.
If a = 1 ==> f(n) = f(1)+Sj=0,k-1 c
= f(1)+ck = f(1)+c logb10 log10 n = O(log n).
If a > 1 ==> f(n) = akf(1) + Sj=0,k-1 aj c
= akf(1) + c(ak-1) /(a-1) = ak [f(1) + c/(a-1)] - c/(a-1)
= c1 algbn + c2 = c1 nlogba + c2 = O(nlogba).
If bk < n < bk+1 is not a power of b.
==> f(n) < f(bk+1) = c1 ak+1 + c2 < c1a alogbn + c2 = O(nlogba ) .
Ex: If f(n) = 5 f(n/2) + 3.
=> a = 5 > 1; c = 3; b = 2. ==> f(n) = O(nlogba ) = O(nlg 5 )
If f(n) = 2 f(n/2) + 2
==> f(n) = O(nlg 2) = O(n) is linear.
if f(n) = f(n/2) + 2 --- binary search, then f(n) = O(log
n).
Transparency No. 7-60
Advanced counting techniques
divide-and-conquer relations(cont'd)
Theorem 2: If f(n) = a f(n/b) + cnd, where a 1, b > 1 and c,d > 0,
is increasing, then
f(n) = O(nd) if a < bd // nd dominates if #subproblems is small
= O(nd log n) if a=bd //every level of problems requires nd.
= O(nlogba ) if a > bd. // nd (conquer effort) has no effect.
Pf: f(bk) = a f(bk-1) + cbkd = a2f(bk-2) + c a1bd(k-1) + c bdk.
= .... = akf(1)+Sj=0,k-1 cajbd(k-j) = akf(1) + Sj=0,k-1cbdk(a/b)j
= f(1) ak + cbdk (1-(a/bd)k) / (1-(a/bd)).
case 1: n = bk. (k = logb n)
Hence if a < bd ==> f(n) = f(1) ak + cbdk (1-(a/bd)k)/(1 - (a/bd))
O(bkd) = O( (bk)d) = O(nd).
If a = bd =>f(n) = f(1) ak+ckbkd = O(kbkd) = O(nd logbn) =O(nd log n)
If a > bd => f(n) = f(1) ak + cbkd (1-(a/bd)k)/(1 - (a/bd)).
f(1) ak + cbkd (a/bd)k = O(ak) = (nlogba).
Transparency No. 7-61
Advanced counting techniques
The master theorem:
case 2: bk < n < b k+1:
=> f(bk) f(n) f(bk+1).
But O(f(bk+1)) = O(f(bk)), hence O(f(n)) =O(f(bk)). QED
Ex8:Fast integer multiplication:
A = (a2n-1 a2n-2 ... a1 a0)
B = (b2n-1 b2n-2 ... b1 b0)
AH = (a2n-1...an); AL = (an-1,...,a0); BH = ..., BL = ...
=> A x B = (2n AH + AL) x (2nBH + BL) = 22n AHBH + 2n(AHBL + ALBH) +
(ALBL)
=> f(n) = 4f(n/2) + O(n) => f(n) = O(n lg 4) = O(n2) - no improving !!
But AXB = 22n AHBH + 2n(AHBL + ALBH) + (ALBL) -- 4 multiplications
= 22n AHBH + 2n((AH+AL)(BH+BL)) - AHBH - ALBL) + (ALBL)
-- 3 multiplications
=> f(n) = 3f(n/2) + O(n) => f(n) = O(nlg 3) =O(n1.73)< O(n2).
Transparency No. 7-62
Advanced counting techniques
More examples:
Fast matrix multiplication:(Ex5)
one nxn matrix multiplication can be divided into
7 (n/2)x(n/2) multiplications + 15 (n/2)x(n/2) additions.
=> f(n) = 7 f(n/2) + 15n2/4
=> a = 7, b = 2, d = 2. => a > bd = 4.
=> f(n) = O(n lg 7) = O(n2.81).
Better than direct multiplication(=O(n3)) !!
Although even better result (O(n2.376 )) is possible.
mergeSort (A) { n = A.length ;
if(n < 2) return A;
B = mergeSort(A[0.. n/2 -1]); C = mergeSort(A[n/2..n-1]);
return merge(B,C); // this step takes time O(n)!!
} // f(n) = 2 f(n/2) + O(n) => f(n) = O(n log n).
Transparency No. 7-63
Advanced counting techniques
7.5 Inclusion-Exclusion principle
The principle: A, B : two finite sets
=> |AUB| = |A| + |B| - |A B|.
1
2
2
3
1
2
1
Ex2: #positive integers < 1000 and dividable
by 7 or 11 = ?
|A|+|B|+|C|
sol: let A ={x | x < 1000 and 7 | x}
B = {x | x < 1000 and 11 |x}.
1
1
1
=> |AB| ={x | x < 1000 and 77 | x}
0
1
1
=> |AUB| = |A| + |B| - |AB|
1
=⌊ 1000/7⌋ + ⌊1000/11 ⌋- ⌊1000/77 ⌋
= 220.
|A|+|B|+|C| -|AB|-|AC|-|BC|
Problems:1. |AUBUC| = ?;
2. |A1UA2UA3UA4| = ?
ans: 1. |A|+|B|+|C|-|AB|-|AC|-|BC|+|ABC|
Transparency No. 7-64
Advanced counting techniques
The general inclusion-exclusion principle
Theorem 1: |A1 U A2 ...UAn | = S1in |Ai| - S1i<jn|AiAj| +
S1i<j<kn|AiAjAk| - ... +(-1)n+1 |A1A2...An| ---(*)
pf: Let a be any element belonging to exactly Ad1,
Ad2,...,Adr. (i.e., ∉ Ad for d ∈ {1,…,n} - {d1,…,dr}.)
==> It is counted C(r,s) times by the sum:
S1≤j1<j2<...<js ≤n |Aj1 Aj2 ...Ajs|.
(note: C(r,s) = 0 if r < s).
==> # a counted by (*) = C(r,1) - C(r,2) + ... +(-1)n+1 C(r,n)
= C(r,1) - C(r,2) + ... +(-1)r+1 C(r,r)
= (-1) [ C(r,0) - C(r,1) + C(r,2) + ... +(-1)r C(r,r) ] + C(r,0)
= - (1-1)r + C(r,0) = 1
Transparency No. 7-65
Advanced counting techniques
7.6 Applications of the IE principle
Alternative form:
|~A1~A2... An)| = |~(A1UA2...UAn)|
= |U| - | A1UA2...UAn |
= |U| - S|Ai| + S|AiAj| -... + (-1)n |A1...An|.
Ai : set of elements having property Pi.
N(Pj1,...,Pjk) = #elements with properties Pj1,...,Pjk.
(i.e. N(Pj1,...,Pjk) = |Aj1 ...Ajk|. )
~Pj : the negation of property Pj.
N(~Pj1,...,~Pjk)) = #elements without any property of Pj1,..,pjk.
= N(~(Pj1\/...\/Pjk)) = |U| - |Aj1.. Ajk|.
N(~P1,...~Pn)
= |U| – SN(Pi) + SN(PiPj) - SN(PiPjPk) +... +(-1)n N(P1P2...Pn).
Transparency No. 7-66
Advanced counting techniques
Examples:
Ex1: x1+x2+x3 = 11, 0 x1 3, 0 x2 4, 0 x3 6.
==> #integer solutions = ?
Sol: let P1 = "x1 > 3"; P2 = "x2 > 4"; P3 = "x3 > 6".
=>#sol = N(~p1/\~p2/\~p3) = N(~(P1\/P2\/P3))
= N - N(p1) - N(P2) - N(P3) +N(p1/\P2) +N(P1/\P3) + N(P2/\P3)
- N(N(p1/\P2/\P3)
=> N = C(11+2, 2);
N(p1) = #sol with x1 > 3 = #sol of "x1' + x2 + x3 = 7" = C(9,2)
N(p2) = C(8,2); N(P3) = C(6,2).
N(p1/\P2) = #slo with X1> 3 and X2 > 4 = #sol of "x1'+x2'+X3 =
2" = C(4,2) = 6.
N(P1/\P3) = C(0+2,2) = 0; N(P2/\P3) = 0.
N(P1/\P2/\P3) = 0.
=> #sol = 78 - 36 - 28 - 15 + 6+ 1 + 0 - 0 = 6.
Transparency No. 7-67
Advanced counting techniques
More example
Ex2: #positive integers 100 and dividable by 4, 5 or 6.
A = {x : 4|x}; B = {x: 5|x }; C= {x: 6|x}.
=> |A| +|B|+|C| = [100/4] + [100/5] + [100/6] = 25 + 20 + 16 =61.
|AB|+|AC|+|BC| = [100/20] +[100/12] + [100/30] =16
|ABC| = [100/60] = 1. => #sol = 61-16+1 =46.
Ex3': |A|= m, |B| = n, m n. #onto function f:A -> B = ?
Let B = {b1,...,bn} and Pi = "bi is not in the range of the fun"
=> N(Pi) = |Ci|= |{f | f:A->B and bi ∉ f(A)}|.
#ontos = N(~P1/\~P2.../\~Pn) = N(~(P1\/...\/Pn))
= |U| - |C1 U C2 U... U Cn|
= nm - S|Ci| + S|Ci Cj| - ... +(-1)n |C1C2...Cn|
= nm - C(n,1)(n-1)m + C(n,2)(n-2)m -... +(-1)n-1 C(n,n-1) 1 m.
Transparency No. 7-68
Advanced counting techniques
more examples (cont'd)
Ex3: #ways to assign 5 jobs to 4 people s.t. each one is
assigned at least one job.
sol: m =5, n = 4.
#ways = 45 -C(4,1)35 + C(4,2)25+C(4,3)15
= 1024 - 972 + 192 - 4 = 240.
Ex4: [The hatcheck problem:] n hats randomly returned to the
customers. => What is the probability that no one receives
his own hat?
Transparency No. 7-69
Advanced counting techniques
Derangements
x1,x2,...,xn: a list
Any permutation a1,...,an of {x1,...,xn} s.t. aj xj for all j = 1..n is
called a derangement of the list.
Ex: 1,2,3,4,5 has derangement
21453 but not 21543
Let Dn = # derangements of n objects.
=> D1 = 0, D2 = 1, D3 = 2. (123 has derangements: 231, 312)
Theorem: Dn = n! (1- 1/1! + 1/2! +... + (-1)n /n! )
Pf: let Pi =def "a=a1...an is a perm of x1...xn s.t. ai = xi."
=> Dn = N(~P1/\~P2/\../\~Pn) = N(~(P1\/P2\/..\/Pn))
= N -SN(Pi) + SN(Pi/\Pj) -... + (-1)nN(p1/\../\Pn)
= n! -C(n,1)(n-1)! +C(n,2)(n-2)! + ... +(-1)nC(n,n)(n-n)!
= n![1 - 1/1! + 1/2! .. ].
=> solu of the hatcheck problem = Dn / P(n,n) = Dn /n! ∈[0.3,0.5]
= (1 -1/1! + 1/2!-...) e-1 = 0.368 as n .
Transparency No. 7-70